Вы находитесь на странице: 1из 23

C

cab �ý�; (Ʈ��, �� ����) �����


cabal =��, ��� ���
cabby �ý� �����
cabin �5θ�; ����
cabinet ����; ���; ����, ij���
cache :�� ���, ���� �����
cackle (��ż��) ������ ���; ��� ���.
cactus ������
cadaver (Ư�� �ΰ���) ��ü
cadet ��� �ĺ���; �߽;�, �����
cage ����, �츮; �츮 ������ ���
Cain ī��
raise Cain � ҵ �; ��8Ű��.
calamine Į��� *�Ǻ� � ҿ�f
calamity ����, �糭, ���
calculate ~; ����ϴ�, �����ϴ�; ~; �Ǵ��ϴ�, ���ϴ�; ��d�ϴ�; �‫ ���� �ٽ‬ϴ�; ��
ȹ�ϴ�.
calculation ���; ��� ���
caliber ū ��, ū ����
calisthenics ��ġ, ���, ǰ��; ���
call 1. ��û; �ʿ�; ����; ��d 2. ��ȭ�� �ɴ�; ~��� ���ϴ�, �����ϴ�, ���ϴ�.
call ~ on(upon) ~���� ~; �䱸�ϴ�(��Ź�ϴ�).
call for (��Ȳ ����) ~; �ʿ�� �ϴ�; (�Ҹ��� ��) ~; �‫ ��ٶ‬, �䱸�ϴ�.
call forth ~; �߱��Ű��, /���ϴ�.
call off ~; �����ϴ�, ����ϴ�.
call on �湮�ϴ�; (��v ��'��) û�ϴ�.
call on(upon) (������� �л�;) ��Ű��, �����ϴ�.
call on ~ to ~���� ~�� ��; �䱸�ϴ�.
call up (���;) �ҷ���8��, �����ϴ�.
call upon ~ to do ~���� ~�ϵ��� �䱸�ϴ�.
on call (�ǻ� ����) �θ��� �‫�ִ� �� ����� �ٷ‬, ����ϰ� �ִ�
call-in (��ȭ�� ����) ��û�� �� �wα߽�
calling �θ�; õ��, ���
calm 1. v����, �����; ��d�� 2. ~; ��������, ����ϰ� �ϴ�.
calm ~ down ~�� ��=; ����� �ϴ�, ��=; ��d��Ű��.
calorie Į�θ�
cam ķ *Ư���� 1���� ���� �Ǵ� �������� ��� ��ǰ
camcorder ķ�‫�ڴ‬
cameo ī�߽�, �簢 8�� ��� ����; /�� ��찡 � ����ϴ� v��,( ��ȭ�� �� ��䱸 � ���)
/������ ����
camera-shy ���� ����� �Ⱦ��ϴ�, ���� �����
camp 1. ķ��, ��Ʈ ��Ȱ; (���� ����) �߽���
�; ( �; ���� ��) ����, �� 2. ķ���ϴ�, �߽߽

�ϴ�.
campaign 1. �߽, ķ����, ������; ���� �ൿ 2. �߽; �ϴ�.
campaigner ~����; (dġ ����) �߽߽߽
��
camper ķ���ϴ� ���
campesine (Ư�� ��ƾ �Ƹ߽�ī�� �ε��) ���
can hardly wait to do ~�ϱ⸦ ��‫��� ���ٸ‬ϴ�.
Can it. v���� �‫ ������ �־‬, �‫�� ض‬.
canal ����; (���Ĺ� ü����) ����
cancel ~ out ~; ��f�ϴ�, ����ϴ�.
cancellation ���; ����; ����; ��ȿ
cancer ��
cancerous ����; �Ͽ� �ɸ�
candid ������, d����, �����
candidate �����; �����; ~�� ���� ���
candidly �����ϰ�, ��ź����
canine 1. �� 2. ����
cannon ����
cannot afford to do ~�� �� ���; ~�ϴ� ��; ��; �� ���.
Cantonese ���� ���
canyon ���
cap 1. ����; (���� ����) ����, �ְ� �ѵ� 2. ~ �� ����; d �ϴ�.
capability (~�ϴ�) ��, �ɷ�
capable /����, �ɷ� �ִ�
be capable of diong ~�� �����ϴ�, ~�� �� �ִ�.
capacity (�߽� ������) �ɷ�; ���<�; ��� �ɷ�, d��
be filled to capacity ������ �.
cape ��, ��; the Cape ��z�
Cape Canaveral ������ ij������ *�� � �÷θ����� ���� �‫ؾ‬ȿ� �ִ� ��.
capital 1. ��; ��߽��� ; ���ֿ�
; ���‫ �ں‬.2 �‫������ �ں‬, ������
capital gain �‫ ����* ���� �ں‬/����� ���� �λ� ���� ��� ����
capital surplus ��߽��� �‫��� ں‬
capitalism �‫�����ں‬
capitalist �‫ �ں‬,���‫�������ں‬
capitalistic �‫���������ں‬, �ֺ����ǿ� �����
capitalize on ~; �� ��ϴ�, ƴŸ��.
Capitol �� ��ȸ �ǻ��
Capitol Hill ��
� ��ȸ
capsule ĸ�� *����� ���� �ȿ� ��ġ�Ǿ� ���� ���� ����� �� �ֵ��� �ǵ��� ��: ��
��
Capt.(=Captain) ~��, ����; (������) ����; ���
captivate ~�� ��=; ���Ѵ�; ~; ������ �ϴ�.
captive 1. ��� 2. ��ΰ� ��, �������
captive audience ��ΰ� �� û�� *��� ����ö�� ��: Ż�Ϳ��� ������ ������� �Ϲ�
��8�� ���� ���߸� �ϴ� ����; ��Ī�Ѵ�.
captivity ������� ��, ����� �ż�
capture ~; ���, �����; ~; a���ϴ�, ~; ���ϴ�; (���, ��= ��;) ��η� �ϴ�.
cap ~�� ����; d�ϴ�.
cap �߽�� ����
capability �ɷ�, ��
caravel ���� ��, ij���� *16����� ������ �߽�� � ���� ��: ��
carbon dioxide ���ȭź��, ź�� ����
carbon-copy ���� �Ȱ�:, ����ϰ� �߽�
carcass ����, ����; (����, �� ����) ��ü
card ����; Ʈ����, ī��
cardboard box ������ �‫�ڽڽ‬
cardiac arrest ���� d��
cardinal 1. �߱�� 2. �䱸� ��� , �ֿ���; ��ȫ����
cardiopulmonary resuscitation ���� ��� �һ�
cardiology ������
cardiovasculat ���� �����
care 1. ������; ��d; ����
care about ~; ������; ~�� ����� �ִ�.
care for ~; �~��ϴ�.
couldn`t care less about ~�� ���� ����� ���, �� ��� �ƴϴ�.
Take care! (�‫��ۺ‬λ��) ��, �߽�, �� ��.
take care of ~; ������; ó���ϴ�, ������ �ϴ�.
careen (��) ��䱸�䱸 �����ϴ�.
career ���; ���, �� �; (���忡����) ����, �⼼
carefree ��d�L��, ������
caress �ֹ��ϴ�, ���‫��ٵ‬.
caretaker ��ȣ��, �İ���
cargo ����, (�������) ȭ��
Caribbean ī������ (����)��
caricature 1. dz�� ��ȭ ; ��ȭ ȭ 2. ~; ��ȭ ȭ �ϴ�, dz��ȭ �ϴ �.
carnival ��0f, ī�Ϲ�
carpal tunnel syndrome ���� ���ı� *����� ���8�� ���� ���� � �ո� �߽ ���� ��
�� �‫��� �ٷ‬ϸ� ��8Ű�� ��ȯ
carport ���� ���
carriage (4��) ����
carrier ����ϴ� ���; �����; �‫ �װ‬ȸ��
carrot-and-stick ȸ/�� '����
carry ����ϴ�; ó���ϴ�; ~; /���ϴ�, ��/�ϴ�.
carry away (����, ���� ����) ~; �����, ��������.
carry in ~; ������, ����ϴ�; �ḻ; ���, û���ϴ�; (��f��8��) �����ϴ�, ��; ��
��.
carry it off �‫���س‬, ��Ƽ��.
carry on (��ȭ ��;) ����ϴ�, �����ϴ�.
carry out ~; ������; (��ȹ ��;) �����ϴ�, �ǽ��ϴ�; ~; �߽��ϴ�, �����ϴ�.
carry through ����ϴ�.
cart ���, �ְ�
cartel ī����, ��� ����
cartoon (�ַ� dġ����) dz�� ��ȭ, �û� ��ȭ; ��ȭ ��ȭ, ��ȭ
cartoonist ��ȭ ��ȭ��, dz�� ��ȭ��
carve ����; ����.
carve out ~; �߶ � ���� , (���� ��'��) ��ô�ϴ�.
case ���, ���; �Ҽ�, ����; (����� �dz�; �����ϱ� '��) ���, ����; ���, ��d, ��
��; ����, ����
It is the case that ~��� ���� ������, ~��� ���� �� �ִ�.
just in case ���Ͽ� ����Ͽ�
rest one`s case ��� f��(�� ����); ������.
cash in (��f��8��) �����ϴ�.
cash in on ~8�� ��; ���; ~�� ��; �ɴ�; (����; ��� '��) ~; ����ϴ�.
cash basis �������
cask ��, �배: ���
casket ��; ��: ����
cast 1. ��v��, ����; �����, ����; �迪, �߽ ���� 2. ~; �����, �������; (�Ҿ�, ��
�� ��;) �����.
cast A as B A�� B�� ��8�� ���, A�� B�� �迪�ϴ�.
cast off ~; �߽��δ�, ���.
castrate �ż��ϴ�, ���Ҹ� f���ϴ�.
castration �ż�
casual �쿬� ,� �����; ������; �Ǵ� �����, �����, ij�����
casually ������, �쿬� �
casualty (����, ���� ����) �����(��), �����(��); ���(��)
let the cat out of the bag ���; �����ϴ�, ����� �����Ǵ�.
catalog īŻ�α�, ���
catalyst �˸�; �˸����� ����; �ϴ� ��(���)
catastrophe �����; �ҿ�, ����, �糭
catastrophic �뺯� ���; �ĸ�����, ����� �ḻ��
catch 1. ��d, �� 2. �����.
catch hell ��; �߽�.
catch on �α⸦ ���; /���ϴ�.
catch on with ~����
��� /���ϴ�.
catch up with (����;) �����ϴ�; (����;) ü���ϴ�; (���� � ��8��) �����ϴ�, ��
f���; �� �.
