Академический Документы
Профессиональный Документы
Культура Документы
WHO IS IT FOR? It is written for all students who need or wish to study chemistry
for its own sake or need it as the basis of another discipline (biology, medicine,
physics, engineering) at first year university level. It is of special importance for
those who have not had the opportunity to study chemistry over their formative years,
or who have not been fortunate enough to have experienced good teaching. However,
it is also useful to those who have successfully studied chemistry over several years at
school to reinforce their basic knowledge and understanding of its all important
language. It is also for teachers with limited background of chemistry but who are
called on to teach the subject. In teaching it is so important that basic terms and
definitions are precise and accurate.
HOW IS IT USED?
However, it is envisaged that this manual will be most commonly used to look up
definitions of words or concepts of concern. To do this find the word in the INDEX
and then go to the section indicated. There you will find the definition or explanation
you are seeking. But instead of finding just a definition, as in a normal alphabetical
glossary, you will see the definition or explanation in a broader context. By reading
material both before and after the entry your knowledge will be enhanced. It is this
aspect of this manual which makes it different from other publications.
At the end of each section there are a small number of EXERCISES on the most basic
topics. Answers to these are given immediately before the index.
In general students who have completed the most senior level of their school’s
chemistry curriculum should have covered most of the material in this manual.
Notable exceptions to this are likely to be quantum numbers of section 3,
spectroscopic analysis of section 12 and most of section 16 on rates of reaction and
reaction mechanisms. All these topics are met early in tertiary chemistry courses, and
the difficulties many students have with reaction mechanism appear to stem from a
lack of understanding of the language used to express the concepts. A knowledge of
elementary algebra is assumed, this being essential for quantitative work.
ACKNOWLEDGEMENTS
To the University of Auckland for providing one of its 1994 Teaching Improvement
Grant of $1000.
To many colleagues for reading, criticising, making suggestions and proof reading at
different stages of the development of this manual: Dr Robyn Dormer, Drs Paul and
Sheila Woodgate, Dr Graham Wright, Heather Wansbrough (first year student), all of
the University of Auckland; Gavin Peckham (University of Zululand, South Africa),
Dr Siow Heng Loke (University of Malaya), May Croucher (New Zealand Forest
Research Institute), Dr Bryce Williamson (University of Canterbury), and members of
the University of York Science Education Group. In particular to Marten J. ten Hoor
of the Netherlands, for his rigorous reading of and comments on the manual. Without
his criticisms and corrections a significant number of errors or inaccuracies would
have been present.
To SI Chemical Data by Gordon Aylward and Tristan Findlay, 3rd edition, Wiley,
Brisbane, from which the basic layout of the periodic table was taken.
To General Chemistry by P.W. Atkins and J.A. Beran, 2nd edition, Scientific
American Books, New York, for their excellent glossary from which many of the
definitions were taken.
CDROM - LET’S TALK CHEMISTRY
A CDrom - Let’s Talk Chemistry is also available. It contains this manual on the
basic language and vocabulary of chemistry that may be printed out in full or in
individual sections (chapters). As this manual is of necessity brief, this CD-ROM also
contains a very much more friendly and helpful tutorial type electronic form in
HTML, with fuller explanations, many figures and diagrams, and more examples and
exercises all with detailed answers. The price is $25 (Australian and NZ) + $7
postage and packaging. It may be ordered by mail sending an Australian or NZ
cheque to: A and B Scott, 62 Orchard Grove, Blackburn South, 3130 Vic., Australia.
SECTION 1
This section introduces terms and definitions which make up the vocabulary of the
language of chemistry. Starting with atoms it progresses to elements, molecules and
compounds. It shows how a substance can be simply represented by a chemical formula
made up of both letters and numbers. Many of the terms may be familiar to the layperson,
but not necessarily their precise definitions in the context of chemistry.
Chemistry: The study of matter, its composition and properties, and the changes it
undergoes.
To develop this topic we need to define the atom, the basic unit of common matter.
Atom: A neutral particle consisting of a nucleus containing most of its mass, and electrons
occupying most of its volume.
Nucleus: Consists of two types of subatomic particles; protons, each with an electric charge
of +1, and neutrons which have no charge.
Mass number: Symbol A, the sum of the number of protons and neutrons in the atom.
(Nucleon is a term for either a proton or neutron. Thus A is the number of nucleons in an
atom and the number of neutrons is A-Z.)
Element: A substance composed of atoms all of which have the same atomic number, i.e.
the same number of protons in the nucleus, and thus the same number of electrons.
The atomic number defines the element. Each element has a name (of varying historic
origin) and a shorthand symbol. The periodic table on the previous page lists the elements in
order of increasing atomic number. The atomic number is at the top of each entry, then the
full name and then the symbol. The symbol has one or two letters. The first letter is always in
capitals and the second in lower case. The origin of some symbols which may appear to bear
no relationship to the full name come from Latin, Greek or German [e.g. 26, iron, Fe].
Metallic element: Elemental substance which has a "metallic" lustre, conducts electricity
and heat well, and is malleable and ductile [e.g. copper]. All the elements to the left of the
bold line on the periodic table are metals.
Non-metallic element: Elemental substance which does not have metallic properties. [e.g.
nitrogen] All the elements to the right of the dashed line on the periodic table are non-
metals.
Metalloid or Semimetal: An element with the physical appearance and some of the
properties of a metal, but which has the chemical properties of a non-metal [e.g. arsenic].
1-2
These are the elements between the bold and dashed lines on the periodic table.
Isotopes: Atoms of the same element (same atomic number) but with different numbers of
neutrons and hence a different mass number [e.g. all atoms of carbon have six protons but
may have six (12C), seven (13C), or eight (14C) neutrons. 13C is an isotope of carbon.]. Some
isotopes are unstable and emit particles or radiation over a period of time and are called
radioactive.
Radioactivity: The spontaneous breakdown of one type of atomic nucleus into another.
Relative atomic mass: Symbol, Ar, the mean mass of an atom of an element allowing for the
relative abundance of its naturally occurring isotopes relative to (divided by) one twelfth of
the mass of one atom of the isotope 12C. (This topic is covered in section 8.) The value of Ar
is given as the fourth item in each entry of the preceding periodic table.
The chemical properties (behaviour) of the different elements can be understood in terms of
the number and arrangement of the electrons in their atoms. The arrangement of the elements
in the periodic table is based on this electronic structure. This topic is covered in section 3.
Molecule: A discrete neutral particle consisting of a definite number of atoms bonded (held)
together by chemical bonds. (Chemical bonds is the subject of section 4.)
Substance: A single, pure type of matter [e.g. water, sucrose (common sugar), sodium
chloride (common salt), argon (gas in many light bulbs)].
A pure substance may be elemental [e.g. oxygen, aluminium] or a compound [e.g. water,
sodium chloride].
A pure elemental substance may consist of individual atoms, [e.g. He, Ne, Ar]; molecules,
[e.g. nitrogen - N2, oxygen - O2, sulfur - S8, where the number of atoms in the molecule is
given by a subscript number following the symbol for the element]; or large aggregates of
atoms [e.g. all metals, carbon in the form of diamond or graphite].
Allotrope: Alternative form of an element differing in the way the atoms are linked [e.g.
carbon - diamond and graphite; oxygen - O2 (dioxygen) and O3 (ozone)]. Each form is an
allotrope.
Binary compound: A compound containing only two elements [e.g. hydrogen chloride,
HCl; water, H2O].
Ion: A charged particle. A cation is a positively charged particle, one containing fewer
electrons than protons; an anion is a negatively charged particle, one containing more
electrons than protons.
An ion may be (i) monatomic, i.e. just one atom, [e.g. sodium ion, Na+; magnesium ion,
1-3
Mg2+; chloride ion, Cl–; oxide ion, O2–]; (ii) polyatomic, i.e. a discrete number of atoms
jointed together, [e.g. sulfate, SO42–; nitrate, NO3–; ammonium, NH4+] or (iii) polymeric, i.e.
large aggregate of atoms joined together, [e.g. silicate (SiO32–)x]. The overall charge is given
as a superscript after the formula as shown.
Ionic compound: A compound consisting of ions. The total charge on the cations equals the
total charge on the anions, as substances are neutral. An ionic compound is an aggregate of
those ions. However the charge on the ions is not shown in its formula [e.g. sodium chloride,
NaCl, is made up of monatomic sodium ions, (Na+), and chloride ions, (Cl–); sodium sulfate,
Na2SO4, is made up of sodium ions, (Na+ ) and sulphate ions, (SO42–); ammonium sulfate,
(NH4)2SO4, is made up of ammonium ions, (NH4+), and sulfate ions, (SO42–); sodium silicate,
(Na2SiO3), is made up of Na+ cations and polymeric (SiO32–)x anions.].
Matter exists normally in three states - gas (g), liquid (l) or solid (s).
Phase change: The change which occurs when a substance changes from one state to
another, or undergoes a change in structure in the solid state. The common names for phase
changes are:
g → l condensation l → g evaporation
l → s freezing s → l melting or fusion
g → s deposition s → g sublimation
Crystalline solid: A solid in which there is an orderly array of its constituents (atoms,
molecules or ions). A crystalline solid may exist as a single crystal or as numerous crystals
[e.g. common salt, NaCl; common sugar, sucrose, C12H22O11; diamond].
Mixture: A type of matter consisting of more than one substance and which can be
separated into its components by making use of different physical properties of the
substances present. Mixtures may be homogeneous or heterogeneous.
Homogeneous mixture: A mixture in which any two samples have the same composition
and properties [e.g. air (a gas); seawater (a liquid)].
Heterogeneous mixture: A mixture containing entities of sufficient size such that all
samples are not identical [e.g. concrete; smoke].
Solution: A homogeneous mixture (usually with one component in larger amount); normally
a liquid [e.g. seawater; hydrochloric acid ], but the term may be also apply to a solid, but not
to a gas.
Solvent: The component of a solution in largest amount [e.g. the water of seawater].
Solute: The components of a solution in lesser amounts [e.g. the salts in seawater].
Colloid: A mixture consisting of a finely divided phase (the dispersed phase) distributed
1-4
uniformally in a continuous phase (the dispersion medium). Aerosols, liquid in gas [e.g.
mist, fog] or solid in gas [e.g. smoke]. Emulsions, liquid in liquid [e.g. cream, fat in water,
and butter, water in fat]. Sol or colloidal suspension, solid in liquid; slurry or paste when
concentrated. Foam, gas in liquid or gas in solid. Gel, a polymeric dispersed phase in a
liquid. The dispersed phase has a huge surface area which gives colloids their distinctive
properties. Colloids are heterogeneous mixtures.
Chemical formulae: Part of the language used by chemists to represent substances and
compounds [e.g. H2O is the formula for water].
Molecular formula: The formula for a discrete molecule. It gives the symbol of each
different element and the number of atoms of that element as a subscript immediately after
the symbol for the element [e.g. ammonia, NH3; nitrogen, N2; glucose,C6H12O6; sulfuric
acid, H2SO4]. There are now rules for the order in which the elements are listed based on
chemical language which has evolved over time. However the order is best learned with
experience (i.e. seeing it written). However, for indexes (listings) of organic compounds the
order is C H O and then the remaining elements listed alphabetically. The formula may
represent one discrete molecule of the substance or a macroscopic amount of it. Which is
meant must be deduced from the context in which the formula is used.
Empirical formula: The formula for a substance giving the simplest ratio of the atoms [e.g.
glucose, CH2O].
Compounds which consist of large aggregates of atoms joined together are usually
represented by their empirical formula [e.g. silica is normally represented by just SiO2 not
(SiO2)x]. Elements which consist of aggregates of atoms bound together are represented
simply by the symbol for the element [e.g. aluminium metal, Al]. Ionic compounds are
represented by the formula for their cations and anions in their simplest whole number ratio,
without showing the charge on either the cations or anions [e.g. NaCl represents sodium
chloride which consists of Na+ and Cl– ions in a 1:1 ratio; Ca3(PO4)2 represents calcium
phosphate which consists of Ca2+ and PO43– ions in a ratio of 3:2; Na2SiO3 represents a
sodium silicate which consists of discrete Na+ ions and polymeric anions (SiO32–)x]. Note the
use of brackets around polyatomic ions when a subscript is needed.
Valence: The number of bonds an atom of a particular element can form in a molecule. [e.g.
In water, H2O, one oxygen atom forms bonds to two hydrogen atoms, and each hydrogen
atom forms one bond to an oxygen atom. The hydrogen atoms are not bonded to each other.
The valency of O is two and of H is one. In silica, SiO2, each Si atom is bound to four O
atoms and each O atom to two Si atoms. The valency of Si is 4 and of O is 2.] In simple ionic
compounds containing monoatomic cations and anions the valency is simply the charge on
1-5
the ions. [e.g. In NaCl made up of Na+ and Cl– the valency of both Na and Cl is one.]
Polymer: A substance having large molecules consisting of repeated units (the monomers).
Polymers do not have a definite formula as they consist of molecules of different chain
length.
[e.g. polyethylene, H-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH2- or H-(CH2-CH2)x-H where x
is a large number and the monomer is ethylene, C2H4; the polymeric silicates above.]
Free-radical: An atomic, molecular, or ionic particle with an unpaired valence electron [e.g.
chlorine atom, Cl· ]. Usually chemically reactive. See sections 3 - 4.
To understand why pure substances have particular compositions and properties we need to
know about the "electronic structure" of the atoms (i.e. the way the electrons are arranged
about the nucleus of the different elements). Then we can rationalise the ratio in which
atoms combine and whether they are molecular, polymeric or ionic, [e.g. why gaseous
nitrogen consists of discrete N2 molecules; methane, ammonia, water and hydrogen fluoride
consist of discrete molecules of CH4, NH3, H2O, HF respectively (H4C, H3N, OH2, FH are in
principle equally valid formulae, but not normally used); why sodium chloride consists of
Na+ and Cl– ions; why metals exist in nature mainly as cations, Mx+; why free-radicals are
reactive]. The topic of electronic structure is covered in section 3.
Inorganic chemistry: The chemistry of compounds other than carbon, but includes CO, CO2
and carbonates.
EXERCISES
From the periodic table give the name and symbol of the element, and the number of neutrons
for the isotope, given the atomic number and the mass number.
1. Example: Z = 8 A = 16
Answer: oxygen, O, A-Z = 8
2. Z = 19 A = 39 3. 3. Z = 29 A = 65 4. Z = 86 A = 222
Write the formula of the following compounds from the given compositions:
7. Acetic acid, molecular, two carbons, four hydrogens and two oxygens
8. Glycine, molecular, two carbons, five hydrogens, two oxygens and one nitrogen
1-6
9. Cystine, molecular, two nitrogens, two sulfurs, twelve hydrogens, four oxygens and
six carbons
SECTION 2
This section introduces the language of chemical equations, the method of representing the
changes which occur in a chemical reaction in which substances are consumed and new ones
formed.
