FATS AND OILS

Fats and oils are special esters.

fatty acids get attached to Glycerol and then they are called triglycerides
Most dietary fat is in the form of triglycerides

Fatty acids found in animal triglycerides are saturated ones

Fatty acids found in plant triglycerides are unsaturated ones

( exception - tropical oils)

When a fatty acid is with single bond between its carbon

atoms.
It has maximum number of hydrogen atoms and
thus forms a saturated triglyceride when attached to glycerol.
e.g.palmitic acid

When a fatty acid is with one or more than one double bond
and fewer hydrogen atoms attached to carbon chain. This is an
example of monounsaturated and polyunsaturated fatty acid,
respectively. When it attaches to Glycerol it forms unsaturated
triglyceride. e.g. linolenic acid with 3 double bonds and fewer
hydrogen atoms attached to carbon chain

The double bonds between carbon atoms, in an unsaturated

fat keeps the fat in a liquid form at room temperature. E.g. oils
Where as saturated fats stays solid at room temperature e.g. butter,
animal fat

Questions:
1. Write an equation for the formation of the fat formed when 3 molecules of
CH3(CH2)15COOH react with one molecule of glycerol
2. Write an equation for the formation of the fat formed when 1 molecule each of
CH3(CH2)15COOH, CH3(CH2)6CHCH(CH2)6COOH and CH3(CH2)3CHCH(CH2)3CHCH(CH2)3COOH
react with one molecule of glycerol