߽ ߽
catchy ����� ��=; ��� ����, ����
ο ����ϱ� ����
categorize ~; /���ϴ�. �з��ϴ�.
cater (=����) �‫� �غ‬ϴ�, ����ϴ�; �6�; f���ϴ�; �䱸� �����ִ�.
caterer ��ȸ �����, =�� v����
caterpillar �ֹ�, ����
catharsis dȭ, īŸ���ý�
cathartic īŸ���ý�(d���� dȭ)��
cathedral �뼺� ,� ����
Catholic 1. ī�䱸 � ���, ������ 2. ī�䱸 � �����, ��������
Catholicism ī�䱸� ;� ī�䱸� ��ž�
cathouse â����, ���߽
cattle ��
Caucasian 1. ��ī���� ���; ���� 2. ��ī���� ��~��, ����~��
cause 1. ����; ����; (��ȸ����) ���, ����, ���� 2. ~; ��8Ű��, ~�� ������ �Ǵ�; ~;
�ʷ��ϴ�.
caution 1. ����, v��, ���� 2. (~��;) �����ϴ�; ���� ���� �δ�.
cautionary �����, �ư���, �������
cautious ���� ��:, v�ɼ� �ִ�
cautiously �����ϰ�, v�ɼ� �ְ�
cavairy �⺴(��)
cave ����, ����
cave in to ~�� �߽��ϴ�.
caveman (Ư �� ���� �ô���) �����
cavity ��ġ
cease �����ϴ�.
cease from diong ~�ϴ� ��; �߽��δ�.
cease-fire d��, ���� ����
cedar ���� ���
cede ~ to ~���� ~; �䱸�ϴ�.
ceiling õ��
celebrate ~; �����ϴ�, �ູ�ϴ�; ~; ����ϴ�, ����ϴ�; ~; ���� �˸���; ~; ���
�ϴ�.
celebration ����, ���ϸ���; Ī��, ���
celebrity /����, ���; ��, ���
celestial �ϴ��� õü��
cell ����, ��: ��; ����
cell-phone �߽� ��ȭ
cellar (�ķ�ǰ, ���� ����) ���� �����
cellmate ��: ���濡 �ִ� ���; ������
celluloid 1. ��������; ��ȭ 2. ��ȭ��; ��ȭ�� ����
cement �ø�Ʈ, ��ũ��Ʈ
cemetery ������, �� ����
cenotaph ����
censor 1. (���ǹ�, ��ȭ ����) �˿� ��� 2. ~; �˿��ϴ�; ~; �˿��� ��f�ϴ�, ������
��.
censorship �˿�
census ���� v��, �α� v��
cestenary ���f
center 1. �߽�; �߽� �ü�, ~� �ü� 2. ~�� �߽�; �δ߽.
center around ~�� �����ϴ�, ~; �߽�8� �ϴ�.
Centers for Disease Control �� �䱸 � ���*���� '�� �� �ⱸ ���� �ִ� �� ��,
�8���� ;�� �‫� �� ��ڸ‬ü�.
centerpiece (då, ��ȹ ����) �ֿ� Ư ¡
central �߽���
�, ߽� �; ����ϴ�
be central to ~���� �߽��ϴ�
�, ~ � ߽� ���
� Ǵ� .
Central American �߽� �Ƹ߽�ī��, �߹���
centrifugal force ��ɷ�
century �� ���� �������
cereal �߽߽߽
��
cerebral �������, ������
cerebral palsy ����
certain Ưd��, d����; �߽, ��d��; Ȯ���ϴ� ٰ ���ϴ�
make certain ~; Ȯ���ϴ�, �‫�~ ��ݵ‬ϵ��� ���ϴ�.
certainty Ȯ�Ǽ�, �ʿ���; Ȯ��, ����
certificate (~��) ���, ��
certified of deposit ���� ��; �䱸 � �����d�䱸� �
certified public accountant ���� ȸ���
certify �����ϴ�, �����ϴ�.
CFC(CFCs=chlorofluorocarbon) �w��
chafe at ~���� ȭ�� ����, ���� �8���.
chagrin �����, ����
chain ����, f��
chain 1. �罽; (~��) ����, ����; ü��a 2. �䱸� ��Ŵ�.
chain reaction ���� ����
chairman ����, '����
chalet (���� dz��) ����; ���� *��'�� ����� ��
chalk up A to B A�� B�� ��8�� ������.
challenge 1. ����, ������ �ִ� ��; ��f, ���� 2. �����ϴ�; ~�� ���Ǹ� ��û�ϴ�; ~�� d
�缺; �ǽ��ϴ�.
challenge ~ to do ~���� ~�϶�� �ο�; �ɴ�, ~�ϱ⸦ �����ϰ� �䱸�ϴ�.
challenging �ǿ�; �����; �����ִ�; ����; �����
chamber ��; ħ��; ȸ����; ��; (�Թ� �����) ����, �ǿ�
chamber of commerce ��� ȸ�Ǽ�
chamberlain ��~, �����
champ �����, è�Ǿ�
championship �����
Champs Elysees ��i��f �Ÿ�
chance 1. ���ɼ�, ���; �쿬, ��� 2. �����ϴ�, �‫���غ‬.
take a chance ���ϵ� ���ϵ� �‫���غ‬.
chancellor (�Ϻ� ������ �б�) ����
change 1. �‫��ٲ‬Ա�, �‫�� ��� ; ��ܵ� ;�� ;�� �ٲ‬ȯ 2. ȯ���ϴ�.
channel 1. ���‫��� ;�ٴ‬, ��Ʈ; ä�� 2. (��� ��;) ������, ������.
chant 1. �뷡; ��âv, ��v�ο� ��Ʈ 2. (���� ��ȣ��) ��f�� ��ġ��; (���� ��;) ���
�ϴ�, �뷡�� ����ϴ�.
chaos ȥ��, ȥ�� ����
chaotic ��ȥ����, ������
chapel (�б� ����) �����, �����, ä��; (���� ��ȸ��) ��ȸ��
chaplain (�����) ��ȸ��; ����� ���
chapter (å ����) ��; ���, ��ȸ
character ����, Ư��; �ι�, �ΰ�; (��� ����) ���� �ι�, �迪
characteristic Ư��, Ư��, Ư¡
characterize A as B A�� B�� �����ϴ�.
charade ���� �䱸�‫�(���� ����ٺ‬ൿ)
charge 1. û�� �‫�ݾ‬, ���, ���; (~��) ����; ��ȣ,����, ����; ��å, ��, ��� 2. ~���
���ϴ�, ����ϴ�; (��� ��;) û���ϴ�.
be in charge of ~; ������ �ִ�, �����ϰ� �ִ�, ���ϰ� �ִ�.
charge A B A���� B�� û���ϴ�.
charge A for B A���� B�� ���; �䱸�ϴ�.
charge A with B A�� B�� å�ϴ�, A�� B�� ��/�� ����ϴ�(����ϴ�).
in charge of ~; ����Ͽ�
on the charge that ~�� �˷�, ~��� ���Ƿ�
take charge �� ���ô�.
take charge of ~; �����ϴ�, �ô�.
chargeable �� ҵ Ǿ �� ��, (��, å��;) n�� ��
charged �����; ������; ��d����
chariot �Ǹ��� ����, �ɼ�
charisma ���; ������ �ŷ�, ī������
Charismatic Movement ī������ �߽ *����; �߽Ҵ ‫�� ��� �ٴ‬ü �߽
charitable �‫�ں‬ο�, �‫���ڼ‬
charity �‫�� �ڼ‬ü; �‫��� �ڼ‬
charlatan ��¥ �ǻ�, ������ �ǻ�
charm �ŷ�, ����; �ֹ�, ����
chart 1. ��ǥ, �2���߽. ~; ��ǥ�� �ϴ�; (��ȹ ��;) �����; ~; ��Ʈ ��Ʈ�� �ִ�.
chase after ~�� �‫� �ڸ‬Ѵ�.
chasm �� ƴ; �տ�
chaste �������� ���襤; ǰ' �ִ�, ���õ�
chastity ���, d��
chat 1. ���, ��� 2. ����ϴ�, ����ϴ�.
chat about ~�� ���� ����ϴ�.
chauvinism ����, ����
chauvinistic ������ �ֱ�����; ������ ���� ������
cheap shot ���� �ൿ
cheat 1. ���Ӽ�, ���; Ŀ�� 2. ~; ���� �, �����; �ϴ�; ���Ӽ� ����.
check 1. ��f, f��; ��ǥ, ��꼭; ��ǥ 2. ~; �ñ��, �δ�; ~; v���ϴ�, �˻��ϴ�.
check back �‫����� �ٽ‬ϴ�.
check in 1. üũ �� 2. ��ο� �����ϴ�; üũ���ϴ�.
check in with ~�� �����ϴ�, �����ϴ�.
check out 1. üũ �ƿ� 2. ~; ��v�ϴ�; v���ϴ�, �˻��ϴ�; v���Ͽ� Ȯ���ϴ�; v����
��.
checks and balances (�Ƿ���) ��f�� ���� *��Ǻи��� ��: �ǹ� � ���δ�.
checkbook ��ǥå, ��ǥ��
checkpoint (����) �˹���
checkup �˻�; ����
cheekbone �����
cheer 1. ��ä, ȯȣ 2. ȯȣ�� ���, ~; �����ϴ�, ~���� ��ä�� ������.
cheer up ����� ����.
cheese ġ��; �ŷ����� �: ����
chef �䱸� ,� �ֹ���
Chekhovian üȣ�� dz��
chemical 1. ȭ�� fǰ, ȭ�� ��ǰ 2. ȭ������
Chemical Mace �ַ� ����, �ɹ��� ���� �
chemically ȭ�л�, ȭ����8��
chemist ȭ����
chemistry ȭ��, ȭ�� ����; (�‫�ڿ‬, ���� ���� ����) �‫�ۿ‬
chemotherapy ȭ�� ���
cherish (�繰;) ������ �ϴ�.
chest ����, ��
chew ~; ����, ������ ��ó�� ����.
chic ���ִ�, ���õ�
chicken out �߽��δ�, ������ ��; ����.
chicken pox ���
chickpea ���Ƹ��� */�� ����, ���� ��� �Ŀ�8�� ���Ǵ� ��
chief ���� ����; (�� � ����) w��, ����
Chief Executive �� � �����
Chif Judge �� ���ǰ� *�� ������� ���� �� ���� �ְ� ������; ����Ų��.