Chemical bonds: The forces holding atoms together in matter. (see section 4)
Balanced chemical equation: A chemical equation in which the numbers of atoms of each
element is the same on both sides
[e.g. 2H2 + O2 → 2H2O].
Stoichiometric coefficient: The number immediately in front of the formula of the chemical
substances in the balanced equation. The coefficients may be interpreted as the relative
number of particles of reactants and products [e.g. For the above equation two molecules of
dihydrogen react with one molecule of dioxygen to form two molecules of water].
NH3 + O2 → NO + H2O
Hint 1 1NH3 + O2 → 1NO + H2O
Hint 2 Leave O until last
Hint 3 This is H. Balance H by writing 3/2 in front of H2O. 3H on left, therefore (3/2) x 2
on right 1NH3 + O2 → NO + 3/2H2O
Now O 1NH3 + 5/4O2 → 1NO + 3/2H2O
One cannot have ½ or ¼ molecules. Multiply all coefficents by 4 to have only whole
numbers
4NH3 + 5O2 → 4NO + 6H2O
The combustion of ethane: The products are carbon dioxide and water. Write the formulae
for reactants and products, C2H6 + O2 → CO2 + H2O
Hint 1 Not applicable.
Hint 2 Leave O until last
Hint 3 Could balance C or H next. Balance carbon, C, by writing 2 in front of CO2.
C2H6 + O2 → 2CO2 + H2O
(2 C on both sides; 2 atoms in one molecule of ethane, C2H6, and one atom in each of 2
molecules of carbon dioxide, CO2.) Now balance H. There are 6 H atoms on the left, so write
3 in front of H2O.
C2H6 + O2 → 2CO2 + 3H2O
(6 H atoms in ethane and 2 H atoms in each of 3 water molecules.) Balance O. There are 2 O
atoms on left and 7 O atoms on right. Write 7/2 in front of O2.
C2H6 + 7/2O2 → 2CO2 + 3H2O
This would be interpreted as one molecule of ethane reacting with 3½ molecules of dioxygen
to give 2 molecules of CO2 and 3 molecules of water. But one cannot have half a molecule.
This problem is overcome by multiplying all coefficients by two.
2C2H6 + 7O2 → 4CO2 + 6H2O
2 molecules of ethane react with 7 molecules of dioxygen to form 4 molecules of carbon
dioxide and 6 molecules of water.
Nett ionic equation: A chemical equation for a reaction occurring in aqueous solution
between ionic compounds, but showing only the reacting ions. [e.g. When solutions of silver
nitrate, AgNO3, and sodium chloride, NaCl, are mixed a precipitate of silver chloride forms:
Ag+(aq) + Cl–(aq) → AgCl(s)
The Na+ and NO3– ions present in solution are not shown because they are not reacting. Such
ions are sometimes called spectator ions. The (aq) and (s) in the equation stand for aqueous
and solid respectively and make the equation more meaningful. ]
Nuclear equation: An equation for a nuclear change or reaction. [e.g. the production and
decay of cobalt-60:
2-3
59
27Co + 01 n → 27 60
Co → 60 28 Ni + −1 e + γ-photon
0
Normal cobalt, 59Co, absorbs a neutron (n) in a nuclear reactor to give 60Co which decays
with elimination of an electron from the nucleus to give 60Ni with excess energy and this is
lost as a gamma-photon.] Note that the mass numbers (superscripts) balance and the atomic
numbers or charge (subscripts) balance.
EXERCISES
1. Example: N2 + H2 → NH3
ammonia
Balance N by writing 2 in front of NH3
N2 + H2 → 2NH3
Balance H by writing 3 in front of H2
N2 + 3H2 → 2NH3
5. Fe3O4 + C → Fe + CO 6. NO + O2 → NO2
Write nett ionic equations for the following reactions on mixing aqueous solutions of the
following soluble ionic compounds (salts).
11. Solutions of thallium nitrate, TlNO3 and potassium fluoride, KF, to give a precipitate
of thallium fluoride.
12. Solutions of copper sulfate, CuSO4, and sodium carbonate, Na2CO3, to give a
precipitate of copper carbonate.
13. Solutions of calcium nitrate, Ca(NO3)2, and sodium phosphate, Na3PO4, to give a
precipitate of calcium phosphate.
14. Solutions of magnesium sulfate, MgSO4, and barium hydroxide, Ba(OH)2, to give a
precipitates of barium sulfate and magnesium hydroxide.
3-1
SECTION 3
To understand why pure substances have particular compositions and properties we need
to know about the "electronic structure" of the atoms (i.e. the way the electrons are
arranged about the nucleus of the atoms of different elements). Then we can rationalise
the ratio in which atoms combine and whether they are molecular, polymeric or ionic, [e.g.
why gaseous nitrogen consists of discrete N2 molecules; methane, ammonia, water and
hydrogen fluoride consist of discrete molecules of CH4, NH3, H2O, HF respectively; why
sodium chloride consists of Na+ and Cl– ions; why metals exist in nature mainly as cations,
Mx+; why free-radicals are reactive.
Early last century a model of the atom (Bohr model) in which electrons circulated around
the nucleus in orbits, just as planets do around the sun, was developed. This model proved
inadequate to explain many phenomena and was replaced in the 1920's, when it was
postulated that the behaviour of electrons in atoms could be described by mathematical
equations similar to those used to describe the motion of standing waves in a string. From
this model the electrons can be visualised as electron clouds of various shapes with the
nucleus of the atom at their centre.
Electronic structure of atoms: The arrangement of electrons around the nucleus of the
atom.
The properties of atoms can be understood in terms of Quantum Theory, which involves the
Heisenberg Uncertainty Principle and the Schrödinger Wave Equation.
Quantum Theory: A theory that states that the energy of an object can only change by
discrete steps. A change involves a packet of energy called a quantum.
Heisenberg Uncertainty Principle: The position and momentum of a particle cannot both
be known simultaneously. This implies that in an atom the position and momentum of an
electron cannot both be known simultaneously. (Thus a model of an atom containing
electrons in fixed orbits around the nucleus is untenable.)
Atomic orbital: A mathematical expression from the Schrödinger Wave Equation from
which, for each energy level, the probability of finding the electron at different positions
from the nucleus can be calculated. The atomic orbital can be depicted as an "electron-
cloud" with the nucleus at the centre, the denser the cloud the greater the probability of the
electron being there. Only two electrons can occupy the same orbital.
Quantum numbers: Numbers which label the orbital and spin of an electron.
Electron pair: Two electrons in the same orbital. They must have opposite spins.
3-2
Spin of an electron: The intrinsic angular momentum of an electron. Occurs in only two
senses denoted ↑ and ↓.
Electron shells: The electrons in an atom exist in shells, each shell being made up of atomic
orbitals or subshells.
Principal quantum number: Symbol n, an integer, 1,2 3... which defines the shell. The
smaller n is, the lower the energy of the electron (more energy required to remove the
electron from the atom), and the closer on average it is to the nucleus. First character in
designation of an orbital.
Azimuthal quantum number: Symbol l, defines the subshell or kind of orbital, and can
have the values 0,1,...,n-1. An orbital with l = 0 is called an s orbital; with l = 1 is called a p
orbital; with l = 2 is called a d orbital; with l = 3 is called an f orbital. Second character in
designation of an orbital.
Magnetic quantum number: Symbol m1, specifies the particular orbital of a subshell and
can have values -l, -l+1,...0,...,l-1,l.
Spin quantum number: Symbol ms, specifies the spin of an electron and can have values of
+½ (↑) or -½ (↓).
Occupancy of shells: The first shell, n = 1, can hold 2 electrons in one orbital, labelled 1s.
(l = 0 for an s orbital)
The second shell, n = 2, can hold 8 electrons in four orbitals, one labelled 2s and three
labelled 2p. (l = 1 for a p orbital).
The third shell can hold 18 electrons in nine orbitals, one 3s, three 3p and five 3d. (l = 2 for a
d orbital)
The fourth shell, n = 4, can hold 32 electrons in 16 orbitals, one 4s, three 4p, five 4d and
seven 4f. (l = 3 for an f orbital)
Within a shell the energy levels of the orbitals (subshells) is s < p < d < f.
The bottom line in each entry of the preceding periodic table gives the number of electrons in
the shells in the ground state of that element [e.g. potassium, K, 2.8.8.1, has 2 in the first
shell, 8 in the second, 8 in the third and one in the fourth.].
Ground state: The state of an atom when all the electrons are in the lowest allowed energy
levels.
Electron configuration: A statement of the arrangement of electrons in the orbitals [e.g. Cl,
1s22s2p63s2p5]. Each principal quantum number is shown only once and the number of
electrons in each subshell is shown as a superscript following the symbol for the orbital.
The ground state electron configuration of any element can be written down by filling the
orbitals in order using the energy levels:
1s < 2s < 2p < 3s < 3p < 4s < 3d < 4p < 5s < 4d < 5p < 6s < 4f < 5d < 6p < 7s < 5f
[e.g. cobalt, Co, Z = 27, thus 27 electrons. 1s22s2p63s2p64s23d7. This may be written as
1s22s2p63s2p6d74s2.]
3-3
Valence electrons: Those electrons in the outermost shell and in unfilled subshells [e.g. Cl
has 7 valence electrons (3s2p5) and Co has 9 valence electrons (3d74s2)]. Valence electrons
are involved in chemical bonds - section 4.
The Periodic Table: A table showing the elements in rows and columns in a manner which
shows up relationships between the properties of the elements.
Periods: Rows of the periodic table. Elements in the same row are in the same period [e.g.
calcium, Ca, and copper, Cu, are both in the 4th period]. The number of the period (row) is
equal to the principal quantum number of the outermost valence shell of the atoms.
Groups: Columns of the periodic table. Elements in the same column are in the same group
and have the same number of valence electrons (which accounts for their similarities) [e.g.
carbon, C, and tin, Sn, are both in group 14 and both have four valence electrons]. This
numbering replaces a previous system, shown as Roman numbers on the table, still used by
some older chemists.
Blocks: Groups having the same valence orbitals. Groups 1-2 are s-block because their
elements have only s valence electrons; groups 3-12 are d-block because their elements have
only s and d valence electrons; groups 13-18 are p-block because their elements have s and p
valence electrons.
Halide: A binary compound of a halogen and another element [e.g. HCl, CaCl2, PCl3],
or with a group [e.g. CH3Cl, chloromethane but also called methyl chloride; see section 6-2].
Ionisation energy: The first ionisation energy is the minimum energy required to remove an
electron from a neutral atom in the gas phase:
E(g) → E+(g) + e–(g)
The second ionisation energy is the minimum energy to remove an electron from this gaseous
ion:
E+(g) → E2+(g) + e– (g)
Similarly for successive ionisation energies (I.E.). The variation of I.E with position in the
periodic table is important in understanding the chemical properties of the elements. In
general the ionisation energy increases from left to right in a period as the number of protons
in the nucleus is increasing and therefore the attractive force between it and the electron is
increasing. The first I.E. of the first element of a period is much lower than that of the last
element in the previous period as the electron lost is from a shell of higher principal quantum
number and hence energy.
Excited state: The state of an atom when an electron is in an orbital of energy greater than
that in the ground state. When an electron changes energy level (orbital) a quantum of energy
is emitted or absorbed as a photon.
3-4
EXERCISES
Write the electron configuration of the ground states of the following elements:
1. Example: selenium, Se
Answer: From the periodic table Z = 34; there are 34 electrons to be placed in
the orbital energy series.
1s22s2p63s2p64s23d104p4
2, 10, 18, 20, 30, 34 accumulative number of electrons
or 1s22s2p63s2p6d104s2p4
7-12. Give a possible value for the principal quantum number and for the azimuthal quantum
number for a valence electron of the elements in questions 1-6 above.
7. Example: selenium, Se
Answer: For Se the valence electrons are 4s and 4p.
For 4s n = 4, l = 0
For 4p n = 4, l = 1
Give the orbital of an electron with each of the following quantum numbers:
13. Example: n = 3, l = 2
Answer: 3d
In which period, group and block of the periodic table are the following elements?
22. The second ionisation energy of sodium is much greater than that of magnesium.
Explain in terms of their electron configurations. (Hint: write down the electron
configurations and see which electrons are being lost.)
4-1
SECTION 4
CHEMICAL BONDS
In most matter atoms exist close together in aggregates. The inner electrons are held tightly
by the nucleus, (i.e. they have very high ionisation energies), but the valence electrons can
be attracted to the nuclei of two or more atoms simultaneously. It is this electrostatic
attraction of the valence electrons to two or more nuclei that provides the forces which hold
atoms together and is the basis of the chemical bond. This section defines different classes
of bonds and the language of depicting them on paper.
In most matter atoms exist close together in aggregates. The inner electrons are held tightly
by the nucleus, (i.e. they have very high ionisation energies), but the valence electrons can be
attracted to the nuclei of two or more atoms simultaneously. It is this electrostatic attraction
of the valence electrons to two or more nuclei that provides the forces which hold atoms
together and is the basis of the chemical bond.
Covalent bond: A pair of electrons shared between two atoms (nuclei) in a molecule or
polyatomic ion.
Single bond: One pair of shared bonding electrons; represented by a line [e.g. H-H in H2].
Double bond: Two pairs of shared bonding electrons; represented by a double line [e.g.
O=C=O in CO2].
Triple bond: Three pairs of shared bonding electrons; represented by a triple line [e.g. N≡N
in N2].
The chemical behaviour of different elements can be understood by considering the number
and arrangement of valence electrons in their atoms.
With the exception of metals, almost all atoms in stable substances have 2 (H, He), 8, 18, or
an even number between 8 or 18 electrons in their outermost shell. (High temperatures and
low pressures change this.) An octet (8) of electrons in the third shell (which can
accommodate 18) is common.
Now we can understand the formulae and properties of some simple compounds that we have
met in previous sections.
Methane, CH4. The carbon nucleus (atom) is surrounded by four hydrogen nuclei. Number of
valence electrons = 4(C) + 4 x 1(H) = 8. These 8 are in four pairs around C and each H has
H
H C H
H
one pair. We represent methane by the Lewis structure
4-2
Lewis structure: A chemical formula (diagram) which shows the arrangement of the atoms
and valence electrons in the species.
Water, H2O. The oxygen nucleus has two H nuclei attached. Again there are 8 valence
electrons, 6(O) + 2 x 1 (H). Lewis structure:
O O
H H H H
The two pairs of dots represent the two non-bonding electron pairs in the valence shell of
the O atom. However, these are not always shown as their existence can be inferred. The
inner shell electrons which we can consider belonging exclusively to the one nucleus are
never shown in Lewis structures.
Dinitrogen, N2. 10 valence electron, 2 x 5 (N). The Lewis structure: :N≡N: Each N nucleus is
surrounded by 8 valence electrons, 3 pairs of electrons being attracted simultaneously to two N
nuclei. Dinitrogen contains a triple bond .
Carbon dioxide, CO2, and silicon dioxide, SiO2. In CO2 and an SiO2 unit there are 16
valence electrons 4 (C) or (Si) + 2 x 6 (O). Carbon dioxide exists as discrete CO2 molecules.
We can rationalise this by the Lewis structure O=C=O where each atom has 8 valence
electrons and the molecule has two double bonds. Silicon dioxide (quartz) is a solid. We can
rationalise this by writing the Lewis structure for a small part of the compound:
Si Si Si O
O O O
O Si O Si O Si O
O O O
Si Si Si
Again each atom is surrounded (tetrahedrally) by 8 valence electrons, each Si with 4 bonding
pairs, and each O with two single bonds and two non-bonding electron pairs.
CO2 and SiO2 have different structures. The explanation for this is beyond the scope of this
document. The existence of discrete molecules of CO2 implies the energy of CO2 in this
form is lower than that of a polymeric structure.
Sodium chloride, NaCl, is an ionic solid composed of Na+ ions surrounded by Cl– ions and
vice-versa. Each Na+ and Cl– ion has eight electrons in its outermost shell. (The valence
electrons are all located on the Cl– ion.) Ionic bonds hold the structure together.
Ionic bonds: The electrostatic attraction between cations and anions. The bonding electrons
are localised on the anions.
4-3
Calcium phosphate, Ca3(PO4)2 consists of Ca2+ cations surrounded by PO43– anions and vice-
versa and is therefore also an ionic compound, the cations and anions being held together by
electrostatic attraction. However the bonds holding the P and O nuclei together in the
phosphate anion are covalent. The same is true of the bonds in a sulfate anion or a carbonate
anion, etc.
Metallic bonds: The bonds holding atoms of a metal together. The simplest picture is that of
cations in a sea of valence electrons spread out or "delocalised" over the whole structure.
Polar bond: A covalent bond in which the bonding electrons are not evenly shared, the
electrons being attracted more to the more electronegative atom [e.g. H-Cl, which has a
polar bond with H partially positive and Cl partially negative].
Electronegativity: A measure of the ability of an atom to attract electrons to itself in a
compound. The order of electronegativity is:
F > O > Cl > N > Br > I > S > C > H > P > B > Si
Polar molecule: A molecule with a positive side and a negative side [e.g. H-Cl, (δ+)H-Cl(δ-
) where δ means slightly; H2O with O slightly negative and the H's slightly positive].
Bond length: The average distance between the nuclei of the two atoms bonded together.
(Average because the nuclei are vibrating).
Bond strength: The energy needed to break a chemical bond with the bonding electrons
being equally divided between the two fragments. (see section 11)
Intramolecular bonds: Bonds between atoms in a molecule. [e.g. H-O bonds of water]
Hydrogen bond: A weak bond between fluorine, oxygen or nitrogen in one molecule or ion
and a hydrogen atom bonded to a fluorine, oxygen or nitrogen atom in another molecule or
ion or in the same molecule. Properties of water and the structure of many biological
substances [e.g .proteins and DNA] are explained in terms of hydrogen bonds.
Van der Waals bonds (forces): The intermolecular forces which hold molecules together in
liquids and solids. In vaporisation and sublimation these bonds are broken, and in
condensation and deposition they are made.
4-4
EXERCISES
1. Example: C-Cl
State whether the following molecules are polar and if so show the polarity:
9. Carbon dioxide, CO2, a linear molecule 10. Sulfur dioxide, SO2, a bent molecule
12. Methane, CH4, the carbon atom is tetrahedrally surrounded by the 4 hydrogens
5-1
SECTION 5
STRUCTURAL FORMULAE
Structural formulae of molecules and ions give more information than simple chemical
formulae. Lewis structures show which atoms are bonded to which using the letter symbols
for the atoms, and the arrangement of the valence electrons forming the bonds. A line
represents a two-electron bond. Lewis structures are like words of chemical language and are
found in all chemical literature. It is essential that you can write Lewis structures for
molecules and ions assuming knowledge of which atoms are bonded to which. This section
gives simple rules which allow you to do this. It also introduces you to the concept of the
shape of molecules.
Structural formula: A chemical formula which shows the groupings of atoms in a compound.
Lewis structures (defined in section 4) of discrete molecules and ions are an essential part of
the chemical language. They are used to show details of structure and of chemical reactions.
The ability to write Lewis structures for basic molecules and ions is an essential skill for
chemists. The following rules require knowledge only of the number of valence electrons of
an atom of each element, and the arrangement of the nuclei, i.e. which atoms are joined or
bonded together.
(a) Determine the total number of valence electrons in the molecule or ion by adding
together the numbers of valence electrons of each atom, and if an anion, by adding the
overall charge of the ion, and if a cation, by subtracting the overall charge of the ion.
(c) Draw a line representing a single bond containing two electrons between joined
atoms.
(d) Distribute the remaining electrons evenly in pairs on the outer atoms so these have up
to eight electrons (except for hydrogen which has two). Any still not used after this
should be placed on the central atom.
(e) If the central atom is now surrounded by fewer than eight electrons, move sufficient
non-bonding pairs from outer atoms other than halogens to between joined atoms,
thus making them bonding, to bring the number on the central atom up to a maximum
of eight.
(f) Count the number of electrons "owned" by each atom assuming bonding electrons are
shared evenly. To evaluate the formal charge at that atom compare the result with
the number of valence electrons of the neutral atom. Show only non-zero charges.
(g) For central atoms from the third row or later rows of the periodic table, move further
non-bonding pairs to bonding positions to lower the positive formal charge on the
central atom to one or zero.
5-2
Formal Charge: The electric charge of an atom in a molecule or ion assuming perfect covalent
bonding. [e.g. in NH4+, N "owns" four electrons and has the formal charge +1 as an N atom has
five valence electrons.]
Examples:
D, e O O N O O S O
O C
O
f
O
O N O O S O
O C
O structure 1
g
O S O
6e-
O S O
6e-
O S O
structure 2
In the case of CO32– and NO2 above each C-O and both N-O bonds are identical although a
single Lewis structure might suggest otherwise. The problem can be overcome by writing the
three possible Lewis structures for CO32–, or the two possible Lewis structures for NO2 and
drawing a double headed arrow, ↔, between them. Each individual Lewis structure for a
5-3
molecule or ion is called a resonance structure, and the true structure of the molecule or ion
is a composite of these called the resonance hybrid. (See benzene, page 6-5)
Of course, many molecules or ions do not have a "central atom". Organic molecules with
more than one C are obvious examples. Provided the structure is known, (i.e. which atoms
are bonded to which), extending the rules with common sense will work. [e.g. C2H2, H-C-C-
H, put pairs on C atoms evenly, and move both pairs to between C atoms to make a triple
bond.
H C C H H C C H
]
Condensed structures. The information provided by a Lewis structure can frequently also
be provided by a modified or condensed form which is easily understood once some basic
ideas are mastered. Often the non-bonding electron pairs are not shown. In many organic
compounds (compounds of carbon), chains of carbon atoms joined together are present. Thus
butan-1-ol, for which the complete Lewis structure is
H H H H
H C C C C O H
H H H H
can be represented as CH3CH2CH2CH2OH, where atoms joined to a carbon are shown on its
right before the adjoining atom is given. Butan-2-ol is CH3CH2CH(OH)CH3.
Ethanoic acid:
H
H C C O H
H O
Familiarity with these types of formulae comes with practice and experience based on the
electron structure and valency of the atoms of the elements.
Molecular shape. The shape of a simple molecule or ion describes the relative positions of
the nuclei of the atoms in the molecule. H2O is described as bent because the H-O-H atoms
do lie on a straight line. NH3 is described as trigonal pyramid because the N atom is above
the plane of the three H's which are at the corners of an equilateral triangle. CH4 is described
as tetrahedral because the C atom is in the middle and surrounded tetrahedrally by the four H
5-4
atoms. BF3 is trigonal planar, because the boron atom is in the centre of an equilateral
triangle with fluorines at each corner. CO2 and C2H2 are linear the O-C-O atoms and
H-C-C-H atoms lying in straight lines. It is difficult to give a simple description of shape of
more complex molecules such as butanol, ethanoic acid and sulfuric acid above. However
we can describe the arrangement of the atoms around a single atom. Thus in butanol above,
each C atom is surrounded tetrahedrally by four other atoms. In ethanoic acid the carbon
atom bonded to two O's and a C is in the centre in an equilateral triangle, the other carbon
atom being tetrahedrally surrounded by the three H's and one C.
Valence-shell electron pair repulsion (VSEPR) theory: A theory which gives a simple
rationale of shape (reason for the particular arrangement or shape). The "groups" of electrons
(i.e. a non-bonding electron pair, a bonding pair, the four electrons of a double bond, the six
electrons of a triple bond) around the central atom (as shown in the Lewis structure) keep as
far away from each other as possible. [e.g. NH3 is a trigonal pyramid - there are four pairs of
electrons tetrahedrally around the N, but the shape description only involves the atoms; H2O
is bent - there are four pairs of electrons tetrahedrally around the O; the carbonate ion, CO32–,
is a planar triangle; sulfur dioxide, SO2 is bent. In sulfuric acid the S is tetrahedrally
surrounded by four O's, and the H-O-S atoms do not lie on a straight line.]
EXERCISES
Draw Lewis structures for the following species. Unless otherwise stated the first element in the
formula is central and bonded individually to the other atoms. Remember to show non-zero
formal charge.
18. CH2ICH2CH2COCCCH(NH2)CH3
6-1
SECTION 6
Many organic compounds have common names which have arisen historically, or have
been given to them when the compound has been isolated from a natural product or first
synthesised. As there are so many organic compounds chemists have developed rules for
naming a compound systematically, so that it structure can be deduced from its name. This
section introduces this systematic nomenclature, and the ways the structure of organic
compounds can be depicted more simply than by full Lewis structures. The language is
based on Latin, Greek and German in addition to English, so a classical education is
beneficial for chemists!
Greek Latin
½ hemi semi
1 mono uni
1½ sesqui
2 di bi
3 tri ter
4 tetra quadri
5 penta quinque
6 hexa sexi
7 hepta septi
8 octa octo
9 ennea nona
10 deca deci
Organic compounds: Compounds containing the element carbon [e.g. methane, butanol].
(CO, CO2 and carbonates are classified as inorganic.) See page 1-4.
Special characteristics of many organic compounds are chains or rings of carbon atoms
bonded together, which provides the basis for naming, and the presence of many carbon-
hydrogen bonds. The valency of carbon in organic compounds is 4.
Straight chain hydrocarbons are named according to the number of carbon atoms: CH4,
methane; C2H6 or H3C-CH3, ethane; C3H8 or H3C-CH2-CH3, propane; C4H10 or H3C-CH2-
CH2-CH3, butane; C5H12 or CH3CH2CH2CH2CH3, pentane; C6H14 or CH3(CH2)4CH3,
hexane; C7H16, heptane; C8H18, octane; C9H20, nonane; C10H22, CH3(CH2)8CH3, decane.
Saturated compound: One having only single bonds [e.g. ethane, C2H6].
pent-, (5); hex-, (6); hept-, (7): oct-, (8); non-, (9); dec-, (10); alk-, general. The ending -ane
means no unsaturation (no double or triple bonds). Alkanes may be non-cyclic (acyclic) or
cyclic (contain rings). The general formula for an acyclic alkane is CnH2n+2 and for one
containing one ring CnH2n. In cyclic alkanes the stem gives the number of carbon atoms in
the ring. [e.g. c-C6H12 is cyclohexane, where c- means cyclic]
Unsaturated compound: A compound with one or more multiple (double or triple) bonds
[e.g. ethene (ethylene), CH2=CH2 ].
Alkyl group: In general, an alkane minus one hydrogen atom and represented by R [e.g.
CH3- is methyl (sometimes shown as Me); CH3CH2- is ethyl (sometimes shown as Et);
CH3CH2CH2- is propyl (sometimes shown as Pr); CH3CH2CH2CH2- is butyl (sometimes
shown as Bu)].
In straight chain alkanes the non-terminal carbon atoms are bonded to two other carbon
atoms. In a branched alkane one or more carbons are bonded to three or four other carbon
atoms.
Primary carbon atom: A carbon atom bonded to only one other C atom.
Branched hydrocarbons are named after the longest chain (saturated) or the longest chain
containing the double or triple bond (unsaturated) with the branched group given by its alkyl
name. [e.g. CH3C(CH3)2CH2CH3 is 2,2-dimethylbutane. ]
Isomers: Compounds with the same molecular formula but with their atoms arranged
differently [e.g. hexane and 2,2-dimethylbutane, both C6H14].
Functional group: An atom or group of atoms which give the compound distinctive
chemical properties [e.g. -Cl, -OH, >C=C<, -CO2H]. Thus all organic compounds except
saturated hydrocarbons have one or more functional groups. The functional group
determines the class of compound. In nomenclature the functional group may be identified
by a prefix, a suffix, or by the class of compound. (See below)
-F, fluoro-; -Cl, chloro-; -Br, bromo-; -I, iodo-; generally called haloalkanes (prefix) or alkyl
halides (class of compound). [e.g. CH3CH2Cl is chloroethane or ethyl chloride.
CH3CHFCH2CH3 is 2-fluorobutane or secondary butyl fluoride.]
-OH, hydroxy-, giving rise to alcohols. The -OH group can be named as the prefix hydroxy-,
as the suffix -ol replacing the -e of the alkane or as an alcohol. [e.g. CH3CH(OH)CH2CH3 is
butan-2-ol or secondary butyl alcohol; (CH3)3COH is 2-methylpropan-2-ol or tertiary butyl
alcohol].
-NH2, amino-, giving rise to amines. The -NH2 group can be named as the prefix amino-,
with the suffix -amine replacing the -e of the alkane or as an amine. [e.g. CH3CH2NH2 is
aminoethane, ethanamine or ethylamine.] Amines can be considered as ammonia with
hydrogens replaced by alkyl groups. If just one H is replaced the amine is a primary amine,
as above. If two hydrogens are replaced the amine is a secondary amine [e.g.
CH3CH2NHCH3, N-methylethanamine (the N shows the methyl substituent is bonded to
nitrogen) or ethyl methyl amine]. If all three hydrogens are replaced the amine is a tertiary
amine [e.g. (CH3)3N is trimethylamine].