Chihuahua ġ�Ϳ�*� ‫�� ���߽ ��ڻ‬: ��
child-care /�� ��0��
childbearing �����, ��� ������
childbirth ���, �и�
childhood � ����, /�� ����
childproof ��� ��� ������, ����䱸 �‫�ִ� �� �ٷ‬
child's play ���� ��, ������ �� �� �ִ� ��
Chile ĥ��. ĥ�� ��ȭ��
Chilean 1. ĥ�� ��� 2. ĥ����
chili ĥ�� *ĥ���� ���߷� ���� �� ŷ�
chill ������, �Ĵ�; ��d�����; ��d�ϴ�.
chilling �ѱⰡ ���� �; �ô���, �ҽ ���
chilly ��, ���
chime (~ ����) ��� �����.
chimpanzee ħ����
chin ��
chin up ���; ����, ��⸦ ����.
China ��ȭ �ι� ��ȭ��, �߱�
Chinese �߱���; � ߱ � ���
chink (�����8��) �߱� ���
‫ڰ‬
chip 1. v��, (���� ����) ��: v��; �‫�ݵ‬ü ����, (���‫��ڰ‬п�) Ĩ *���� ȸ�θ� ���� ��
���� ��: �‫�ݵ‬ü v�� 2. ~; ���.
chiropractop ô�� ��d ��� ��� ��
chlamydia Ŭ����� ������ *������ ��~
chock-full �� ��
choice �‫������ �ٸ‬, ����� ���
make a choice �����ϴ�.
of one's choice �‫������ �ڱ‬, ������ ������
choir (��ȸ��) ������, ��â��, �Ǵ�
choke ~; ��Ľ�Ű��; (�� ҿ�) �����ϰ� �ϴ�, �� ä���.
cholesterol ��߽���
���������
�‫� ��� ݷ‬
chop ~; ���.
chop down ~; (���� ��8��) �‫���ڸ‬, ���.
chop off ~; ����, �߽߽߶ �.
chop up ~; ���ð� ���, �߰� ���.
chopper �߽߽߽߽߽
����
chopstick c����
chord �ɱ�, ��d
chore �ϰ�, d���� �ϰ�; ����, ��䱸� �
choreograph �ȹ��ϴ�; �ȹ��� ����ϴ�; ~; �����ϴ�, �����ϴ�.
choreography �ȹ�
christen ~���� �����ϴ�; �����Ͽ� ����ϴ�.
chromosome ����ü
chronic (����) ������
chronicle 1. �����, ���� 2. ~; ����߽ �ƴ�; ~; �����ϴ�; ����ϴ�.
chrysalis ���; �‫� �غ‬ô�, ���
chrysanthemum ��ȭ
chubby (���, �� ����) ������ ����, ������
chuckle 1. ųų ��� ��= 2. ųų ���.
chump ���� �Ӵ� ���, �‫�ٺ‬
chunk ����� �‫)��(�ݾ‬
church ��ȸ, ����
Church of England ���� ����ȸ, ����ȸ
church service ����
CIA(=Central Intelligence Agency) �� �߽� d���
cigar ���‫�ۿ‬, �ð�
cigarette (~��� ��) ���
circle ���� ����, ���߽�; �� , ���, ��ȸ
circuit ����, ����; ȸ��, ȸ��; �‫������ ���ڵ‬, ��Ŷ
circuit board ȸ�� ���� *���� fǰ �Ǵ� �x�Ʈ ȸ�� � �����ϴ� ����
circulate (���, ��� ��;) ��ȯ��Ű��; (���‫ )�ڸ‬/���Ű��; (�ҹ� ����) �����.
circulate around ���Լ� ���8�� ��ȯ�ϴ�(�����).
circulation (���� ����) ���� �μ�, ���� �μ�; �Ǹ� ����; /��
circumstance (��'��) ��Ȳ, ȯ��, ����, d��; �쿬, ��
circumstantial evidence ��Ȳ ���, ��b ���
circus �߽, ��Ŀ��; ��Ŀ����
cirrhosis ���溯, ����ȭ
citation ����, �ο�(��); ��ȯ(��), ���� '�� ����
cite (�Ƿ�, ��� ��;) �ο��ϴ�, ���; ���ν� ~�� ����ϴ�; ��ȯ�ϴ�.
citizen �ù�; �Ϲ���
citizenry �Ϲ� �ù�
citizenship �ù��� �ź�; �ùα�; �ùμ�, �ù����� �ൿ, ��α�
citric ��������
city hall �� û��; �� �籹
city planning ���� ��ȹ
city slicker ��ȸ�� ���� �� ���
civic �ù���; �ù�����; ����
civics (�а�μ���) ���; ��� ����
civil ������, ������; ���
civil libertarian �ù��� ��/������, �ù��� ��/ ��ȣ��
civil rights movement ��α� �߽
civil war ����, ����
the Civil War ��
� ���� ����
civil-rights�ùα���, ��α���
civilian 1. �Ϲ� ����, �ΰ���, �� ����� 2. (����, �����‫������ )���� �ڿ‬, �Ϲ�
�ù���,
�����
civility ���� �‫�ٸ‬, d��
civilization ����; ����ȭ �Ǵ� ��
civilize ~; ����ϴ�, ����ȭ�ϴ�.
civilized ����ȭ��
clad ��; ��:
clad in ~; ��:, �� ����
claim 1. (����, ���� ����) ��� �䱸, ��� �䱸, ���� 2. ~��� �����ϴ�, �ܾ��� ϴ�.
claim tag ���Ϲ� ��ȯ��
clamor ��ġ��; �����.
clan ��w, ��
clandestine �����, ���� �ϴ�
clap �‫ �ڼ‬,������ �‫�� �ڼ‬ä�� �ϴ�.
clapping �‫ �ڼ‬,�‫�� �ڼ‬ä
clarify ~; �и��� �ϴ�, �����ϱ� ���� �ϴ�.
clash (�ǰ� ����) �浹; ����ġ
clasp �ɼ�, ��Ŭ
class ���, ����; ��ȸ�� �ź�, ��ȸ�
class struggle �������
classical Ŭ������, ������
classification �з�, ����; ��� �ű�
classified ��� �����; �߽���
classified ad �з� ���� *�Ź���� ���� �߽ ����, ����, ���� �Ÿ� ��; �߽߽� ��
���� �Խ��� ����
classroom ����
classy ����, �����; �ź��� ��:
clause (������) ��; (��� ��8��) v��, ���
clean �����, û����
clean ~ up ~; ����� �ϴ�, dȭ�ϴ�.
߶ �, ��8� �߽߽
clean fish ���; �߽߽ ߶ �.
clean up d���ϴ�.
cleaner's ��Ź��
cleanliness û��, �����
cleanup û��, ��f
clear 1. Ȯ���ϴ�, �����ϴ� 2. ó���ϴ�, f���ϴ�.
clear one's name �8�; �Ĵ�, ��Ȥ; Ǯ��.
clear the way for ~�� ��ָ� f���ϴ�, ~; ���� �ϴ�; ~�� ���� �‫� �غ‬ϴ�, ������ ��
�� �ϴ�.
clear up ����� û���ϴ�.
clear-cut Ȯ����, �и���
clearance ����� ġ���, f��; ��� ���� ��� �㰡
clearly ��Ȯ�ϰ�, �и��ϰ�
clergyman ������, ���
clever ������; �����; ������
click ���� �Ҹ��� ����; ���� ��‫��� ;�ݴ‬콺� ���ư; ������, Ŭ���ϴ�.
client �Ƿ���, �����; ��; (���� ��� �߽��
�) ��� ; �߽� ���
clientele ��; �ŷ�ó
cliff ��������, ��
cliffhanger ��ȸ �տ� ��; ��� �ϴ� ��䱸� ������� ���� �����潺 �wα߽�; ����
���� �տ� ��; ��� �ϴ� ��Ȳ
climaate ����; dzv, ����, d��
climb �8���.
climb to ~���� ����‫� �ؼ‬䱸�ϴ�, �����ϴ�.
climber ��갡; �䱸� ����� , ���Ӿ��� �䱸� ������ϴ� ���
climbing ��������, ���8���
clinch (�dz� �߽) ���; ���; (�ŷ� ��;) �ŵ����.
cling (~��) �����ϴ�, �����ϴ�.
cling to (��, �0� �߽) �Ŵ߽���, �����ϴ�.
cling on to ~���� �Ŵ߽���.
clinic (��d ��; '��) ����; ���� ����, ����; ����(�� �ǻ�); �ӻ� �ǻ�
clinical �ӻ���, �ӻ� ġ����
clip ����: ��ǰ; ��: ��ǰ; (�Ӹ� ��;) ��=
clique ��Ÿ���� �����, �Ĺ�
cloak 1. ����, �Ҹ� ��� ����; :�� ���, '�� 2. ~; ��ġ��.
cloak-and-dagger =����; ������ Ȱ����
cloakroom �߽�ǰ �����; �Ϲ� �����
clock (�߽ �ӵ���) ����ϴ�, ~�� �ð�; ���.
around the clock 24�ð� ���8��; ���Ӿ���, ���� �ʰ�
clock radio �ð 谡 ��: ����, Ÿ��Ӱ� ����� ����
clone ���� ��ĵǴ�, Ŭ��; �����.
close 1. ��, �ḻ 2. d����, ����; ģ��, ģ����; �����, ��b�� 3. ~; �����ϴ�, ����
��.
close down ��a�ϴ�, ����ϴ�.
close to 1. ~�� �����, b���� 2. ~�� ���Ͽ� �‫ ��״‬,�‫�ݴ‬.
close to call ��d�ϱ� ���, b����
close up ~; b��, �‫�ݴ‬.
close call '�� �Ϲ�, ���� �ϻ�
close-up ����� �Ÿ���
closely ����ϰ�, ����ϰ�, ���� ���; ������; ����Ͽ�
closeness ģ�а�, ģ�а�
closet 1. ��� ����, ���� �ִ� ���� 2. �‫�� ���ڽڽ‬ü�� ���, �����
closing ��a��, ������
clothes �Ǻ�, �Ƿ�; ��Ź��
cloud 1. ����; (���� ����) ū �� 2. ��ο� �‫����� �߽��ڸ‬.
cloudy �帰
clout ���� �����, dġ�� �����; �Ƿ�, ����
clove (���� ����) ���ΰ�
clown ����; �ͻ�
cloy (=�Ĺ� ��'��) ������, �ʹ�Ӹ��� ����.
club (�߱���) ����
clue (��f�� Ǫ��) �Ǹ���, �ܼ��
never have a clue �8��������, ���� �� �� ���, ������ ���� �ʴ�.
clump (����, ���� ����) ���
cluster (��, ���� ����) ����; ����
clutch ~; �� ���.
clutter ~; ��߸���.