(Note that for alkyl halides and alcohols 1o, 2o or 3o refers to the carbon atom to which the
halo or hydroxy group is attached. For amines it refers to the number of alkyl groups on the
nitrogen. Thus (CH3)3COH is a tertiary alcohol, but (CH3)3CNH2 is a primary amine.)
>C=O, carbonyl. If this is at the end of a chain the compound is an aldehyde, and named
with the suffix -al. [e.g.
CH3CH2 C H
O
is propanal or propyl aldehyde. It is more simply written as
CH3CH2CHO, but never as CH3CH2COH. You need to understand that the oxygen is bonded
to the carbon. This -CHO representation is used because the other would look too much like
an alcohol. ]
If the CO group is not at the end of a chain the compound is a ketone, and named with the
suffix –one. [e.g.
CH3CH2 C CH2CH3
O
is pentan-3-one, (or diethyl ketone). Propanone (dimethyl
ketone) is commonly called acetone. It is more simply written as CH3COCH3].
C OH
O
, carboxyl, giving rise to carboxylic acids. The suffix -oic and the word acid
6-4
are used in naming. [e.g. CH3CH2CH2CO2H is called butanoic acid. Methanoic acid,
HCO2H, is commonly called formic acid, and ethanoic acid, CH3CO2H, is commonly called
acetic acid.] The group is also often written as -COOH instead of -CO2H. The CH3CO-
group is commonly called the acetyl group. RCO- is an acyl group.
The product of the reaction of a carboxylic acid with a base is a carboxylic acid salt, an
ionic compound. The name of the cation is given first followed by the acid with the suffix -
oate replacing -oic. [e.g. CH3CH2CH2CO2–Na+ is sodium butanoate; CH3CO2–NH4+ is
ammonium ethanoate or ammonium acetate.] The general name for the anion is carboxylate.
When the OH of the carboxyl group is replaced by another group the compound is a
carboxylic acid derivative. If the OH is replaced by OR of an alcohol the compound is
called an ester. The R group is given first followed by the acid with the suffix -oate
replacing -oic [e.g. CH3CH2CO2CH2CH3 is ethyl propanoate]. When the OH group is
replaced by NH2 the compound is a primary amide. The suffix -amide replaces -oic. [e.g.
CH3CONH2 is ethanamide, more commonly called acetamide]. If the OH has been replaced
by an RNH the compound is a secondary amide, or by an RR'N group a tertiary amide,
and the alkyl group of the amine named as such with the prefix N to show it is bonded to the
nitrogen atom [e.g. CH3CH2CONHCH3 is N-methylpropanamide]. If the OH has been
replaced by a halo group the compound is an acyl halide, -oic becoming -oyl [e.g.
CH3CH2COCl is propanoyl chloride]. If the OH has been replaced by a carboxylate group,
OCOR, the compound is an acid anhydride. [e.g. CH3COOCOCH3 is ethanoyl anhydride
or acetic anhydride. An anhydride in general is a substance formed by removing the
elements of water from the compound.
[e.g. 2CH3CO2H → CH3COOCOCH3 + H2O ]
For compounds with larger carbon skeletons a further condensation of structural may be used.
is butylbenzene.
Benzene is C6H6 and is the parent of aromatic compounds. Each carbon in the benzene ring
has one hydrogen attached. As a second resonance structure with the double bonds in the
other three positions can be drawn, the resonance hybrid of benzene is often represented as
a hexagon with a circle inside:
i.e.
or
Phenyl group: Benzene minus one hydrogen, C6H5- (sometimes shown as Ph). [e.g.
C6H5CH2CH2CO2H is 3-phenylpropanoic acid.]
Benzyl group: C6H5CH2- [e.g. C6H5CH2Cl is benzyl chloride; C6H5CO2H is benzoic acid.]
Many substituted benzenes have common names. PhOH is phenol, PhCH3 is toluene; PhNH2
is aniline; PhCH=CH2 is styrene.
Vinyl Group: Ethene minus a hydrogen, CH2=CH-. [e.g. CH2=CHCl is vinyl chloride,
CH3CO2CH=CH2 is vinyl acetate. ] Vinyl compounds are the monomers of vinyl polymers.
[e.g. PVC, polyvinyl chloride; PVA, polyvinyl acetate. ]
EXERCISES
Write condensed formulae, but showing all double and triple bonds, for the compounds:
1. Example: 2-chlorohex-3-ene
Answer: CH3CHClCH=CHCH2CH3
8. nonanamide 9. N-ethylmethanamide
10-18. Give the systematic name of the compounds in questions 9-17 of section 5.
7-1
SECTION 7
Quantity: A property that is measured [e.g. mass, length, time, volume, pressure].
Unit: A standard quantity against which a quantity is measured [e.g. gram, metre, second,
litre, pascal; which are units of the above quantities].
Chemists measure various quantities. If the mass of a substance was found to be 6.0 grams
this can be expressed as an equation
m = 6.0 g
Here m is the symbol for the quantity mass, 6.0 is a number and g is the symbol for the gram,
a standard quantity of mass. The equation is shorthand for
mass = 6.0 x (1 gram)
In general an equation of measurement takes the form
quantity = (number) x (unit)
In print, the symbols for quantities are shown in italics and for units in regular type as is done
above.
The equation may be manipulated by the normal rules of algebra. Thus the heading of a table
or the axis of a graph could be labelled m/g (i.e. mass in grams) and numbers only tabulated
or shown on the axis.
It is important to realise that the magnitude of a quantity expressed as a number without units
for the quantity is meaningless unless the quantity is in fact a ratio and is dimensionless (i.e.
has no units since the units in the numerator and denominator cancel).
Many quantities are defined in terms of other quantities. Thus density, symbol ρ, is defined
as mass per unit volume. Thus if the mass and volume of a sample of a substance are known,
the density is calculated by dividing the mass by the volume, density = mass/volume or ρ =
m/V.
[e.g. a 5 cubic centimetre sample has a mass of 15 grams. Calculate its density.
ρ = m/V = 15 g/5 cm3 = 3 g cm-3. ]
For many quantities there are different systems of units. It is essential that one can convert
from one set of units to another. This is simply done by replacing the units in the equation by
their values in terms of the desired unit [e.g. If the velocity of a particle is 200 miles per hour
7-2
Units
International System of Units (SI units): The internationally adopted system which defines
or expresses all quantities in terms of seven basic units, the six used by chemists being:
length metre m
mass kilogram kg
time second s
temperature kelvin K
amount of substance mole mol
electric current ampere A
Other quantities commonly used in chemistry, and which have special names for the units
derived from these basic units are:
Further quantities used in chemistry but without special names for the derived units are:
area, m2; volume, m3; density, kg m-3; absorbance, dimensionless (therefore no units).
Coherent SI units: The base units, and those derived from them. Thus all the units shown
above are coherent SI units. Note that the base unit of mass is the kilogram. This is the only
base unit which has a multiple prefix (see below). If, in a calculation of a quantity involving
several other quantities, only coherent SI units are used, the units of the required quantity will
be coherent (i.e. the appropriate base unit).
The sizes of these units are often unsuitable for some measurements and the decimal
multiples, shown below with the name and symbol of the prefix, are used:
Some multiple units have their own name, the three relevant for chemists being:
Units may be written out in full or the symbol used. A mixture of full word and symbol is
not permitted [e.g. kgram is not permitted]. The letter s is never added to the symbol to
indicate a plural. A full stop is not written after symbols except at the end of a sentence.
Those symbols named after a person have a capital first letter, but when the name of the unit
is written out in full a lower case first letter is used [e.g. J, joule].
When two or more symbols are combined to indicate a derived unit, a space is left between
them. A space is also left between the number and the symbol for the unit, but no space is
left between the prefix indicating powers of ten and the symbol to which it applies. When
symbols are combined as a quotient, [e.g. metres per second], either power to the minus one
or the solidus may be used [e.g. m s-1 or m/s]. But the solidus may only be used once in a
derived unit to avoid ambiguity [e.g. writing kg/m/s2 for pascal could be interpreted as
kg m-1 s-2 or as kg m-1 s2].
Quantity calculus: The manipulation of the mathematical equations relating quantities and
their measured values using the rules of algebra. All calculations in this manual follow the
rules of quantity calculus. When one quantity is multiplied by another, no space is left
between their symbols, [e.g. m = ρV]. In calculations prefixes for multiples can be replaced
by their numerical values. [eg. Convert the density of 3 g cm-3 into coherent SI units.
The coherent units for density will be kg m-3. 1 g = 10-3 kg , and 1 cm = 10-2 m.
ρ = 3 g cm-3 = (3 x 10-3 kg) x (10-2 m)-3 = 3 x 103 kg m-3. ]
The calorie, still widely used in USA, is the energy required to raise the temperature of 1 g of
liquid water 1 oC. Electron volts are useful at the atomic or molecular level, and kilowatt
hours are the common unit for power consumption.
7-4
EXERCISES
Write the equations for the following statements using powers of 10 in place of prefixes.
Express the following numbers under the given heading in a table as a normal equation for
the quantity.
5. Example: 4.2 under the heading 105 m/g Answer: 105 m/g = 4.2 m = 4.2 x 10-5 g
6. 23 under the heading 10-2 t/s 7. 7. 8 under the heading 105 p/Pa
SECTION 8
Suppose a chemist wishes to carry out the chemical reaction of adding bromine to hexene
to give dibromohexane, C6H12 + Br2 → C6H12Br2, starting with a known amount of
hexene. How does the chemist know how much bromine is needed? The chemical
equation tells you that one molecule of dibromine is needed for each molecule of hexene.
But the very large numbers of molecules required for reactions on a practicable scale
cannot be counted. If the mass of hexene is known how could the mass of bromine
required be calculated? This section tells how this type of question is answered. It
requires the introduction of a new quantity specific to chemistry , amount of substance, and
it it th l
Amount of substance: symbol n, a quantity fundamental to chemistry. Atoms and molecules
are much too small or light to be counted or weighed individually in the laboratory. The
chemist therefore needs a unit to specify the quantity amount of substance of an appropriate
magnitude (size) for laboratory or industrial scale work. The chosen unit is the mole.
Mole: symbol mol, the unit of the quantity amount of substance. The mole is defined as the
amount of substance of a system which contains as many elementary entities as there are
atoms in 12 grams of carbon-12 (i.e. carbon consisting only of the isotope 12C).
12 g is an easily measurable mass. When the mole is used, the elementary entities must be
specified and may be atoms, molecules, ions, electrons, other particles or specified groups of
such particles.
It follows from this definition of the mole that x moles of dihydrogen (H2,) will contain
exactly the same number of dihydrogen molecules as there are dioxygen molecules (O2) in x
moles of dioxygen or water molecules (H2O) in x moles of water. Thus it follows from the
chemical equation
2H2 + O2 → 2H2O
that 2 moles of dihydrogen react with 1 mole of dioxygen to give 2 moles of water, i.e. the
chemical equation is also a simple way of expressing the reaction of measurable amounts of
substances as well as of individual molecules. Thus the chemical equation (page 2-2)
C2H6 + 7/2O2 → 2CO2 + 3H2O
is quite satisfactory when the reaction coefficients refer to amounts measured in moles.
Molar mass: symbol M, the mass per mole of substance (the substance being defined by its
chemical formula). (Molar means per mole in this context.) The mass of any substance is
proportional to the amount of that substance and the proportionality constant is its molar
mass;
m = Mn. [e.g. for water m = 18 g when n = 1 mol; 18 g = M(H2O) x 1 mol;
M(H2O) = 18 g/(1 mol) = 18 g mol-1.]
This is usually written as m = nM. (i.e. mass of substance is the amount in moles multiplied
by the mass per one mole). Commonly used units are grams per mole [e.g. M(12C) = 12 g
mol-1]. The molar mass of the atoms of each element in units of grams per mole (g mol-1) is
given in the periodic table immediately under the symbol for the element. The molar mass of
any substance defined by its chemical formula is the sum of the molar masses of all of its
constituent atoms.
[ e.g. M(H2O) = 2M(H) + M(O) = (2 x 1.01 + 16.00) g mol-1 = 18.02 g mol-1 ]
The amount of substance is normally obtained by weighing, (i.e. by measuring its mass using
8-2
a balance), and converting the mass of the sample to the amount of the sample in moles by
m
rearranging the equation m = nM to give n = .
M
[e.g. What is the amount of copper of 20.0 g of the metal?
m(Cu) 20.0 g
n(Cu) = = = 0.3150 mol].
M (Cu) 63.5 g mol -1
For a liquid the volume might be measured and this converted to amount in moles by using
both the density and the molar mass of the substance.
[ e.g. What is the amount of tetrachloromethane in a 20.0 cm3 sample? ρ(CCl4) = 1.584 g
cm-3; M(CCl4) = 153.8 g mol-1. Convert from volume to mass using the density,
m(CCl4) = ρ(CCl4)V(CCl4),
and then to amount using the molar mass,
m(CCl 4 ) ρ (CCl 4 )V (CCl 4 )
n(CCl4) = = {by replacing m(CCl4) by ρ (CCl4)V(CCl4)}
M (CCl 4 ) M (CCl 4 )
1.584 g cm -3 × 20.0 cm 3
= = 0.206 mol ]
153.8 g mol -1
The most useful expression for the stoichiometry of the above general chemical equation is
n(A) n(B) n(C) n(D)
= = =
a b c d
m
This equation and n = are two of the most important equations used in practical
M
quantitative chemistry.
Avogadro Constant: Symbol NA or L, the number (of entities) per mole. From many varied
measurements its value has been determined as 6.022 x 1023 mol-1.
Atomic mass constant: Symbol mu, One twelfth of the mass of one atom of 12C.
Also sometimes called unified atomic mass unit, symbol u, previously amu.
1
/ × 12 g mol -1 1 g mol -1
Thus mu = 12 = = 1.667 x 10-24 g
NA 6.022 × 10 23 mol -1
Relative atomic mass: Symbol Ar, mean mass of one atom of an element (i.e. taking into
account the relative natural abundance of the isotopes) relative to (i.e. divided by) mµ. With
8-3
the exception of the heaviest elements which have been formed from different radioactive
isotopes, in general the relative amounts of the different isotopes of an element is
independent of its source [e.g. chlorine, Ar(Cl) = 35.45, consists naturally of 75.5% 35Cl and
24.5% 37Cl].
Note that the relative atomic mass has no units because it is the ratio of two masses. Most
reference books and periodic tables simply give Ar values for the elements. From a practical
viewpoint it is most important to realise that the numerical value of the molar mass M(E) is
equal to Ar(E) when the units of molar mass are g mol-1 .
Atomic weight: An older term for mean molar mass of an element, M(E), but sometimes
used for relative atomic mass, Ar(E).
Relative molecular mass: Symbol Mr, the mass of one molecule of the substance relative to
mµ. It is simply the sum of all the Ar values of the atoms in the molecule.