Clydesdale 1. Ŭ�����߽��
�~ � �� 2. Ŭ�����߽���~ �
co-author ������, �� ������
co-ed 1. (������) ���л� 2. ���� ������
co-op's ��Ȱ �� v��, �Һ��� v��
co-opt ~; ����ϴ�, ��� �����.
co-option (�‫���ݴ‬, �Ҽ� �߽���) ���
co-producer �� f����, �� �����
co-star 1. ����, �� ��Ÿ 2. ���� �����ϴ�.
coach 1. ��ġ; (��
��౸ ���� ) ����; ����, �� 2. ~; ���ϴ�, ��ġ�ϴ�.
coachable ���� �� �ִ�
coal ��ź
coal mine ź��, ź��
coal-mining ��ź ä����, ź������
coalesce �����ϴ�; �յ��ϴ�.
coalition ��üȭ, 6��; (�Ͻ����� dġ��) ����, �յ�, f��
Coast Guard �‫���� �ؾ‬
coastal �����, ������
coastline �‫ؾ‬ȼ�
coat ǥ��; ����.
coattail (�νõ� ��'��) ����� �‫���( ;�ڶ‬ſ���) ���� ���� �ĺ��‫� ���� �ڸ‬缱��Ű��
���� ����� ��
cob �|�� �Ӵ�
cobblestone (����뿡� ����Ǵ�) �‫�ڰ‬, v�൹
‫ڰ‬
cocaine ��ī��
cochair ~�� �� ����; �ô�.
cockamamie 1. �߽��Ͼ��
� � 2. ߽߽߽߽߽߽
� ��Ͼ��
cocktail Ĭ����
cocky �ǹ���, �߳� ô�ϴ�
cocount palm ���‫���� ���ھ‬
coconut shell ���‫���� ������ �ڳ‬
cocoon (���� ��'��) ��ġ; ����, ��ȣ �Ǹ�
coddle ~; �����ϰ� ������, �<����� � �⸣��.
code ����, ����� ��뼺; ��Ģ; (�ൿ, ��ȸ ��Ȱ����) ����, ���; ��ȣ, ��ȣ
coed ���� ������
coeducational ���� ������
coerce ��f�ϴ�, �����ϴ�.
coercion ��f��, ��з�
coexist ��x�ϴ�.
coexistence ��x
coffin ��, ��
cog ��Ϲ���
coif ~; v���ϴ�.
coin ��ȭ
coincide with ~�� ���ÿ� �Ͼ߽��
�; �ġ �ϴ�.
coincidence ���� �߽�; (߽ 쿬��) ��ġ, ��ġ
coincidentally ���ÿ�; ��ġ�‫�ؼ‬
coking coal a��ź, ��ź
col. 0�� ���, ������
cold �߽�, ��� ѷ �� �߽��
�; ( �) �d ��, ħ����
cold feet ��
Cold War (f 2�� ������� �ĺ��� �ҷ� �‫���� ���� )�������ر‬
collaborate �� �����ϴ�.
collaboration ����, �� f��
collaborator �� f����; �����
collagen ������, �‫��ݶ‬
collapse 1. ������, �‫� ;���� ;�ر‬ҽ� 2. (�����) ��������, y���ϴ�; (�ǹ���) ������
��, �‫��ر‬ϴ�.
��� ����) Į��, ��; (�� ����) �����; (�˼�, �뿹 � ���
collar (���� ) w��
collateral �䱸 � ���, ���
colleague ����, ������
collectable ����� ����ǰ
collectible ����ǰ
collective �����, ������
collective security ��� ���� ����
collectively ������8��, �Ѱ��Ͽ�
collector's item ������ ��ġ�� �ִ� ����(ǰ��)
collegial ��������; ��ü v����
collide with ~�� �浹�ϴ�.
collision �浹, �‫�ݵ‬
collision course �浹 �뼱; �浹�� �� ��� ��d
cologne �5��‫ݷ‬δ�
colonel ���
colonial ������; �� ��
colonialize ~; �Ĺ���ȭ�ϴ�.
colonize ~; �Ĺ���ȭ�ϴ�; ���ֽ�Ű��.
colony �Ĺ���; (~�� ��: ������) ����; (���� ����) ����, �‫ݷ‬δ�
color 1. ��; (/�� ��~��) �Ǻλ�; Ư��, ���� 2. (��;) ĥ�ϴ�.
color-blind �����, �����; ��~ ����� ���
colossal ū, ��Ը���
Columbus �‫ݷ‬ҹ�
columned ���ְ� �ִ �, ��������
comatose ȥ�� ������, �λ�Ҽ���
combat 1. ����, �ο� 2. ~�� �ο��.
combat-ready ���� �‫������ ���� ﰢ‬
combatant �����, ���� ���
combination v��; ����, ����
combine ���ϴ�, ����ϴ�.
combined ������, �յ���; ��ģ
comb through ~�� �������� ����ϴ�.
combustible ��������, Ÿ�� ����
combustion ����
come �4�; ����; �Ͼ߽���; �Ÿ ����.
come about (����) �Ͼ߽���, ߽߽߽߽߽
��ϴ� .
come along ��Ÿ����, �����ϴ�.
come and go �Դ� ���� �ϴ�, ������ �Ⱥ����� �ϴ�.
come around ��½ ��Ÿ����, ã�ƿ4�; �ǰ�; �‫�ٲٴ‬, ��v�ϴ�.
come around to (���� ���� � �ܱ Ⱓ) ~ �� �湮�ϴ�.
come as one is ���8�� �4�.
come away with �߽ (��d, �λ� ��); ����.
come back ���ƿ4�; ȸ���ϴ�; �����ϴ�.
come down (��� ����) �������, �������; (�ǹ���) �������.
come down to �߽ ~�� �Ǵ�.
come forward ������, ����ϴ�.
come forward with ~; �����ϴ�, �����Ű��.
come from ~�� ���� ������, ����.
come into (�߽�, Ȱ�� �߽) ��߽�� �, ��ϴ� , �����ϴ�.
come into play ȿ�� ���� �, ����; ���ϴ�.
come into power d��; ����ϴ�.
come in with ~�� ���ϴ�, �����ϴ�.
come of age ������ �Ǵ�, �ѻ�� ��; �ϰ� �Ǵ�.
come off (�����) �Ͼ߽���; ( �ȹ ����) �����ϴ�; ������, ���p���; ~; �߽��δ�, ���
ġ���.
come on ����� �‫ ;�ض‬aa ����4�.
come one's way ~�� �� �Ͼ߽�� �, ~ � ��� ߽ � ������ .
come out ��Ÿ����; ��Ȯ�ϰ� ǥ���ϴ�; � �ܺ η� ���4�; (å��) ���ǵǴ�; (������) ���忡
���4�; (������) �����; (���) ~�� �Ǵ�.
come out at ����� ��� ~�� �Ǵ�.
come out for ~�� ���ϴ�, ~�� ���� ���� ǥ���ϴ�.
come out of one's shell ���, ��=; ����.
come out with (f�� ��); �����, ~; ��ǥ�ϴ�.
ܿ‫��������� ؿ‬
come over �4� �‫�ؿ‬, (������) �dzʿ4�.
come up shot 1. �Կ� 2. (��ȭ ��;) �Կ��ϴ�.
come to �߽ ~�ϰ� �Ǵ�, �����ϴ�.
comt to an end ������.
aome to mind ��=�� ���8���.
come true (�� ����) ����Ǵ�.
come under (����, ��� ��); �߽�, ����Ͽ� �ִ�.
come up (�����) �����ϴ�; (��f ����) �Ͼ߽�� �, ߽ ߽��ϴ�; ����4�.
come up to �߽ �ñ߽ �� ���, ��������.
come up with (���, �� ��;) ���� ����, ��; ���ø���; (��fǰ ��;) ����ϴ�;
f���ϴ�; ~�� �Ѿư���, ��� ������ �ϴ�; ~; �����ϴ�, f���ϴ�.
come with ~�� ���� �ִ�, ~�� �μ�Ǵ�.
when it comes to ~�� ���‫���ؼ‬, ~����
comeback 1. ȸ��, �Ĺ�; ��ġ�ִ� �4�(�����) 2. �����ϴ�.
make a comeback ���ƿ4�, �Ĺ��ϴ�.
comedian ��� ���, �‫ڹ‬
‫�� ڹ‬
comedy ��� (��ȭ)
comet �‫�ؼ‬
comfort '��, �ȵ���
comfortable (���� ��'��) ������, ��� ��:; (�����) ��ͱ� ����; ��=����
make oneself comfortable ����� �ϴ�.
comic ��ȭ ����, �ִϸ����; ��� ���, �‫ڹ‬ ‫�� ڹ‬
coming �4�; ������, �巡��
have ~ coming ~; �߽� �����ϴ�, �䱸� ������� �.
coming-out ������������ ���; ����8�� �˸��� ��, Ŀ�‫־‬ƿ�
comity ����, ����
command 1. ����, ���; ���; Ŀ�ǵ� 2. ~; ���ϴ�, ����ϴ�; ~; f���ϴ�; ����ϴ�;
�����ϴ�; (x��, ��� ��;) ���߽�Ű�, ��8��.
commandant ��ɰ�
commander ��ɰ�, ���ְ�
Commander-in-Chief (�����) �ְ� ��ɰ�
commemorate ~; ����ϴ�; �����ϴ�; �߽��.
commemorative �����, ����� �Ǵ�, (~;) �����
commence ~; �����ϴ�, �����ϴ�.
commend A for B A�� B�� Ī���ϴ�.
comment 1. ����, �‫�ڸ‬Ʈ; �ּ�, � �2 ����‫ؼ‬. ~; �����ϴ�.
comment on ~�� ���� �ǰ�; ���ϴ�(�����ϴ�).
commerce ���, ���, ����
commercial 1. (�‫���ڷ‬o ����) ����, CM(=commercial message) 2. �������, ������;

(��������� ���뿡 � ���) �������, �ΰ���


commercialization ���ȭ, ��������ȭ
commercialize ~; ���ȭ�ϴ�, ��ǰȭ�ϴ�.
commercially (ȭ�� ��ǰ��) �Ǹſ�8��, ���ǿ�8��, ����8��; �����8��
commissar (�ҷ���) ���� ��f'��; (������� ������) �ι�'��
commissary ��a, �Ĵ�, ī���߽���
commission 1. '��; '����; (Ưd ���; ����) '��ȸ; (�븮 � ������) ���� 2.