Instead of stating the relative molecular mass of a large molecule is, for example, 20,000,
biochemists often say the molecular mass is 20 000 daltons or 20 000 Da or 20 kDa. The
dalton is just another (friendlier) name for the unified atomic mass constant, mµ, and is not a
unit in the sense of the gram (or the second, or the mole, or the metre) because its value
depends on the Avogadro constant, an experimentally derived quantity. The dalton is never
used in chemical calculations.
Molecular weight: An older term for molar mass, but sometimes used for relative molecular
mass.
The term "relative molecular mass" is also used for an ionic substance or for substances
which do not exist as discrete molecules, such as MgO or SiO2 [e.g. Mr(MgO) = 40]. The
formula given with the symbol Mr makes it quite clear what is meant. Some authors try and
avoid this problem by using the term "relative formula mass". But this is somewhat
unsatisfactory because formulae are concepts and do not have mass!
EXERCISES
Determine the amount of substance in the given masses of the following compounds. (Molar
masses for the elements in grams per mole are given in the periodic table.)
Determine the mass of the product that would be formed from the given mass of reactant in the
following reactions.
8-4
10. Sulfuric acid from 100 t of sulfur in the manufacture of sulfuric acid
S8 + 12O2 + 8H2O → 8H2SO4
11. Acetic acid from 500 L of ethanol (ρ = 0.785 g cm-3), in making vinegar
CH3CH2OH + O2 → CH3CO2H + H2O
9-1
SECTION 9
The mass of a gas cannot easily be measured by weighing as is done for a liquid or solid.
However the volume of the gas’s container, and the pressure and temperature of the gas can
be measured. This section tells you about experimental laws and a famous hypothesis which
allow the determination of the amount of a gas from its volume, pressure and temperature.
Then it briefly gives the simple theory that rationalises these laws.
Ideal gas: A gas that obeys Boyle's law and Charles's law, and hence the Ideal gas
equation.
Boyle's law: The pressure, p, of a fixed mass of gas is inversely proportional to its volume,
V, at constant temperature (i.e. p ∝ 1/V).
Charles's law: The volume, V, of a fixed mass of gas is proportional to its absolute
temperature, T, at constant pressure (i.e. V ∝ T).
It is found experimentally that at constant pressure and temperature the volume of a gas is
directly proportional to the amount of gas, n, and at constant volume and temperature the
pressure is directly proportional to the amount of gas, n.
Avogadro's hypothesis: Equal volumes of different gases at the same temperature and
pressure contain the same number of molecules (or atoms for monoatomic gases).
Ideal gas equation: pV = nRT R is called the universal gas constant, and has the value
8.314 J K-1 mol-1. This equation is particularly useful in determining the amount of a gas
from its volume, pressure and temperature.
[e.g. Calculate the mass of dinitrogen in 500 litres at a pressure of 200 kPa and a temperature
of 100oC. n(N2) is obtained from the ideal gas equation, and the mass from the molar mass:
pV 200 x 10 3 Pa x 0.500 m 3
n(N2) = = = 32.2 mol
RT 8.314 J K -1 mol -1 x 373 K
Ideal gas: a gas for which the individual molecules or atoms occupy negligible volume, and
for which there are no attractive or repulsive forces between the molecules (or atoms).
Dalton's law of partial pressures: The total pressure of a mixture of gases is the sum of the
partial pressures of the individual gases in the mixture. All real gases deviate from ideal
behaviour, the deviation increasing with increasing p and decreasing T.
Partial pressure: The pressure that a particular gas in a mixture of gases would exert if it
alone occupied the container.
9-2
The kinetic theory of gases makes the following assumptions for an ideal gas:
1. Gases are made up of molecules whose sizes are negligible compared with the
distance between them.
2. There are no forces between the molecules (except in a collision).
3. Between collisions the molecules are constantly moving in straight lines and their
motion is completely random.
4. The molecules are constantly colliding with one another and with the walls of the
container, all collisions being elastic (i.e. no loss of kinetic energy).
5. The collisions with the walls of the container give rise to the measured gas pressure.
Vapour: An alternative term for gas. It is usually used when it is in contact with the liquid
form, solid form or solution of the same substance, or is at a temperature at which it could be
made to condense by increasing its pressure. The term evaporation illustrates this.
EXERCISES
4. The change in pressure if a given volume of xenon at 100 kPa is heated from 298 K to
800 K
SECTION 10
CHEMICAL ANALYSIS
A large number of professional chemists are analysts. They determine things like "how
much of a particular compound is in a sample of a substance", or "the amount of a
particular element in a compound or mixture", or "the concentration of compound or ion
in a water sample". When a chemist makes what is believed to be a new compound, an
elemental analysis is carried out, i.e. the percentage by mass of each element in the
compound is determined and compared with the theoretical figure for the compound.
Chemical analysis is central to the practice of chemistry.
Three main quantities that are measured in analysis are mass, volume, and intensity of a
beam of electromagnetic radiation, giving rise respectively to gravimetric, volumetric and
spectrophotometric methods of analysis. In this section, after you have been given the
definitions of ways the composition of a system can be expressed, you are introduced to
these three classes of analysis.
Concentration: Symbol c, the "amount" of solute per unit volume of the solution. The
"amount" may be given as mass, and c = m/V, where m is the mass of solute and V the
volume of the solution (common unit g L-1), or using the formal definition of amount of
substance as
c = n/V, (common unit mol L-1). For a given solute, concentration in one set of units may be
m
converted to the other using m = nM or n = [e.g. 5.50 g of sodium chloride was dissolved
M
in water to give 200 mL of solution. Determine the concentration.
m( NaCl) 5.50 g
c(NaCl) = = -3
= 27.5 g L-1
V ( NaCl) 200 x 10 L
The term molarity, symbol M, is an old term no longer approved by the International Union
of Pure and Applied Chemistry (the body which determines the rules on the language of
chemistry), but unfortunately often still used by analytical chemists for concentration in units
10-2
of mol L-1. [e.g. The molarity of the above NaCl solution is 0.470; it is a 0.470 M solution of
NaCl; in speech it may be described as a 0.470 molar solution. Here molar means mol L-1,
not per mole. This is an example of chemists having two different meanings for the same
word. The meaning is made clear by the context in which the word is used.]
Mole fraction: Symbol x, the amount of a substance or entity (molecules, atoms or ions) in a
mixture as a fraction of the total amounts of substances or entities in the mixture. [e.g. 1.0 g
of sodium chloride is dissolved in 10 g of water. What is the mole fraction of NaCl in the
solution?
n(NaCl)
x=
n(NaCl) + n(H 2 O)
m(NaCl) 1.0 g
n(NaCl) = = = 0.017 mol
M (NaCl) 58.5 g mol -1
m(H 2 O) 10 g
n(H2O) = = = 0.555 mol
M (H 2 O) 18 g mol -1
0.017 mol
x= = 0.030 ]
(0.017 + 0.555) mol
Molality: The amount of solute per kilogram of solvent. (units: mol kg-1)
Percentage composition: There are various forms of this. %w/w is percentage by mass of
the substance relative to the total mass. %w/V is the mass of substance in grams divided by
the volume of the solution in millilitres and multiplied by 100. (Chemists here use w for
mass, originating from the loose use of the word weight.) %V/V is the percentage by volume
of the substance relative to the total volume.
Parts per million: Symbol ppm: a ratio. For a gaseous mixture, the mole ratio, (mol/mol).
For solutions, normally calculated from mg of substance per kg of solution, but for dilute
aqueous solutions as mg of substance per litre of solution. For solids, the mass ratio.
This section will cover three classes of chemical analysis, gravimetric, volumetric, and
spectrophotometric.
[e.g. The silver in a 100 g ore sample was recovered as 4.55 g of pure silver chloride.
Determine the percentage mass of silver in the sample.
Ag(ore) → AgCl(s)
Silver chloride is AgCl. Identify the quantities known and to be determined: m(AgCl) and
m(Ag) respectively. From the stoichiometry determine the relationship between them:
n(Ag) = n(AgCl).
m(AgCl) 4.55 g
n(Ag) = n(AgCl) = = = 0.317 mol
M (AgCl) (107.9 + 35.5) g mol -1
m( Ag) 3.42 g
% mass = × 100 = × 100 = 3.42 ]
m(sample) 100 g
It can be useful to derive the overall expression between the required unknown and known
quantities and put all the numerical values into this expression at the end.
[e.g. In the above example:
m(AgCl)M (Ag) 4.55 g × 107.9 g mol -1
m(Ag) = n(Ag)M(Ag) = n(AgCl)M(Ag) = =
M (AgCl) (107.9 + 35.5) g mol -1
= 3.42 g]
Equivalence point or stoichiometric point: The stage of a titration where the volume added
from the burette (the titre) contains the exact amount of B required to react with all of A
according to the chemical equation for the reaction
n(A) n(B)
For aA + bB → cC + dD it is where = .
a b
I ct(B) is known, (i.e. B is a standard solution), and nt(A) is to be determined. Here the
subscript t has been used to emphasise these are quantities in the actual titration step.
The amount of A in the conical flask is determined from the titre, the volume of
solution B, Vt(B), delivered from the burette:
an t (B) ac t (B)Vt (B)
nt(A) = = .
b b
From nt(A), the amount of A in the flask, information such as the concentration of a
solution of A, the amount of A in a mixture, or the percentage purity of a substance
may be determined.
[ e.g. A 25.0 mL aliquot (a small known volume of solution) of hydrochloric acid was
transferred with a pipette ( device which delivers a fixed known volume of solution)
to a conical flask and titrated with 0.150 mol L-1 sodium hydroxide solution, the
reaction being
HCl + NaOH → NaCl + H2O
The titre was 23.4 mL. Determine the concentration of the HCl solution.
Stoichiometry: nt(HCl) = nt(NaOH) = = ct(NaOH)Vt(NaOH)
II nt(A) is known, and c(B) is determined. This is called standardising the solution of
10-4
B. The amount of A may be obtained (a) from the mass of a very pure substance A
(known as a primary standard) determined by weighing and calculating n(A) from
n(A) = m(A)/M(A), or, (b) if A does not have the properties of necessary for a
primary standard, weighing out some other primary standard substance, X, that gives
A in a stoichiometric
an(X) am(X)
reaction, xX → aA so that n(A) = = .
x xM (X)
[e.g. Potassium iodate, KIO3, a primary standard reacts with excess iodide to produce
a known amount of iodine which is not a primary standard. The chemical equation is
IO3– + 5I– + 6H+ → 3I2 + 3H2O
3m(KIO 3 )
Here X is IO3– and A is I2 and n(I2) = 3n(IO3–) = ]
M (KIO 3 )
bn t (A) bm t (A)
nt(B) = = (because n = m/M)
a aM (A)
bm t (A)
c(B) =
aM (A)Vt (B)
2m t (Na 2 CO 3 )
Stoichiometry: nt(HCl) = 2nt(Na2CO3) =
M (Na 2 CO 3 )
n t (HCl) 2m t (Na 2 CO 3 )
c(HCl) = =
Vt (HCl) M (Na 2 CO 3 )Vt (HCl)
2 × 0.200 g
= = 0.192 mol L-1
{(2 × 23.0 + 12.0 + 3 × 16.0) g mol -1 × 19.7 × 10 -3 L}
nf (A) m(A)
cf(A) = =
Vf (A) M (A)Vf (A)
where the f refers to the volumetric flask. The amount of A used in the titration is
nt(A) = cf(A)Vp(A) (because c = n/V)
m(A)Vp (A)
=
M (A)Vf (A)
Again m(A) and Vt(B) are measured in the experiment, the molar mass of A and the
volumes of the flask and pipette being known.
nf (Na 2 CO 3 ) m (Na 2 CO 3 )
cf(Na2CO3) = = f
Vf M (Na 2 CO 3 )Vf
23.7 g
= = 0.894 mol L-1
106.0 g mol × 0.250 L
-1
nt(Na2CO3) = cf(Na2CO3)Vp
Absorbance: Symbol A, log10(Io/I), where Io in the intensity of the light beam entering the
solution and I the intensity leaving it. [e.g. If 90% of the incident light is absorbed by the
solution, A= 1.] Optical density is an older term for absorbance.
Beer's law (Beer-Lambert law): A = εcb. This states that the absorbance, A, of a solution is
proportional to the concentration of the absorbing solute, c, and the pathlength, b, of the light. ε
is the proportionality constant. (l is sometimes used in place of b.)
Molar absorptivity: The value of ε when the concentration of the solute is measured in mol
L-1. (Extinction coefficient is an older term for this.) The value of ε varies with the
wavelength, λ, of the light.
[e.g. Calculate the concentration of a solute, with ε = 1200 L mol cm-1, for which the
absorbance is 0.450 when measured in a 1.0 cm cell.
A 0.045
c= = = 3.75 x 10-4 mol L-1 = 375 µmol L-1 ]
ε b 1200 L mol cm × 1.0 cm
-1 -1
EXERCISES
From the masses of the compounds dissolved in the given volumes in questions 1-3 calculate
the concentrations of the solutions in units of (a) g L-1 and (b) mol L-1.
3. 5.234 g of the primary standard oxalic acid, H2C2O4.2H2O, made up to the mark in a
100 mL volumetric flask
4. A sodium hydroxide solution was standardised by titrating against the above oxalic
solution (question 3). A 10 mL aliquot of the oxalic acid took 18.52 mL of NaOH to
reach the equivalence point for the reaction
H2C2O4 + 2NaOH → Na2C2O4 + 2H2O
Determine the concentration of the sodium hydroxide solution.
5. The standardised NaOH solution of question 4 was used to determine the percentage
purity of a sample of ammonium sulfate, (NH4)2SO4. 0.8548 g of the ammonium
sulfate was weighed into a conical flask and titrated with the NaOH solution
according to the equation below, the titre being 26.75 mL. Determine the percentage
purity.
(NH4)2SO4 + 2NaOH → Na2SO4 + 2NH3 + 2H2O
7. A solution of an azo dye with a molar absorptivity of 17 500 L mol -1 cm-1 at 560 nm
wavelength had an absorbance of 0.528 when measured in a 0.50 cm cell at this
wavelength. Determine the concentration of the dye. If the relative molecular mass of
the dye was 468 calculate the mass of dye in a 20 litre vat.
11-1
SECTION 11
THERMOCHEMISTRY
Most chemical reactions are accompanied by the release of energy to the surroundings or
absorption of energy from the surroundings, or put more simply the reacting system gets
hotter or cooler as the reaction proceeds. The most common form of energy transferred is
heat. This section introduces the language used in measuring and representing the heat
changes that occur, and how the amount of heat released or absorbed in a chemical
reaction can be calculated from tabulated data for the reactants and products of the
ti
Thermochemistry: Study of the heat released or absorbed by chemical reactions.