�ֹ��ϴ�; ~; �Ƿ��ϴ�, 'Ź�ϴ�.
commission ~ to do ~�� ~�ϵ��� �Ƿ��ϴ�.
�; �䱸� ,� ��� ��d��
commissioner ��
commit (��, ��� ��;) ���ϴ�; ~���� '���ϴ�.
commit A to B A�� B�� ��Ž�Ű��.
commitment (����, �߽ ����) ��: ����, ����; ����, ��; ����, ���; '��, 'Ź; ����
committee '��; '��ȸ, ����ȸ
commode (�½�) �dz� ����; ����
commodity ��ǰ, ��ǰ; ��ȭ �ʼ�ǰ
common 1. ����, �� 2. ������, ����; ���� ����, ���� �ִ�
have A in common with B B�� ����8�� A�� ����.
common sense (1������) ���, ���
common-sense �������
commoner ���, ����, ����
commonly �Ϲ���8��
commonplace �����, ������
Commonwealth (���� ����) ��ü
communal �� ��ȸ��; ��8�� ����ϴ�
commune with (�‫�ڿ‬, �� ���) ��=; ���ϴ�.
communicate �����ϴ�, �ǻ 䱸 � ��
ϴ�.
communicate with ~�� ����ϴ�; �ǻ 䱸 � ������ϴ�.
communication ���; ���
communique ����, (�ܱ������ ) ��� ��ǥ
communism �������
communist 1. ���������; ����� 2. �������(��)��; �������
Communist Chinese ��� �߱���, ߱�� d����
Communist Party ����
community ��ü; �� ��ȸ; �� ��ü�� ����
commute 1. ��� 2. ~�� ���8�� �� �� �ִ�; ����ϴ�.
commuter 1. ����� 2. �������
commuter-train ���� ������; ��� ������
compactor ������ �����
companion ����, ģ��
companionship ��f, ģ��
company ȸ��
comparable �����; �����Ҹ���
comparatively ����, ߽ ߽
� �
compare ~; ���ϴ�, ���ִ�.
compare A to B A�� B�� ���ϴ�, A�� B�� ��/�ϴ�.
comparison ��, ��v
compassion (�‫��� )���� ��� �ٸ‬, ��: ��d
compassionate ��d���� ��:, ��d ��:
compatibility ��x�� ���ɼ�, ���ռ�
compatible vȭ�ϴ�; �䱸� ��� �ִ�
compel �����ϰ� ~��Ű��; ~; ������Ű��, ��~�ϰ� �ϴ�.
compel to do ~���� ��; �� ���.
compelling ��f����, �����ϱ� ���; Ī������ ��; �� ���, �ָ����� ��; �� ���
compensate for ~; �����ϴ�, �߽��.
compensate with ~8�� �����ϴ�, ����ϴ�.
compensation ����(��), ���(��)
compete �����ϴ�, �����.
compete with ~�� �����ϴ�, �ܷ��� .
competition ����; ���, ��ȸ, ������
competitive ������, �������; ������� ����
competitively ������8��, ���£ ���‫�ؼ‬
competitiveness ����
competitor ������, ���� ���
compile (�‫�� );�� �ڷ‬8��, �ϳ��� ~���ϴ�.
complacency (��� ����) �‫�� �ڱ‬w
complain �����ϴ�, �����.
complain about ~�� ���� ���� �Ҹ�; ����ϴ�, �Ҹ�; ���ϴ�.
complain of (���� ��); ȣ���ϴ�, ~�� ���� �����ϴ�.
complaint ����, �Ҹ�; �����, �����
complement ~; �����ϴ�; �Ŀ��ϴ�.
complete 1. ������ 2. ~; �����ϰ� �ϴ�; �Ϸ��ϴ�, ~; ������; ~; �����ϴ�.
complete with ~�� �Ϻ��, ~���� ����
completely ������, ö����
completion �ϼ�, �Ϸ�
complex 1. ����ü, ~�� ���, ����ü 2. ������, ����� ��Ų; ������, �ռ���
complexion �Ȼ�, ���
complicate ~; �����ϰ� �ϴ�, ��ư� �����.
complicated ������, ������
compliment 1. ����, ��� 2. ���Ǹ� ǥ�ϴ�, ������ ��; �ϴ�.
comply with ~�� ���.
component (��f ����) ����, ���� ���
compose ~; �����ϴ�, v���ϴ�; ~; �۰��ϴ�.
be composed of ~8�� ��
�����, �����Ǿ� �ִ�.
compose oneself (ǥd;) ���‫�������� );=��( ;��ٵ‬.
composer �۰߽ ; �۰�
composite �ռ� ����; �ռ���, ���չ�
compost ���, ��v ���
composure ��d, ��d
compound 1. (��'�κ��� ����) ��ü ��‫�ڼ‬, ��� �ְ�, ����; ȥ�չ�, ȭ�չ� 2. ��
���ϴ�, ȥ�ս�Ű��, ȥ���� ~; �����; ���ϴ�; (�뿩� ���'��) �������.
comprehend ~; �ľ��ϴ�, �����ϴ�.
comprehension ���‫�ط‬, �ľǷ�
comprehensive �����ϴ�, �������, ����'��
compress ~; �о� �ִ�.
compressed �����
comprise (v�� ����) ~8�� �������; ~; �����ϴ�.
compromise Ÿ��; Ÿ���
compulsive ���� ��信 �������; ��f����
compulsory �ǹ�����, �ʼ���
computer-generated ��ǻ�ͷ� �‫���ۼ‬
computer-literate ��ǻ�߽� � �� �ִ�, ��ǻ�� v���� ������
computer-savvy ��ǻ�Ϳ����� ����� dz
����, ��ǻ�� ����
comrade ����, ����, ģ��
con 1. (������) ����, Ⱦ�� 2. �ſ� ����� 3. ���� �, �����ϴ�.
con-artist ����
concede ~; ��d�ϴ�, �����ϴ�; �����ϴ�.
concentrate 1. ���߽, ���߽ 2. (����, ��� ��;) ~�� �����ϴ�.
concentrate on ~�� �����ϴ�, ����ϴ�.
concentrated ��������; �����
concentration camp ��f ����, dġ��(���) ����
concept ����, ���, ��; ����
concern 1. ���; ���� ���; ���; ���; ��ɻ�; ���; ���, �� 2. ~; ��d�ϴ�; ���
�� �ִ�.
be concernedd about doing ~�ϴ� �Ϳ������ �ִ�; ~; ��d�ϴ�, �����ϴ�.
be concerned with ~�� ����ϴ�; ~; ��f�� �ϴ�.
concerning ~�� ���Ͽ�, ~�� ���Ͽ�
concerted (�ൿ, ��ȹ ����) ��d�� ����, ���ǵ�
concertgoer =��ȸ�� �ܼ�� Ʈ �߽ ���� ���� ���
concerto ���ְ�, ��ü����
concession �纸
conciliator vd��; ������
conciliatory ȸ/����; 6ȭ����
conclude ���; ������, (��~��8��) �Ǵ��ϴ�.
conclusion �ḻ, ~��; ���, ����; ��d, ���
conclusive ��d����, ��ȣ��
concoct ���߽ �����; ��v�ϴ�.
concord (�ǰ� ����) ��ġ; (�䱸� ��� ) vȭ; ��ȭ, ��ȣ
concrete ��ü����, Ưd��; ��ũ��Ʈf��
condemn (���;) ���ϴ�, å���ϴ�.
be condemned to ~�ϵ��� ���������.
condemn A as B A�� B��� ���ϴ�(å���ϴ�).
condemnation ���� ��, �
condense ~; �����ϴ�; ����ϴ�.
condensed (����, �Ը� ��'��) �����; ��ҵ�
on the condition that ~���� v��8��
condo �浵��Ͼ�, �о� ����Ʈ
condolence �ֵ�, � ּ �
condom �ܵ��
condone (��, '�� ��;) �뼭�ϴ�, �� �ִ�.
conducive to ~�� ������ �� ����, ~�� �����ϴ�
conduct 1. �ൿ, ��', �µ� 2. (�� ��'��) ���ϴ�, ó���ϴ�, ���ϴ�, �߽�ϴ�
�, �
���ϴ�.
conduct oneself �ൿ�ϴ�, ó���ϴ�.
conduit (��, ���� ����) ����, ���
cone ����; �������� ��
confederate 1. �����, ����� 2. ������, ������
confederation ����, ����
‫ڰ‬
confer (ȣ��, �‫�ִ� );�� �ڰ‬, ���ϴ�.
conference ȸ��, ����ȸ; ȸ�ǽ�
confess ~; �о���, ����ϴ�; ~; (��Ƿ�) ��d�ϴ�.
confess to ~; �‫��ڹ‬ϴ�, �����ϴ�.
confession ���, ����
confidante �ŷ��ϴ� ���
confide ���; �о��� ����ϴ�.
confide to ~ that ~; �ϰ� ~��; �о���.
confidence �‫�ڽڽ‬, Ȯ��; �ſ�, �ŷ�; (������) ����
confidence in ~�� ���� �ŷ�(�ſ�)
confident Ȯ���Ͽ�; �‫ڽڽ‬Ű��� ��, �‫����� ;���� ;�ڽڽ‬
confidential ������; �����
confidently �‫�ְ��ڽڽ‬
confine ~; ��d�ϴ�, f���ϴ�.
confine A to B A�� B�� ��d�ϴ�(f���ϴ�).
confine oneself to ~�� ����ϴ�; ~�� Ʋ����� �ִ�.
confinement ���� (����)
confirm �߽�ħ�ϴ�, Ȯ���ϴ�.
confirmation Ȯd, Ȯ��; (d����) ����, Ȯ��
confiscate ~; ����ϴ�, �м��ϴ�.
conflict 1. �븳, ����, ����; (~����) ����, �ο�, �浹 2. �븳�ϴ�; �浹�ϴ�.
confluence �շ�; ����, ��ȸ
confront (�� �տ�) ������; ~�� ����ϴ�; ~�� ����ϴ�, �븳�ϴ�.
be confronted with (����� ���) ����ϴ�, ~�� ����ϴ�.
confrontation �븳, ���
Confucian /����; /������
confuse ȥ���Ű��, ȥ���ϴ�.
confused ȥ�����
confusing ȥ���Ű��, ȥ��; �ʷ��ϴ�
confusion ȥ�� ����, ȥ��; �ָ���, �Ҹ��; ��Ȥ, ��Ȥ; d�� ���, �ǽ� ���
congested ȥ����, ������
congestion dü, ����, ȥ��
conglomerate ��� ����ü
congratulate ~���� ������ ��; �ϴ�, ��䱸 �ϴ�.
congratulate A on B B�� �Ϸ� A���� ������ ��; �ϴ�(��䱸 �ϴ�).
congratulation 1. ���� 2. (�ູ�� ����) �����մϴ�.
congregate �����, �����ϴ�.
congregation ����, ȸ��; �ŵ���, �ŵ� ��ȸ
congress (��
���) ���� ��ȸ; (Ư�� �߳��� ��ȭ����) ��ȸ, ��ȸ
congressional ȸ����; ��ȸ��; ��ȸ��, ��ȸ��
congressman ��� ���� ��ȸ �ǿ�, (Ư��) �Ͽ� �ǿ�
congresswoman ���� ���� ��ȸ �ǿ�, (Ư��) �Ͽ� �ǿ�
conjecture 1. ����, ���� 2. ~; �����ϴ�, �����ϴ�.
conjunctivitis �ḷ��
conk out ���峪��, ���ߴ�.
connect �մ�, b���ϴ�.
connect A with B A�� B�� ����Ű��(�����ϴ�).
connection (ȸ�� ����) b��, ����; ����, ����
connoisseur (���ǰ, ���ǰ ����) ��d��, ���İ�
connotation ����� ��, ����
conquer (����, ���並) ����� ȹ���ϴ�, �ο� �����ϴ�.
conquest d��
conscience �����, ���; �к�
conscientious �������, ������
‫ڰ‬
conscious �ǽ��ϰ� �ִ�, �‫��ڰ‬ϰ� �ִ�
‫ڰ‬
be conscious of ~; �ǽ��ϰ� �ִ�, �‫��ڰ‬ϰ� �ִ�.
‫ڰ‬
consciously �ǽ��Ͽ�, �‫��ڰ‬Ͽ�
consciousness �ǽ�
consecutive ��������, ��ӵǴ�
consecutively ������8��, ��ӵǾ�
consensus ��‫� ��� ڰټ‬ǰ�; (�ǰ���) ��ġ
consent ����, �³�
consenting adult ���� ���� *Ư�� ������ ��'�� ������ �� �ִ� ����; ����Ų��.
consequence ���, �߽߽

conseuqently �� ����, ���
conservation (�‫�ڿ‬, ���� ����) ��ȣ, ��x
conservationist (����, õ���‫�� )���� �ڿ‬ȣ����, �‫�� �ڿ‬x �߽߽߽ ��
conservatism ��������
conservative 1. ������, �������� ��� 2. ��������; (Ư�� ����, ij������) �������
conservator (��õ, ����) ��'��, ������
consider ~; ����ϴ�, �����ϴ�; ~; (~���) ���ϴ�, �����ϴ�.
consider A B A�� B��� ���ϴ�(�����).
considerable �����, ������
considerably �����, ��
consideration (��d�� ����) ����‫�� ;���� �� �ؾ‬/, ���; ���
considered ���� ���� (����)
considering ~; ����ϸ�, ~; ���ϸ�
consignment shop 'Ź �Ǹ�a *���� �ʴ� ���ǵ�; �þ� �Ȱ� ���Ḧ �߽� a��
consist of ~�� ��
�����, �����Ǵ�.
consistency ��, �е�
consisteny (����, ���� ����) �����ϰ��; ��v�ִ�
be consistent with ~�� ��ġ�ϴ�, ������ �ʴ�, �䱸�ϴ�.
consolation '��, '��
console ~; '���ϴ�; ��; �ϵ����.
consolidate ~; ��ȭ�ϴ�, �߰��� �ϴ�.
consolidation vd �뤾� ;� ��ȭ, �ܴ������
consortium ��ȸ, v��, ��ü
conspicuous ���� �� ���, Ȯ���� �����
conspiracy =��, ���
conspire to do ~�� ��; ���ϴ�.
constant �Һ���, ���� �ʰ� ��ӵǴ�; d����8�� ��w�Ǵ�
constantly ���� ����, ���Ӿ���, �Һ��ϰ�; �����
constellation ���‫�ڸ‬, ������ 'ġ
constituency ���ű���; ���ű�
constituent 1. ������, ���ű� ���� 2. �����ϴ�, ���� �����
constitution v��, ��v, ����; ���, ������
constitutional ��������; ü����, ü����; ������, �����, ���� dġ��
constitutionalist �������; ȣ�����
constitutionally ����, �Թ���8��
constraint ��f; �ӹ�; (��� ����) ��f; (�µ� ����) �����
construct 1. ���߽, ��v�� 2. (���, ���� ��;) �����ϴ�, ���� ����; ¥ ���ߴ�.
construction ����, ���� ���
constructive �Ǽ�����, ��������; �‫�� ;���� ���ؼ‬d��
consulate �����
consult �����ϴ�, ����ϴ�, (�����) �ǰ�; ���; ~; ���� �ϴ�.
consultant �|���Ʈ, ��, ��㿪
consultation ���, ����
consume ~; �Һ��ϴ�; �����ϴ�; ~�� ��=�� (����, ��� ����) �����, ��������� ��
��.
consumer �Һ��ϴ� ���, �Һ��ϴ� ��, �Һ���
consummate ~; �Ϸ��ϴ�, �߽��ϴ�.
consumption �Һ�; �Һ�
contact (d�� ��'�� ��; �� �ִ�) �ƴ� ���, �θ�; b��
contact with ~���� b��
get in contact with ~�� b���ϴ�, ����; �ϴ�; ������.
contact lens ����Ʈ ����
contagious ����, ��������; �ű�� ����
contain ~; �����ϴ�, ~�� ��� �ִ�.
container ���, ����; (�Ϲ���‫������ )���ۿ‬ �
contaminant �?� ����
contaminate ~; �����, (���� �����) �?�����.
contamination �?�
contemplate doing ~�Ϸp� �ǵ��ϴ�.
contemplation �=�; ����, ���; ����
contemporary 1. �����, ���ô� ��� 2. �����
contempt ���, �ŵ�
contemptible ����� ����; ����; �ѽ���
contend �ο��, �����ϴ�; ~; ���ϰ� �����ϴ�.
contend with ~�� ��, �����.
contender (��� ��; ��) ������, ���� ���
content (��� ����) ����, ���빰
contention �ο�, ����, ����; ����, ����
contentious ���Ǹ� ��8Ű��, �� ��� �к���
contentment ��w, �ȵ�
contest ����
contestant ������, ���� ���, ���߽�Ʈ ����
context ���� ���, ����; ��Ȳ
continent ���, 0���
continental �����
contingent �İ ߴ�; �а ߴ�
continuation ���; ����; x��; ����
continuity ��b�� ���; ����(��); (��ȭ ����) �Կ��� �뺻, ��Ƽ
continuous ��������, �������
continuously ���Ӿ���, �����‫�ؼ‬
contraband �и�ǰ
contract 1. (�Ÿ�, �䱸 � ��� ) ���; ��༭; (��� ����) û�� 2. (��0;) �����Ű��; (��
�) �ɸ���.
contract on ~�� ���� �ϻ� �Ƿ�, ���� ��ȹ
Contract with America ������� ��� *��ȭ���� 1994�� �߰� ������ ��ǥ�� då
����, ��� ��v���� �谨 ���� ��ȭ�Ǿ� �ִ�.
contractor �����; û�ξ���
contractual ������, ���8�� �����
contradict ��ȣ�� �����ϴ�; �‫��ݹ‬ϴ�.
contradiction �‫ �ݴ‬,�‫��� ;�ݷ‬
contradiction in terms ��� ���, ���� �ܾ߽ � ����� ���� ǥ��
contradictory ����, d�‫���ݴ‬
contraption (�������) ���, �ž�; �߽��� �ȹ� , ������ ���
contrary �‫���ݴ‬, ����ġ ��:
contrary to ~�� d�‫���ݴ‬, ��v����
contrast 1. ��v, ���; (��v���� �4�) ������ ���� 2. ~; ��v�ϴ�, ����ϴ�.
in contrast ��v��8��
contribute (���� ��;) ����ϴ�; (��� ��;) f���ϴ�; �����ϴ�, �߽߽߽߽.
�ϴ�
contribute to ~�� ����ϴ�, �߽�ϴ�
�; ~ � ������ �Ǵ�.
contribution ����, �߽; ���, ����; ��α�; ��� ��ǰ
contributor �����; ������
control 1. ���, �� 2. ����ϴ�, ���ϴ�.
have no control over ~; f���� ���� ���.
out of control f���� �� ���, ��f�� �� ���
take control ����; ���.
take control of ~�� ����; ����ϴ�, ���ֱ�; ���, ��f�ϴ�.
controversial ���Ǹ� ��8Ű��, ���ǰ� �ǰ� �ִ�, �������
controversy ����, ����
controversy-free ����8�κ��� ��/�ο�, ������ ����� ���� �ʴ�
convalescent ȸ���� ȯ����; ������
convenience ���� ��; �ǽ����� ����
conveniently ���ϰ�, �˸°�
convention ��ȸ; ��ȸ; (��ȸ, ��ȸ ��ü ����) ��ǥ�� ȸ��, d�� ��ȸ; /�� �ǰ�; (��
f) ��d
conventional ~����, �������, ��������, ��������, �ν�����; (���Ⱑ) ���‫����� ;�ڷ‬
�� ��:; ���ȭ��
conventional wisdom �Ϲ� ����� ���� �ų�(���)
converge (�� a��) �����.
converge on ~�� �����, �����ϴ�.
conversation ��ȭ; ȸȭ; �米
converse ��ȭ�ϴ�, �ǰ�; ������.