Rearrangements of atoms that occur during chemical reactions involve both bond breaking
and bond formation. Bond breaking results in absorption of heat from the surroundings and
bond formation in release of heat to the surroundings.
Heat: Energy transferred as a result of a temperature difference between a system and its
surroundings. The quantity of energy transferred from the surroundings to the system is
given the symbol q. The system means the substance, or reactants and products of a reaction,
and the surroundings everything else. When energy is transferred from the system to the
surroundings q is negative. Chemists frequently make measurements at constant
(atmospheric) pressure. Energy transferred at constant pressure is given the symbol qp.
A chemical equation can be made more meaningful and informative by showing the states of
the reactants and products and the quantity of heat released or absorbed.
[e.g. 2H2(g) + O2(g) → 2H2O(l) ∆rH = -570 kJ mol-1
implies that when 2 moles of gaseous dihydrogen reacts with one mole of gaseous dioxygen
to give two moles of liquid water 570 kilojoules of energy is released from the reacting
system to its surroundings.] The ∆ means change, r stands for reaction and H is the symbol
for enthalpy. ∆rH is the enthalpy change of the reaction.
Enthalpy change: Symbol ∆H, the change in energy of a system which undergoes a change
at constant pressure. ∆H = qp
Exothermic reaction: A reaction that releases energy to the surroundings. ∆rH < 0
Endothermic reaction: A reaction that absorbs energy from the surroundings. ∆rH > 0
∆rH is negative for an exothermic reaction (the energy of the system, the reactants and
products, is less after the reaction than before) and positive for an endothermic reaction (the
energy of the system is greater than before).
Note that the per mole (mol-1) in the units of ∆rH refers to the stoichiometric coefficients in
the equation as amounts in moles. Thus if the above equation were written as
H2(g) + ½O2(g) → H2O(l), then ∆rH = -285 kJ mol-1.
It is most important to understand the difference between the enthalpy change of a system,
and
that of a reaction. The magnitude of the former depends on the amount present in the system
and has units of energy, e.g. kJ, while the amount of the latter is defined by the chemical
equation and has common units of kJ mol-1.
11-2
Latent heat: An old term for the enthalpy change of a change in state.
[e.g. H2O(s) → H2O(l) ∆H = 6 kJ mol-1 . Ice has to be heated for it to melt, so ∆H is
positive. This is called the enthalpy of fusion (or melting) and given the symbol ∆fusH(H2O).
The symbols for enthalpy of sublimation and vaporisation are ∆subH and ∆vapH respectively.]
Note: The convention used here is to place the explanatory subscript between the ∆ and H, as
recommended by IUPAC, the International Union of Pure and Applied Chemistry. Until
recently the subscript was placed after the H and r was omitted for enthalpy changes of
chemical reactions.
Heat capacity: symbol C, the ratio of the heat supplied to the temperature rise produced. i.e.
the energy required to raise the temperature of a substance or system by one degree (oC or K)
qp
when no chemical or phase changes occur. (i.e. C = ; SI units, J K-1)
∆T
Heat capacity at constant pressure: symbol Cp, the heat capacity when the change occurs at
constant pressure, the most common condition.
Specific heat capacity: Symbol cp, the heat capacity of unit mass of a substance; common
units, J K-1 g-1.
Molar heat capacity: Symbol Cp,m, the heat capacity of one mole of a substance; common
units, J K-1 mol-1.
[e.g. The absorption of 390 J of heat by a 100 g block of copper caused its temperature to
increase by 10 oC. Calculate the heat capacity of the block and the specific and molar heats
of copper.
qp 390 J
Cp(block) = = = 39.0 J K-1
∆T 10 K
C p (block) 39.0 J K -1
cp(Cu) = = = 0.390 J K-1 g-1
m(Cu) 100 g
C p (block) C p (block)M (Cu) m
Cp,m(Cu) = = (as n = )
n(Cu) m(Cu) M
39.0 J K -1 x 63.5 g mol -1
= = 24.8 J K-1 mol-1 ]
100 g
If the reaction of a known amount of substance X, n(X), is carried out in a calorimeter and
the temperature change measured, the enthalpy change for that reaction (written with 1 mole
of X in the equation) can be calculated as the actual energy transferred is given by q = -Cp∆T
qp - Cp∆T
and ∆ r H = = . Note the negative sign because if the temperature of the
n(X) n(X)
calorimeter rises (∆T positive) energy has been transferred from the reaction system to the
calorimeter (the surroundings) and the reaction is exothermic.
[e.g. When 16 g of sulfur is combusted to sulfur dioxide 149 kJ of energy is released.
Determine ∆rH for the reaction S(s) + O2(g) → SO2(g)
11-3
m(S) 16 g
n(S) = = = 0.50 mol
M (S) 32 g mol -1
qp - 149 kJ
∆r H = = = - 298 kJ mol -1 ]
n 0.50 mol
Heat of formation of a substance: Symbol ∆fH, the heat (enthalpy) change when one mole
of that substance is formed from its elements in their standard states. By convention an
element in its most stable form at 100 kPa pressure and 25 oC (298 K) is said to be in its
standard state and to have an enthalpy of formation, ∆fH, of zero [e.g. from the reaction of
hydrogen and oxygen above, it follows that ∆fH(H2O) = -285 kJ mol-1 ].
Heat of combustion of a substance: Symbol ∆cH, the heat given out when one mole of that
substance reacts with dioxygen to give the most oxidised products.
[e.g. ∆cH(CH4) is the enthalpy change for the reaction
CH4(g ) + 2O2(g) → CO2(g) + 2H2O(l)
From the appropriate equation above it can be seen that ∆cH(H2) = ∆fH(H2O). ]
Hess's law (of constant heat summation): The enthalpy change for a reaction is
independent of the way the reaction is carried out (i.e. it depends only on the initial
conditions of the reactants and the final conditions of the products). Put another way if a
reaction is carried out in a number of steps the enthalpy change is the sum of the enthalpy
changes for each individual step. [e.g.
(1) CO(g) + ½O2(g) → CO2(g) ∆rH1 = ∆cH(CO) = -282 kJ mol-1
(2) C(s) + O2(g) → O2(g) ∆rH2 = ∆fH(CO2) = ∆cH(C) = -393 kJ mol-1
Imagine that we burn graphite (the most stable form of carbon) and then decompose the CO2
to CO and O2:
(2) C(s) + O2(g) → CO2(g) ∆rH2
(3) CO2(g) → CO(g) + ½O2(g) ∆rH3 = -∆rH1 Note that the sign of ∆rH
changes when the reaction direction is reversed.
Adding (2) and (3):
(4) C(s) + ½O2(g) → CO(g) ∆rH4 = ∆rH(CO) = ∆rH2 + ∆rH3 = ∆rH2 - ∆rH1
= -111 kJ mol-1 ]
where ∑ means "the sum of". This is a very useful expression because the enthalpy change
for any reaction can be calculated from tables of heats of formation of the compounds
involved.
[e.g. For the reaction F3O4(s) + 4H2(g) → 3Fe(s) + 4H2O(l)
∆rH = 3∆fH{Fe(s)} + 4∆fH{(H2O(s)} - ∆fH{Fe3O4(s)} - 4∆fH{H2(g)}
= 4∆fH{H2O(l)} - ∆fH{Fe3O4(s)} because ∆fH for an element is zero. ]
Bond enthalpy (strength): The energy needed to break a chemical bond, with the bonding
electrons being evenly divided between the fragments [e.g. The oxygen-oxygen bond strength
of dimethyl peroxide, CH3O-OCH3, is ∆rH for the reaction CH3OOCH3 → 2CH3O· ].
11-4
EXERCISES
1. The absorption of 62.76 kJ of heat by 500 g of liquid water caused its temperature to
rise by 30 oC. Calculate the specific heat capacity of water in (i) J g-1 K-1 and
(ii) in cal g-1 K-1and the molar heat capacity of water in J mol-1 K-1. (1 cal = 4.184 J)
4. Carbon disulfide, CS2, has a boiling point of 46 oC. The products of combustion are
CO2 and SO2. (i) Write the equation for its combustion. (ii) Calculate ∆fH(CS2)
given the following ∆cH/kJ mol-1: CS2 = -1077; C = -393; S = -297
5. Calculate the approximate ∆rH for the reaction CH4 + Cl2 → CH3Cl + HCl
from the following average bond strengths / kJ mol-1: C-H = 415, C-Cl = 327,
H-Cl = 431, Cl-Cl = 242 (Consider what bonds are broken and what bonds are
made.)
12-1
SECTION 12
Many reactions may be thought to be between a substrate and a reagent. The classification
is based on the change in structure of the substrate.
12-2
(b) Addition: The reagent adds to the substrate, often across a double or triple bond.
[e.g.
(i) H2C=CH2 + Br2 → Br-CH2-CH2-Br
substrate reagent
Bromine adds across the double bond of ethene (ethylene).
(c) Elimination: Atoms or groups are lost from neighbouring atoms of the substrate with
the formation of a double or triple bond. Effectively a small molecule is
eliminated.
[e.g. (i)
H H
KOH
CH3 C C CH3 CH3 CH CH CH3 + ( HBr )
alcohol
H Br
H and Br are eliminated from adjacent carbon atoms.
(ii)
H
K2Cr2O7
CH3CH2 C CH3 CH3CH2 C CH3 + ( 2e- + 2H+)
OH O
Hydrogen is eliminated from adjacent carbon and oxygen atoms. This loss of two H
atoms is more commonly called oxidation. See D, redox reactions. ]
(d) Substitution: One group on the substrate is replaced by (substituted for) another.
[e.g.
(i) CH3-CH2-CH2-Br + OH– → CH3-CH2-CH2-OH + Br–
Br replaced by OH
(e) Condensation: Two molecules are joined and a small molecule is eliminated.
Condensation can be thought of as particular type of substitution.
[e.g.
CH3-CO-OH + CH3-CH2-OH → CH3-CO-O-CH2-CH3 + H2O
OH is replaced by OCH2CH3 and water is eliminated. ]
C. Acid-base
base.
[e.g. HCl(g) + NH3(g) → NH4Cl(s)
The acid hydrogen chloride transfers H+ to the base ammonia to give the ionic solid
ammonium chloride (composed of NH4+ and Cl– ions).
HCl(g) + H2O(l) → H3O+(aq) + Cl– (aq)
The gas hydrogen chloride acts as an acid as it transfers H+ to a water molecule which
is acting as a base. ]
A hydrogen ion, H+, is just a proton, and these acid-base reactions are called proton transfer
reactions. An acid is defined as a proton donor and a base is defined as a proton acceptor.
This is the Brønsted-Lowry definition. A base must have a non-bonding pair of electrons
which can be used to form a bond with a proton.
Brønsted acid: a proton donor, i.e. a species which donates a proton in a chemical reaction
[e.g. HCl in the above examples].
Brønsted base: a proton acceptor, i.e a species which accepts a proton in a chemical reaction
[e.g. NH3 and H2O in the above two examples].
Oxonium (hydronium) ion: the cation H3O+, often written as H+(aq) or just H+ in equations
in water (water, aqua, aq). It is important to realise the proton, H+, does not exist as such in
condensed matter, i.e. liquid or solid state. The term hydronium is still widely used
Hydroxide ion: the anion OH–. (As it is the O which has the formal charge of -1, HO– would
be a more correct formula, but OH– is usually written).
Conjugate acids and bases: When an acid loses a proton, its product is called the conjugate
base of that acid. When a base accepts a proton its conjugate acid is formed [e.g. HCl/Cl–,
NH4+/NH3, H3O+/H2O, and H2O/OH– are conjugate acid-base pairs].
Neutralisation: The reaction between an acid and a base [e.g. reaction of aqueous HCl and
NaOH to give NaCl and H2O ].
Salt: the product (other than water) of a neutralisation reaction between an acid and a base.
Salts are ionic compounds [e.g. NaCl in the above neutralisation reaction].
Redox reaction: A reaction in which one reactant is oxidised and another is reduced. The
concept of oxidation and reduction plays a very important role in chemistry. Historically a
compound was said to be oxidised if it gained oxygen and reduced if it lost oxygen. The term
oxidation was later extended to include the loss of hydrogen, and reduction to include the
gain of hydrogen. However with the development of the electronic structure of the elements
the definitions were changed in order to encompass a wider range of reactions than just those
involving loss or gain of oxygen or hydrogen:
In a redox reaction one reactant called the oxidant (older term oxidising agent) oxidises a
second reactant called the reductant (older term reducing agent) and is itself reduced.
[e.g. Zn + Cu2+ → Zn2+ + Cu Zinc is the reductant and copper ions the oxidant
Cl2 + 2Br– → 2Cl– + Br2 Chlorine is the oxidant and bromide ions the reductant.]
Half-reactions: Redox reactions may be separated into two half-reactions, one involving
oxidation (loss of electrons) and the other reduction (gain of electrons).
[e.g for the above two examples: Zn → Zn2+ + 2e– oxidation
Cu + 2e → Cu
2+ –
reduction
Cl2 + 2e → 2Cl
– –
reduction
2Br– → Br2 + 2e– oxidation ]
In a balanced half-reaction equation the number of atoms of each element and the total charge
must be the same on each side of the equation.
Balanced redox equation: One in which there are no free electrons on either side of the
reaction equation. If two half-equations (one oxidation and one reduction) with different
numbers of free electrons are added to give an overall redox equation, the equations must be
multiplied by integers so that the electrons cancel on addition.
[e.g. For the reaction Zn + Ag+ → Zn2+ + Ag
Zn → Zn2+ + 2e– oxidation
Ag + e → Ag
+ –
reduction x 2 and add
Zn + 2Ag+ → Zn2+ + 2Ag ]
Rules for oxidation number (state): The oxidation number of an atom in a substance may
be determined from the following rules:
1. The oxidation number of an atom in an element is zero.
2. The oxidation number of an atom in a monoatomic ion equals the charge on the ion.
3. Oxygen has the oxidation number of -2, except in peroxides (-1) and when bound to
fluorine (+2).
4. Hydrogen has an oxidation number of +1 except in metal hydrides(-1).
5. Halogens have oxidation number -1 except in oxygen-halogen species.
6. The sum of the oxidation numbers of the atoms in a polyatomic species equals the charge
on that species.
When an atom in a species has an oxidation number x it is said to be in the x oxidation state.