conversion ��ȯ; ��ȯ; ��ȭ; ��~, ����
convert ~; ��ȯ��Ű��, ��v�ϴ�; ~; ~�� �‫� ;�ٲٴ‬Ų ‫� �ٷ‬ϴ�; ��~�ϴ�.
convert A to B A�� B�� ��v�ϴ�(�����ϴ�).
converted 1. ������ ���; ������ ���� 2. ������, ȸ����
convertible ��ȯ ������
convey ~; �ű��; ~; ����ϴ�, ǥ���ϴ�.
convey A to B A�� B�� �˸���(���ϴ�).
convict ~; /�˶�� �����ϴ�.
convicted /�˷� �����
conviction Ȯ��, �ų�
convince (~�ϴ� ���� ����� ���ϰ� ���‫� �ݰ�� )�ؼ‬ϴ�, �����Ű��, Ȯ�Ž�Ű��.
be convinced that ~��� Ȯ���ϴ�.
convincing ���; �����ų ����, ������� �ִ�
convoluted ������, ����
cook (~;) �䱸�ϴ�.
cook up ~; �� �‫� �����ڸ‬䱸�ϴ�(���‫)���س‬.
cool ������, ��d��; (�‫�ݾ‬, ����) ������ ���, ���������; �‫���ٻ‬, ��ſ�, �Ǹ���
cool down ~; ��d��Ű��, ~�� �Ӹ��� �����.
cool off �Ĵ�, ����ɴ�.
cool out ��d�� �ϴ�, ��d�ϴ�.
cooperate ����ϴ�, ���ϴ�.
cooperation ���, ��, f��
cooperative 1. �� v�� 2. �������, ��v����; ����
coordinate 1. �‫����ڵ‬Ʈ 2. ����ϰ� �Ǵ�, vȭ�Ǵ�.
coordinated 2�� ����� ���� vȭ�Ӱ� ������

coordination (�‫�ۿ‬, �����) vd
coordinator ���, vd��
cop ���, ���
cope (���) ��ó�ϴ�.
cope with ~�� �� ��ó�ϴ�, ~; ó���ϴ�, �‫��غ‬ϴ�.
Copenhagen �����ϰ� *����ũ�� ��
copper ��; ��fǰ
copulate �����ϴ�.
copy 1. ����; (����, ���� ����) ��, å 2. ~; �䱸� ���.
copycat 1. �䱸� ������, ����� 2. �����, �䱸� �3. ~; ����ϴ�, �䱸� �����.
cor(=gor) ������ *������ �ҽ� ��; ��Ÿ���� �Ҹ�
coral ��ȣ
coral pink ��ȣ��
cord ��, �‫�ڵ‬
cordon off ~�� ���; ġ��, ����; ����ϴ�.
core (��f ����) �߽��� �κ�, �‫�ٽ‬
corner 1. ���� 2. �‫�� �ٷ‬ó��; ������ 3. ~; ���� ���, ��Ƴִ�.
just around the corner �‫����� ;������� �ٷ‬ϰ�
corny �����, ��
�����
corollary �ʿ��� ���, �Ͱ�
coronary ��� ������
coroner �˽ð�
corporal 0ü��, ��ü��
corporate ������, ���� v����, ȸ����; ������
corporation ȸ��, ���, �ֽ�ȸ��, /��ȸ��
corps ����, ����; ��, ����
corpse ��ü, ��ü
correct �‫����ٷ‬, dd�ϴ�.
correlate A with B A�� B�� ��ȣ �����Ű��.
correlation ��ȣ ���, ��� ���
correspond with ~�� �����ϴ�, ����ϴ�.
correspondence course ��� ��0 ��d
correspondent �����; ��ſ�, ��ű���
corroborate (�ų� ��;) ưư�ϰ� �ϴ�; (���, �� ��;) Ȯ���ϴ�, �����ϴ�.
corrugate ���� ���8�� �ָ����.
corrupt 1. ��d��; ������, Ÿ���� 2. (���;) Ÿ���Ű��.
corruption '�� (��'); ��d, ����, Ÿ��
corset �‫���ڸ‬
cosmetic ȭ��ǰ; ��a; ���ߴ� ��
cosmetologist ��
��
cosmic õü��, ������
cosmopolitan 1.����������, ������ 2. �������, ��f����
cost 1. ��, ��� 2. (�‫�ִ� );�� ����( ;��� )���ݾ‬, /���ϴ�; ~���� (���� ��;) ����

�ϴ�; �Ҵ�, ����Ű��.


costly ����� ���� ���; ���‫�� �ذ‬:
costume jewelry (��ſ���) ��v ������
cot ���� ħ��; /�ƿ� ħ��
couch ����; (d�� �м�; �߽� ȯ����) ħ��
cough ��ħ; ��ħ �Ҹ�
council ��ȸ, ����ȸ, ���ǿ�; (��� ��ġf��) �ǿ�
councillor ���ǿ�
cuoncilman (�����ȸ) �ǿ�
counsel ���, ����; ��ȣ��, ��ȣ�δ�
counseling ī�߽��
�, �� , v��
�; ( �) ��ȣ��
counselor ī�߽��
count ~; �����ϴ�; ����ϴ�; ����� ��ġ�� �ִ�; �ϴ�, ��x�ϴ�.
count on ~�� �����ϴ�, ~; �ϴ�, ����ϴ�.
count out (��;) ���߽ ����.
counter 1. ~�� �‫ )~���( �ݴ‬.2 ��8���� �‫��ݴ‬ϴ�, �‫��ݷ‬ϴ�, �����ϴ�.
counter-myth ���� ��ȭ
counteract ~�� �‫��ݴ‬Ͽ� �ൿ�ϴ�; ~; �����ϴ�.
counterfeit 1. 'v��, ��vǰ 2. ��¥��, 'v�� 3. 'v�ϴ�, ��v�ϴ�.
counterfeiter 'v��, ��v��
countermeasure ��å, ���
counterpart ��� ���� ����� ��, ��: ������ ����; (�븳; ����) ����, ���9�; ���
�� ���, ��: ���忡 �ִ� ���
counterproductive ��ȿ����, ��������; �濡 �‫�ݴ‬Ǵ�
counterprogramming (�۱������
���� ‫�� ���ٸ‬: �ð����� �wα߽��� ����) ���� �w�
counterterrorism �߽� ��å; ���� �߽�
countless �� �� ��; d����, ������
country 1. ��; ����, ����; �ð� 2. �����; ��Ʈ�� ������
countryman ��: ���� ���, ����
countryside �ð�, ���
county (��
� ���� dġ, ��d���� �ִ� ��d ��ȹ) ī��Ƽ, ��
couple 1. �� ���� ���� 2. �� ����� 3. ��ν��� ���ϴ�.
courage ���, ��¯, �밨
courageous ��� �ִ�, �밨��
courageously �밨�ϰ�, ��⸦ ����
courier Ư��; ���� �Ͽ� ����ϴ� ��۱��
course (�Ļ���) ��ǰ, �� b��; the course ���, ����
in the course of ~�ϴ� ���ȿ�, ~�ϴ� �����
court ���Ǽ�, ��d, ����; ��d, �ձ�; (�‫״‬Ͻ� ����) ��Ʈ
courtesy ���ǰ� �‫�ٸ‬, d���� �µ�
courthouse ��� û��
courtier ��d���� ���� ��� ���, v��
courtroom ��d
courtship (������ ������ ����) ����, ��ȥ
couscous ���� *��; �Ǽ� ����, ��ä ��; ����� �Ͼ��x�ī �丮
cousin ����; ����, ��: ������ ��
cove ��, ����
covenant ���, ���; �ž� ����
cover 1. ����, Ŀ�� 2. ~; ����; ~; �‫��ٷ‬, ���ϴ�, ~; �����ϴ�, ~; ����ϴ�.
cover up ~; ��з� �ϴ�, ����.
cover with ~8�� ����.
cover story (���� ����) Ư�� ���; (�‫���ڷ‬o �wα߽���) Ư��
cover-up :��, :��
coverage ��', ��� ��', (���� ����) ���� ��'; ����, ���
covered ����� �ִ�
covered wagon (��ô�‫��� )����� ���ڵ‬䱸� �
covert :����, �����, �����
covet ~; ���ϴ�, �‫��ٶ‬.
cow Ȳ��; (�‫���ڳ‬, �� ����) ����
cozy ��ȭ��, ������
CPU(=central processing unit) (��ǻ����) �߽� ó� ��ġ
crack 1. �� ��: ��ī��; ��, �տ� 2. �������; Ÿ���ϴ�; ��=; ȥ���Ű��, ���� ��
������, ����.
crack a smile ��
����, ��߽� ���.
crack down ~���� ��ȣ�� ó��; ������; ~; ����ϰ� ��f�ϴ�.
crack up to be ~��� Ī���ϴ�, ~���� ������
�.
crackdown ź��, ��ȣ�� ��f(vġ)
cracked ����, ���, ���� ��
cradle 1. ��� 2. ~; ���� �߽��
�; ~; �� 8�� ��: ��ó�� ���.
craft ���, �ⱳ, ���; (�ճ��� ���; ���ϴ�) ���, ��; ��, ��: ����
craftsman ����
crafty ������, ��Ȱ��; �‫�ִ� �ؾ‬, ������
cram ä���, ~8�� ������ �ϴ�.
cram school ����
cramp ���, ��
cramped ��|:, �����
cramping ���, ��
crane �η��; ũ����, ���߱�
crap �‫���ٺ‬: �Ҹ�, �ͼ���
crash down ū �Ҹ��� ���� �μ����, �߽���
� ������ ; �‫��ر‬ϴ�, (��� ����) ���ϴ�.
crash course ���Խ� ����, �Ӽ� ����
crass �����, ���� ���
crater ����, ź��
crave ~; �䱸�ϴ�, �ʿ�� �ϴ�; ~; �����ϴ�.
craving ����, ����
crawl ���, ���ϴ�; �8��8� ����, �����ϴ�.
craze 1. ��/��, ���� 2. ~; ��ġ�� �ϴ�, ~; �߱��ϰ� �ϴ�.
be crazy about ~�� ������ �~��ϴ�, ~�� ǫ ��n �ִ�.
create ~; âv�ϴ�, ����ϴ�; ~; �ҷ���8Ű��, �߱��ϴ�.
creation âv, â��; âv��, ���� ��ǰ
creativity âv��, ��â��
creature ��, ����; ������ ����
credential (��� ����) ������; ���
credibility �ſ�, �ŷ ‫�� ;�ڼ‬Ǽ�; Ȯ�Ǽ�
credit 1. �ſ�, �ŷ�; Ī��; ��d 2. �����ϴ�.
credit A with B A���� B�� ������ �ִٰ� ���ϴ�, B�� ��a; A�� ���� �ִٰ� ��
��.
give A credit for B A�� B�� ��η� ġ��, A�� B���� ������; A���� B�� �ִٰ� ��d
�ϴ�.
credit account û����, �ܻ��
credit card �ſ� ī��
credit ration �ſ 뵵 � �*�ŷ� ����� ���ͷ�, ��f ���� ��; ����8�� ����ȴ�.
creed ��v, ����
creek ��: ��
creep ���, ���ϴ�.
creep along (���� ��� ����) �8��8� ����.
creep in ~�� �˸��� �ʰ� ����� ��� ����.
creep over ���ϴ�.
cremate (��ü��) ȭ���ϴ�.
cremation ȭ��
crematorium ȭ����, ������ �Ұ��� *������: crematoriums�� crematoria, �� ���� ��
��.
Creole ũ���� ���; ũ���þ�
crest ����, ����
crevice ������ ƴ
crew �¹���; (Ưd �Ͽ� ~���ϴ�) �ϴ�, v ��
crime ����, ���� �, ����
crime rate ���� �߽߽߽
��
criminal 1. ����, ���� 2. ������; ������
criminal offense ���� ����, ������ '�� ��'
criminality ���˼�, /��
cringe (�����) ������, '��Ǵ�.
cripple 1. ��ü ����� 2. �����ϰ� �����, ��ġ��; ~; ����� � �����, ����8�� ��
���.
crisis '��, �ߴ� ����
criteria (�Ǵ�, ߽ ߽
� �'��) ����, ô��
criterion (�Ǵ���) ����, ô�� *������: criteria �Ǵ� criterions
critic ������, Ȥ���ϴ� ���; ��а�
critical ������, �����; '����; �ߴ���, ��d����; ��������
be critical of ~�� � �ܼ Ҹ��� ���ϴ�
�, ��������
�.
critical mass �Ӱ� �� *���‫ڷ‬ο��� �Ͼ߽ ���� ����; ��ӽ�Ű�ų� �Ǵ� ������ź��
���; ��8Ű�µ� �䱸�Ǵ� �ʿ䷮
critically ������8��, ������8��
criticism ����, ��
criticize ~; �����ϴ�; ~; ���ϴ�, ����.
criticize A for B A�� B�� ��/�� �����ϴ�(���ϴ�).
critique 1. ����; ��� 2. (������8��) ~; �����ϴ�.
critter ��; ����, ����
Croat ũ�ξ�Ƽ�� ���
Croatian ũ�ξ�Ƽ�� (���)��
Crocodile �Ǿ� *�Ǿ� ��ũ�� �˷�n �ִ� �v��� ������ ���� fv��ü ��, ���‫�����ڽڽ‬
����.
crocodile tears ��� ����
crooked ��:, �����ִ�; ��Ծ���, d������ ����
crooner /�߽� ���: ��Ҹ��� �뷡�ϴ� �������� ����
crop �۹�, ��ȭ��
crop up (����� ��f��) ��Ÿ����, ����.
cross 1. ���2 ~�� ,���� ~�� ;�‫ڰ‬. �Ѵ�, �dzʴ�.
cross one's fingers (�հ���; �������) �ҿ��� �� ����� ���, �ֹ�; �ܴ�� .
cross one's mind (�� ����) ��=�� ���8���.
cross section Ⱦ�ܸ�� ; (��ü�� Ư¡ ��; ��Ÿ����) ��ǥ���� �ܸ��
‫ڰ‬ ‫ڰ‬
cross-burning ���‫* ��¿� �ڰ‬KKK���� ���ϴ� ���‫� ��¿� �ڰ‬ǽ�
cross-check (d�� ��;) ��~ �‫ڷ‬Ḧ ��v�Ͽ� dȮ��; v���ϴ�.
cross-country ���� Ⱦ���ϴ�
cross-cultural ��
�ȭ����
corss-dresser ��
��� ��; �Դ� ���
cross-sectional Ⱦ�ܸ����
crossbreed ~; �������.
crossroads �����, ���(��8��/��) ;�‫���� ڷ‬
crowd ����, ����, �‫�( ;���� ;��� ��� ڰټ‬0�, ��� ��; ��/�ϴ�) ����, ���
crowd around ~�� ��'�� ���� �.
crowds of �‫��� ڰټ‬, ��: �����
crowded ���8�� ������
Crown Prince (���� �����) Ȳ����
crucial ����� �߽���
�, �d ����
crude �‫����ڿ� �״‬, ������; ����, /ġ��, �� ���
cruelly ���ϰ�, ���ϰ�
cruise 1. ����, ��� 2. (���) �����ϴ�, /���ϴ�; (�ý� ����) �߽���, �����ϴ�,
���ƴ�
�ϴ�.
cruise around (���) ~; ���ƴ ‫ٴ‬ϴ�, �߽���.
cruise ship ������, /��
cruiser ������; ���߽�
crumble (��, �� ����) ��ʷ� �������.
crumble away ������, �ҽǵǴ�.
crumple �����; (�����;) �е��ϴ�.
crunchy �5��� �����, �‫� �ڹ��ڹ‬Ҹ��� ����
crusade (��ȸ�� ����) ���� �߽; ���‫�ڱ‬
crusader ���‫��� �ڱ‬
crush (�� ��'��) ����� �����.
crust (�� ����) ����� ����; (Ƣ�� ����) ��; ��
crutch ���; (�Ͻ������ ���� ��������) ���8�, �����ִ� ��
crux ���� �߽���
� a, � � ��f
cry 1. ����; ���¢�� �Ҹ� 2. �θ�¢��.
be a far cry from ~�� ��û�� ���� ����, ����� ���� � ����
�.
cryogenics �����
cryptic ������ �� ���, ����; ߽ ߽� �
crystallize (���, ��ȹ ��;) ��Ȯ�� ����
cub �߽���
� �, ��� ��
cub reporter ���߽��
� ���
Cuba ��� ��ȭ��(=Republic of Cuba)
Cuban ��� ���
Cuban-American ���� �����
cubic ��ü��; �Թ���, 3�����
cuddle ~; ���ȴ�.
cuddly ���Ȱ� ��:, �����
cue (�� ���� �������) ��ȣ, ť
cuisine (��� ȣ��, �� Ư/��) �丮; �䱸� �
culinary �ξ���; �䱸� �
culmination ����, �ϼ�; �ְ�v
culpability �㹰, /�˼�
culprit ����, ����
cult ����, ����; ~��, ����; ���, ��
�, ��Ʈ
cultivate (���;) ����ϴ�, ��ȭ�ϴ�.
cultural ��ȭ����, ��ȭ��
culturally ��ȭ��8��
culture ��ȭ
culture plate ��� b��, �����
cupid ����� ����; ť�ǵ�
curative ġ�� ȿ���� �ִ�, ��; ��ġ��
curator ����; (����� ��'��) ��� ���
curb 1. (�ε��� �� ������) ���� 2. ~; f���ϴ�, ��f�ϴ�.
cure 1. ġ/; ġ�� 2. (�� ��;) ġ/�ϴ�, ~; ȸ����Ű��, ���ϴ�.
curfew �߰� ���� ���� �ð�
curie �� *���� ��d ��'
curiosity ȣ���; ����� ��
curl (�Ӹ���) ��, ��Ӹ�
currency ��ȭ, /�� ȭ��
current 1. �Ϲ��� ����, �帧, dzv 2. ������, ������
currently ����, ���
curriculum vitae ���
¼ *������: curricula vitae���.
curse �����ϴ�, ����Ÿ��ϴ�.
cursory �Ǵ� �����; �ǻ�����
curtail ~; ����ϴ�, �谨�ϴ�.
curvaceous (������) �߽����
�, 0ü ���
custodian ����, ������
custody ��ȣ, ��; �İ�, ����; ��ȣ ������ �ǹ�; (������) ģ��
custom (��ȸ��) �0�, dz��; ����, ��
Customs Service �Ұ�
custom-build (�‫���� �ؼ��ֹ� ������ )���� ���ڵ‬, �ֹ�f��
custom-design ~; �ֹ� �����ϴ�.
custom-made �ֹ� f����
customary �0�����, �����
customize~; �ֹ��‫ �ؼ‬Ư���� �����.
cut ~; �‫���ڸ‬, ����ϴ�; ~; �߽��δ�, ġ���; �Կ�; �����ϴ�, ĿƮ�ϴ�.
be cut out for ~�� �����ϴ�, ��߽߽߽.��
cut ~ off from ~; ~�κ��� ������(����Ű��).
cut ~ out of ~; ~���� f���ϴ�.
cut across ~; �ʿ��ϴ�.
cut back (��� ��;) �谨�ϴ�, ����ϴ�.
cut back on ~; ���� �, �谨�ϴ�.
cut down on ~; ���� �, �谨�ϴ�.
cut off (������ ��� ��;) �����ϴ�; ~; ���߽�� �, �f �ϴ�.
cut out �߽߽߶ �, ���߽��
�; ��� ��.
cut red tape ������Ǹ� û���ϴ�.
cut through �����ϴ�; �‫��غ‬ϴ�; ����ϴ�.
cut to(�‫ �ٸ‬ȭf ��8��) �‫�ٲٴ‬.
cute �Ϳ��
� ; ������, �����; �ְ���, ����
cutlery Į����; ��Ź�� ������
cutthroat ������, ������; (���� ����) ���
cutting edge ��÷��, �ּ���
cutting room (�ʸ���) �����
cy berspace ���� �����
� *��ǻ�� ��Ʈ��ũ�� ���� ��� ����
cyberworld ���� ��� *��ǻ�� ��Ʈ��ũ�� ���ϴ� ����
Cyclops ŰŬ�ӽ� *��ĥ���ƿ� ��Ҵ� �ֲ‫���� ���ٴ‬
cylinder ����; �Ǹ���, ����
cynic ߽ ߽ � ����, ��d��� ���
cynical �ü�����, ߽߽�;����; �ǽ��ϴ�
cynicism �ü�, ߽߽� ��; �ôϽ���
cyst ��, �dz�
Czar ����, Ȳf, (fd �ô���) ���þ� Ȳf; ��f ����, ������, �Ƿ���
czarist ���þ� fd (Ȳf)��