The above rules, which usually give the correct number, are based on the general concept
"the oxidation number of the atom in a species is the charge it would have in the most
probable ionic formulation of that species". Putting this another way, it is assumed that all
the electrons of a particular bond reside on the atom with the greater electronegativity. So an
overall rule to determine oxidation numbers is: write the Lewis structure of the species and
count the number of valence electrons on each atom assuming the bonding electrons reside
on the more electronegative atom, and compare the number with that of the neutral atom; the
difference is the oxidation number. [e.g. HCl; H-Cl; Cl > H; H has 0 electrons; Cl has 8
12-5
valence electrons: H, +1; Cl, -1 SiH4; H-SiH3; H>Si, each H has 2 valence electrons, Si has 0
valence electrons: H, -1; Si, +4].
The concept of oxidation state plays a major role in the classification of inorganic
compounds, but understanding of its significance and usefulness comes only with experience.
A Roman numeral is often used in the name of a species to indicate the oxidation state. [e.g.
The compounds CrCl3 and Na2CrO4 are called chromium(III) chloride and sodium
tetraoxochromate(VI) respectively. See section 13.]
In redox reactions the oxidation number of an atom in the oxidant decreases, while that of an
atom in the reductant increases. [e.g. In the examples above the oxidation state of zinc has
increased from 0 to +2, that of bromine has increased from -1 to 0, that of chlorine has
decreased from 0 to -1, and that of silver has decreased from +1 to 0.]
Rules for balancing redox equations: The ability to write balanced redox equations is an
essential skill. This can be done by following a simple set of "book-keeping" rules:
1. Write down the formula for one of the reactants on the left and the formula for its product
on the right of an arrow.
2. Balance all elements other than oxygen and hydrogen.
3. Balance oxygens by adding H2O to the appropriate side.
4. Balance hydrogens by adding H+ to the appropriate side.
5. Balance charge by adding electrons to the appropriate side.
This gives a balanced half-equation. If the electrons are on the right-hand side, the
reactant is the reductant (lost electrons and therefore has been oxidised). If the
electrons are on the left-hand side the reactant is the oxidant (has gained electrons and
therefore has been reduced).
6. Repeat rules 1-5 for the other reactant.
7. Multiply the two half equations by integers so that the number of electrons shown in each
half-equation is the same.
8. Add the two half-equations, cancelling equal number of species that occur on both sides.
The result is the balanced redox equation.
A useful check when balancing redox equations is to note that the number of electrons in each
half-reaction is the same as the changes in oxidation numbers.
E. Hydrolysis
Reaction between a compound and water which results in the making or breaking of the O-H
bonds of water [e.g. the reaction of hydrogen chloride and water to give hydrochloric acid,
12-6
section 12-3]. However, the term is more commonly used for reactions resulting in the
breaking of O-H bonds of water and the formation of a bond between the O of the water and
the compound.
[ e.g. SiCl4 + 4H2O → Si(OH)4 + 4HCl
TiCl4 + 2H2O → TiO2 + 4HCl ]
EXERCISES
The following reactions can all be classified in more than one of the classes given in this section.
Give two classifications for each. The equations are not all balanced.
1. CH3CH=CH2 + H2 → CH3CH2CH3
2. 2H2O2 → O2 + 2H2O
3. SO2 + O2 → SO3
Give the oxidation number (state) of the italicised atom in each of the following species.
7. NH3 8. CaCl2 9. SO3 10. H2O2 11. ClO3– 12. Cr2O72–
Balance the following redox reactions in aqueous solution. (aq has been omitted from the
formulae for the dissolved ions.)
13. Cl2 + Fe2+ → Cl– + Fe3+
SECTION 13
In some ways the naming of inorganic compounds is quite different from those of
organic compounds. This section introduces the common everyday names of well
known inorganic compounds, and to the more formal systematic rules which have been
developed.
Inorganic compound: Compounds of elements other than carbon, but including carbon
oxides, carbonates.
The Greek and Latin prefixes given in section 6 also play an important role in inorganic
nomenclature.
Definitive rules for naming inorganic compounds have been agreed on internationally, but as
these can lead to rather clumsy names many common names for well known compounds
remain in use.
Ionic compounds are called salts except where the anion is O2− or OH− in which case the
compounds are called oxides and hydroxides respectively.
+
Some polyatomic ions have accepted non-systematic names: NH4 , ammonium; H3O+,
oxonium (hydronium) (also often just called hydrogen ion in aqueous solutions); OH−,
hydroxide; NH2−, amide; CN−, cyanide.
A brief outline of the definitive rules and traditional naming is given below. The examples
should clarify the rules.
Examples:
13-2
The traditional names for the third and fourth examples are sodium chlorate and chromic
chloride respectively. The following points concern this more traditional method of naming:
(a) The endings -ous and -ic are used for cations of elements existing in only two
oxidation states, -ous representing the lower state.
(b) The ending -ite is used to indicate the oxoanion of oxidation state lower than the
common one which ends in -ate. An even lower one is hypo.....ite, and one higher than -ate
is per.....ate.
(c) The Latin or Greek stem is used for elements whose symbols come from those
languages.
Examples:
FeCl2 is ferrous chloride FeCl3 is ferric chloride
SnCl2 is stannous chloride SnCl4 is stannic chloride
KNO2 is potassium nitrite KNO3 is potassium nitrate
Na2SO3 is sodium sulfite Na2SO4 is sodium sulfate
NH4ClO is ammonium hypochlorite NH4ClO2 is ammonium chlorite
NH4ClO3 is ammonium chlorate NH4ClO4 is ammonium perchlorate
Salts can be thought of as the product of a reaction between an acid and a base. Where the
base is an oxide or a hydroxide water is also a product.
[e.g. HNO3 + NH3 → NH4NO3 (NH4+ and NO3− )
H2SO4 + CaO → CaSO4 + H2O (Ca2+ and SO42−)
H3PO4 + 2NaOH → Na2HPO4 + 2H2O (Na+ and HPO42−) ]
The oxoacid corresponding to an -ate anion is called the -ic acid; to an -ite anion the -ous
acid. HClO is hypochlorous acid; HClO2 is chlorous acid; HClO3 is chloric acid; HClO4 is
perchloric acid. (Per is also used in two other ways; as shorthand for the peroxo group, -O-
O- and for organic compounds where all hydrogens attached to carbon have been replaced by
a halogen [e.g. perfluoroethane C2F6]. Thus one must look at the context of the term to
determine the meaning.) For salts of polyprotic acids in which the anions still have hydrogen
atoms attached, the word hydrogen is written before the anion. Thus NaH2PO4 is sodium
dihydrogenphosphate, Na2HPO4 is sodium hydrogenphosphate, and NaHCO3 is sodium
hydrogencarbonate. In the past the word hydrogen in salts of diprotic acids was often
replaced by bi- [e.g. NaHCO3 sodium bicarbonate], but it is no longer approved
nomenclature.
13-3
Most of the covalent oxides are named according to the relative number of atoms of the
element and oxygens [e.g. SO2, sulfur dioxide; SO3, sulfur trioxide; N2O3, dinitrogen
trioxide]. Oxoacids may be thought of as coming from the hydrolysis of the oxide containing
the element in the same oxidation state.
[e.g. SO2 + H2O → H2SO3 sulfur dioxide giving sulfurous acid
SO3 + H2O → H2SO4 sulfur trioxide giving sulfuric acid
N2O3 + H2O → 2HNO2 dinitrogen trioxide giving nitrous acid ]
Acid anhydride: The product from removing water from an acid. (Anhydride, a substance
formed by removing the elements of water from a compound.) [e.g. the oxides in the above
three reactions with water.]
N2O and NO, two well known oxides of nitrogen, have the common names nitrous oxide and
nitric oxide respectively. However they are not the anhydrides of nitrous acid and nitric acid.
This emphasises the point that language of chemistry has developed historically and, as in
any language, there are pitfalls for the beginner.
EXERCISES
Deduce the common names for the following compounds from the names given for related
compounds.
SECTION 14
CHEMICAL EQUILIBRIUM
Many chemical reactions do not go to completion. That is to say when the reactants are
mixed and the chemical reaction proceeds it only goes to a certain extent, and at the end
there are measurable amounts of both reactants and products present in the system. A
system is then said to be at equilibrium. A measure of how far a reaction goes is given by
its "equilibrium constant" which can have very small or very large values. This section
introduces the language used for these reactions, and some important classes.
Reversible reaction: A chemical reaction that can occur in both the forward and reverse
direction and shown by two arrows, ⇄. [e.g. PbCl2(s) ⇄ Pb2+(aq) + 2Cl–(aq) If solid
lead chloride is added to water some dissolves; if aqueous solutions of soluble lead nitrate
and soluble sodium chloride are mixed some solid lead chloride precipitates. The chemical
reaction of the lead-acid battery, see page 15-3.] It is represented in the general case by:
aA + bB ⇄ cC + dD
Chemical equilibrium: The state of a reversible chemical reaction when the rate of the
reaction in the reverse direction equals that in the forward direction; there is no change in
amounts or concentrations of reactants or products with time. As the reaction is occurring in
both directions we called it dynamic equilibrium. It requires an input of energy to change
the composition at equilibrium, i.e. to drive the reaction in the forward or reverse direction.
A reaction at equilibrium is indicated by the use of two half arrows, ⇌ as shown for the
general case:
aA + bB ⇌ cC + dD
equation. Again the square bracket notation is used for concentration. [e.g. For an aqueous
0.1 mol L-1 HCl solution, c(HCl) = 0.1 mol L-1, but the concentration of hydrogen chloride
molecules actually present in the solution, [HCl], is very low. For an aqueous 0.1 mol L-1
phosphoric acid solution, for which we would write c(H3PO4) = 0.1 mol L-1, the equilibrium
actually existing in solution is given by the equation:
H3PO4 + H2O ⇌ H2PO4– + H3O+
In this solution [H3PO4] < 0.1 mol L-1 because some of the phosphoric acid been converted to
dihydrogen phosphate. c(H3PO4) = [H3PO4] + [H2PO4–]. ]
Position of equilibrium: A qualitative expression for the relative amounts of reactants and
products present at equilibrium. The position of equilibrium may lie well to the left with only
very small but measurable amounts of products present, or well to the right with only small
but measurable amounts of reactants present, or anywhere in between. The magnitude of K is
a quantitative measure of the position of the equilibrium. If K is large, then the numerator is
much larger than the denominator, the concentration of the products is much greater than that
of the reactants, and the equilibrium lies well to the right. If K is small the equilibrium lies
well to the left, and only a small fraction of reactants are converted into products. The
14-3
magnitude of this expression remains constant whatever other species or reactions are
involved, i.e. whatever the composition of the system. [e.g. in an equimolar solution of
aqueous H3PO4 and NaOH, (i.e. one made up of equal amounts of the two reactants), almost
all the phosphoric acid reacts to give the dihydrogen phosphate anion,
H3PO4 + OH– → H2PO4– + H2O
but the equilibrium concentrations of the species in this solution still obey the nett
expression
−
[H 3 O + ][H 2 PO 4 ]
K =
[H 3 PO 4 ]
pK pK = -log10K. Many equilibrium constants have extremely small numerical values and it
is often convenient, especially in tabulation, to express them in a logarithmic form. [e.g if K
= 1.0 x 10-8, pK = 8.0; if K = 5 x 10-8, pK = 7.30]
Chemical yield: The fraction of the limiting reactant converted to required product.
Percentage chemical yield: The chemical yield x 100; a common way of expressing
chemical yield.
K's on reaction written in reverse direction. It follows from the definition of K that if the
direction of the chemical equation is reversed Kreverse = 1/Kforward.
K for overall reactions: When an overall reaction can be considered as the sum of a series of
reactions, K for the overall reaction is the product of the equilibrium constants of the
individual reactions, as can be seen for a general case:
Reaction (1) aA + bB ⇌ cC
Reaction (2) cC + dD ⇌ pP + qQ
Overall aA + bB + dD ⇌ pP + qQ
[C]c [P] p [Q]q [P] p [Q]q
K (1) x K (2) = x = = K (overall)
[A]a [B]b [C]c [D]d [A]a [B]b [D]d
It follows from the above discussion (and from the definition of K) that if the stoichiometry
of a reaction equation is altered by multiplying by 2, the value of K is squared.
(1) Solubility
Saturated solution: A solution in which the dissolved and undissolved solute are in
dynamic equilibrium, or a solution containing the maximum amount of solid under
equilibrium conditions.
Solubility constant: Symbol Ks (older term solubility product, symbol Ksp), the equilibrium
constant for the dissolution of an ionic compound in water.
(i) MX(s) ⇌ M+(aq) + X–(aq)
Ks = [M+(aq)][X–(aq)].
In this case it can be seen from the stoichiometry that:
s(MX) = [M+(aq)] = [X– (aq)] and s = Ks½ because Ks= s2.
(ii) MX2 (s) ⇌ M2+(aq) + 2X–(aq)
Here Ks = [M2+(aq)][X–(aq)]2, and s(MX2) = [M2+(aq)] = [X–(aq)]/2.
Thus Ks = s x (2s)2 = 4s3 and s = (Ks/4)
Distribution coefficient: The equilibrium for the distribution of a substance between two
immiscible liquids (i.e. liquids of low solubility in each other) A and B.
X(A) ⇌ X(B)
[X(B)]
K=
[X(A)]
or N2O4(g) ⇌ 2NO2(g)
p(NO 2 ) 2
Dissociation of N2O4. K= ]
p(N 2 O 4 )
14-5
(3) Acid-base
Acidity constant: symbol Ka, the equilibrium constant for the reaction
HA(aq) + H2O ⇌ H3O+(aq) + A–(aq)
(older term, the acid dissociation constant.):
[H O + (aq)][A − (aq)]
K a (HA) = 3
[HA(aq)]
Weak acids: Acids with small values of Ka. (Ka < 1, pKa positive, position of equilibrium
well to left, only a small fraction of acid molecules reacted.) [e.g. In 1.0 mol L-1 acetic acid,
pKa = 4.76, [CH3CO2–] = [H3O+] = 4.2 x 10-3 mol L-1, pH = 2.4.]
Strong acids: Acids with large values of Ka (Ka >> 1, pKa negative, equilibrium well to right,
almost all acid molecules reacted). [e.g. in 1.0 mol L-1 nitric acid, pKa = -1.3, [H3O+] = 1.0
mol L-1, pH = 0 ([HNO3] very small).]
Weak base: A base for which the equilibrium position for the reaction
B(aq) + H2O ⇌ BH+(aq) + OH–(aq)
lies well to the left, only a small fraction of molecules have accepted a proton from water.
Strong base: A base for which the equilibrium position for the above reaction lies well to
the right, only a small fraction of molecules remain in the solution.
Kw
It is easily shown that Kb = . Qualitatively, this expression says that the
K a (conjugate acid)
stronger an acid the weaker its conjugate base. Strong acids have very weak conjugate bases and
very weak acids have strong conjugate bases. [e.g. HNO3 is a strong acid, (pKa –1.3), NO3– is a
very very weak base; HS– is a very weak acid (pKa 19), S2– is a strong base.] Tables of Kb are
unnecessary, tables of Ka or pKa of the corresponding conjugate acids being sufficient to state
base strength. For an acid HA, where pKa(HA) = 7, pKb(A–) is also 7, and it can be said that the
strengths of the acid and its conjugate base are the same.
Polyprotic acids and bases: Acids with two, three or more hydrogens which can undergo
proton transfer. Polyprotic acids can be diprotic, triprotic etc. [e.g. H2SO4- diprotic; H3PO4 -
triprotic] Similarly bases which can accept more than one proton are said to be polyprotic
bases. [e.g. S2–- diprotic; PO43–- triprotic] For polyprotic acids successive acidity constants
can be written [e.g. for phosphoric acid:
H3PO4 + H2O ⇌ H2PO4– + H3O+ K = K1(H3PO4)
H2PO4– + H2O ⇌ HPO42– + H3O+ K = K2(H3PO4)
HPO42– + H2O ⇌ PO43– + H3O+ K = K3(H3PO4)
Buffer solution: A solution which is resistant to change in pH (when small amounts of acid
or base are added or it is diluted). A buffer solution contains significant amounts of both an
acid and its conjugate base. If H3O+ is added to or produced in the solution, it is removed by
reaction with the base. Like wise any OH– is removed by reaction with the conjugate acid:
H3O+ + A– ⇌ HA + H2O
OH– + HA ⇌ A– + H2O
It can be seen from the expression of Ka(HA) that if a buffer solution is made up with
equimolar amounts of HA and A- that the pH of the solution is equal to the pKa(HA) of the
acid. The pH of a buffer solution can be controlled by taking the appropriate amounts of HA
and A–.
Brønsted acid: A proton donor; the molecule or ion must contain H [e.g. HCl and all the
acids above in this section]. (See page 12-3)
Brønsted base: A proton acceptor; the molecule or ion must have a pair of non-bonding
electrons to form a bond with a proton [e.g. :NH3 and all the bases above in this section].
(See page 12-3)
Lewis acid: A species (molecule or ion) which can accept a pair of electrons from a base and
form a bond. This is a broader definition of an acid [e.g. carbon dioxide in its reaction with
the hydroxide ion to give the hydrogencarbonate ion: CO2 + OH– → HCO3– ].
A proton is a Lewis acid by this definition.
Lewis base: An electron pair donor. [e.g. the hydroxide ion in the above example] Brönsted
bases are also Lewis bases as they donate a pair of electrons to the proton.
Complex ion: An ionic species consisting of ligands (Lewis bases) (page 13-1) bonded to a
metal cation (which is acting as a Lewis acid) [e.g. Cu(NH3)42+; CrCl63–]. The ligands may
14-7
Stability constant (Formation constant): The equilibrium constant for the overall reaction
between the aquated metal cation and the free ligands to form the complex ion. [e.g
Cu2+(aq) + 4NH3 ⇌ Cu(NH3)42+
2+
[Cu(NH 3 ) 4 ]
Kf = ]
[Cu 2+ (aq)][NH 3 ] 4
Note: The formal convention for arrows in chemical equations is that → represents a
reaction in the forward direction, ⇄ represents a reversible reaction, and ⇌ represents
a reaction at equilibrium.
.
EXERCISES
Write the expression for the equilibrium constant for the following reactions.
9. AgBr, pKs = 12.3 10. CaCO3, pKs = 8.48 11. PbI2, pKs = 8.10
12. [H3O+] = 1.0 x 10-3 mol L-1 13. [H3O+] = 2.4 x 10-4 mol L-1
14. [OH–] = 1.0 x 10-3 mol L-1 15. [OH–] = 2.4 x 10-4 mol L-1
16. A buffer solution was made up with H2PO4– and HPO42–. Calculate the pH of the
solution (i) when equimolar amounts 0f each ion are used, and (ii) when the amount
of H2PO4– is twice that of HPO42–. pK2(H3PO4) = 7.20
SECTION 15
ELECTROCHEMISTRY
Some systems involving redox reactions can be designed so that the reactants (and
products) are partially separated from each other, and the reaction leads to an electric
current being produced in an external circuit, and which can be used for many useful
purposes. Batteries and their many uses are the obvious examples. Electrical energy can
also be used to drive non-spontaneous chemical reactions to produce desired products in
processes known as electrolysis. This section introduces the language and concepts of
these processes collectively known as electrochemistry.
Electrochemistry: The branch of chemistry that covers the relative strengths of oxidants and
reductants, the production of electric current from chemical reactions, and the use of
electricity to produce chemical change.
Electrolyte: A medium (phase) which conducts electricity by the movement of ions [e.g. a
molten salt] or a substance which dissolves in a solvent to give a conducting solution [e.g.
aqueous sodium chloride, NaCl or any other soluble ionic compound].
Redox couple: The two species of a half- reaction involving oxidation or reduction. (See
page 12-3.) Represented as oxidised species/reduced species [e.g. Cu2+/Cu; Cl2/Cl–;
Fe3+/Fe2+].
Half-cell: An electrode and the couple it is in contact with [e.g. Zn(s) |Zn2+(aq), a zinc rod
in contact with an aqueous solution containing zinc cations; Fe3+(aq),Fe2+(aq)|Pt, a platinum
rod in contact with an aqueous solution containing ferric and ferrous ions ]. The electrode
may be one of the species of the couple or an inert species [e.g. zinc and platinum
respectively above]. The vertical line represents a phase boundary.
Galvanic cell: an electrochemical cell that produces electricity from a chemical reaction. It
consists of two half-cells connected by a junction [e.g. a membrane (diaphragm) or salt
bridge] allowing ions to be transferred between the electrolytes of the two half-cells. When
the electrodes are connected externally by a conductor electrons flow through the conductor
from the negative electrode to the positive electrode. It is normally represented by two half-
cells separated by a double vertical line representing the junction allowing transfer of ions.
[e.g. Zn(s)|Zn2+(aq)||Cu2+(aq)|Cu(s) or more simply as Zn|Zn2+||Cu2+|Cu if it is clear from the
context that aqueous solutions are involved. ]
Cell potential or electromotive force: symbol E, the electric potential difference between
the electrodes of a galvanic cell when no current is flowing. In the above representation of a
galvanic cell it is the electrode potential of the right hand electrode minus the electrode
15-2
potential of the left hand electrode. It is normal to show the negative electrode on the left
and the positive electrode on the right and thus express the cell potential as a positive
quantity. The SI unit of E is the volt, symbol V.
Standard hydrogen electrode: symbol she, a reference electrode defined as having zero
electrode potential. It consists of a platinum electrode in contact with gaseous dihydrogen
and aqueous hydronium ions under defined conditions.
Electrode potential (of a couple): symbol E(oxidised form/reduced form), also called
reduction potential or redox potential is the electrode potential of that couple relative to
the standard hydrogen electrode. More precisely it is the cell potential of a galvanic cell in
which one half-cell is the standard hydrogen electrode, and is negative if the electrode of the
couple is the negative electrode of that cell and positive if the electrode is the positive
electrode of that cell [e.g. E(Cu2+/Cu = 0.34 V; E(Zn2+/Zn) = -0.76 V; E(Cl2/Cl–) = 1.40 V ].
Strong oxidant: An oxidant of a redox couple with a large positive redox potential [e.g. F2,
E(F2/F–) = 2.9 V; Cr2O72–, E(Cr2O72–/Cr3+) 1.4 V. The half-reaction corresponding to this
couple in aqueous solution is that given on page 12-5,
14H+ + Cr2O72– + 6e– → 2Cr3+ + 7H2O ].
Strong reductant: a reductant of a redox couple with a large negative redox potential
[e.g. Na, E(Na+/Na) = -2.7 V].
Table of electrode potentials: A table listing the electrode potentials of redox couples. As
electrons flow spontaneously from the negative to the positive electrode the electrode
potentials can be used to deduce the direction of a redox reaction. [e.g. Can Cl2 oxidise
copper, Cu? Since this reaction would involve flow of electrons from Cu to Cl2 it can be
seen from the electrode potentials above that the redox reaction can occur as E(Cu2+/Cu) is
negative with respect to E(Cl2/Cl–). A table in which the electrode potentials increase down
the table (most negative at the top and most positive at the bottom) can be regarded as an
energy diagram. A spontaneous reaction involving two couples will be that in which
electrons lose energy by moving from a reductant of one couple to the oxidant of another
couple below it in the table.
[e.g. Couple E/V
2+
Zn /Zn -0.76
Cu2+/Cu 0.34
–
Cl2/Cl 1.40
Electrons can flow from Zn to Cu2+ but not from Cu to Zn2+. Thus zinc metal can reduce copper
ions to copper metal but copper metal cannot reduce zinc ions to zinc metal. ]
Cell reaction: The overall chemical redox reaction occurring in the cell. What distinguishes
a cell reaction from a general redox reaction is that the reactants are physically separated in
the cell and the processes of oxidation and reduction are accompanied by electron flow in an
external conductor [e.g. for the cell Zn2+|Zn||Cu2+|Cu the half-reactions will be:
Zn → Zn2+ + 2e! (as the zinc electrode is negative)
and Cu2+ + 2e– → Cu (as copper is the positive electrode)
15-3
Electrolysis: the use of electric current to drive chemical reactions. Electrical energy is
converted into potential chemical energy, and the non-spontaneous reaction is forced to
occur.
Anode: the electrode at which a species is oxidised. Thus for a galvanic cell it is the
negative electrode, and for an electrolysis cell it is the electrode connected to the positive
side of the power supply.
Cathode: the electrode at which a species is reduced. Thus for a galvanic cell it is the
positive electrode, and for an electrolysis cell it is the electrode connected to the negative
side of the power supply.
Reversible galvanic cell: a cell in which the direction of the cell reaction can be reversed by
electrolysis [e.g. the common car battery (lead-acid battery)
-ve Pb,Sb | Pb | PbSO4(s) |H2SO4(aq) | PbSO4(s) | PbO2 | Pb,Sb +ve
Pb,Sb represents the electrodes, a grid made of an alloy which supports the reductant, Pb, and
the oxidant, PbO2. To recharge the battery electrons are pushed into the left-hand electrode
and sucked out of the right-hand electrode by applying an external power supply].
Faraday's laws of electrochemistry: The 1st law states that the mass of the substance being
oxidised or reduced is proportional to the charge passed. The 2nd law states that this mass is
directly proportional to the molar mass of the substance and inversely proportional to its
15-4
change in oxidation state, z. Combining these laws the charge passed, Q ∝ zm/M (Q ∝ zn),
i.e. Q = znF where Q is the charge passed, n is the amount of substance oxidised or reduced
and F is the proportionality constant, called the Faraday constant.
When z = 1 and n = 1 mol, Q = 1 mol x F = F mol, i.e. the Faraday constant is the charge per
mole of electrons.
Faraday constant: symbol F, the molar electric charge, i.e. the charge per mole of electrons,
96 485 C mol-1.
EXERCISES
1. Deduce which of the following species is the strongest oxidant: I2, Ag+, Sn2+, O2
2. Deduce which of the following species is the strongest reductant: Cl–, Sn, Ag, Fe2+
Write the cell, the chemical equation for the overall cell reaction and determine the cell potential
for a galvanic cell made from the redox couples:
Predict whether
SECTION 16
Some reactions appear to occur instantaneously on mixing the reactants; that is to say too
fast to follow by eye. Others are much slower and they can be followed over seconds,
minutes or hours. The study of how fast reactions occur, i.e. the study of reaction rate, is
known as kinetics, and the specific language and concepts which have been developed are
introduced in this section. Studies of how the rate of a reaction depends on the
concentrations of reactants, and sometimes products, have provided evidence for how an
overall reaction proceeds, i.e. what we call the mechanism of a reaction. This section
also introduces some basic classes of reaction mechanism which are widely used in
describing and understanding chemical reactions.
Chemical kinetics (kinetics): The study of the rates of chemical reactions and the steps by
which they occur.
Some chemical reactions are very fast and appear instantaneous to the eye on mixing the
reactants, while others are very slow and the products only form over minutes, hours or even
longer.
Reaction rate: The change in concentration of a reactant or product divided by the time it
takes for the change to occur. Common units are mol L-1 s -1.
[e.g. for the reaction between potassium permanganate and oxalic acid,
6H+ + 2MnO4– + 5H2C2O4 → 2Mn2+ + 10CO2 + 8H2O
the decrease in concentration of permanganate over 40 s was found to be 0.12 mol L-1 Thus
the average change in concentration over this period was ∆[MnO4–]/t = -0.12 mol L-1/40 s and
the reaction rate could be expressed as the rate of loss of MnO4– = 3.0 x 10-3 mol L-1 s-1. The
rate of this reaction could also have been expressed as the rate of loss of H2C2O4 (7.5 x 10-3
mol L-1 s-1) or as the rate of formation of CO2 (1.5 x 10-2 mol L-1 s -1).] In this example the
numerical value of the rate depends on which reactant or product concentration is being
measured. To overcome this it is possible to express the rate of reaction defined by its
chemical equation.
Elementary reaction: A one step reaction. There are three classes of elementary reaction.
Bimolecular reaction: An elementary reaction involving only two particles (the most
common type). The particles may be the same or different
[e.g. 2Br·(aq) → Br2(aq) or HF(aq) + NH3(aq) → F–(aq ) + NH4+(aq)]
16-2
Reaction intermediate: A species produced in one step of a chemical reaction but which is
consumed in a later step. It is not a product of the overall reaction, and hence does not appear
in the overall equation.
Rate-determining step: The slowest elementary step which effectively determines the
overall rate of a reaction.
Rate equation (law): An equation relating the instantaneous rate of the reaction to the
concentrations of reactants, products, or any other permanent species (such as catalysts)
taking part in the reaction at that instance
[e.g. for the reaction H2O2(aq) + 2H+(aq) + 2I– (aq) → I2(aq) + 2H2O at pH of 7 the
rate law is found by experiment to be: v = k[H2O2][I–]
Rate coefficient (constant): Constant of proportionality in a rate law [e.g. k in the above
rate law].
Reaction order: (a) With respect to a single species - the power to which the concentration
of a single species is raised in a rate law [e.g. the above reaction is first-order in H2O2 and
first-order in I–]. (b) Overall - the sum of the powers of the species in the rate law [e.g. the
above reaction is second-order overall. k is a second-order rate constant].
For a reaction between two species to occur they must collide, and most reactions take place
in a series of bimolecular collisions, i.e by a series of bimolecular elementary steps. If the
step involves two different species, A and B, the rate of collision, and therefore the rate of
reaction, is proportional to the concentrations of A and B. Thus for the elementary
bimolecular reaction
A + B → C + D
rate of reaction = k[A][B] where k is called a bimolecular rate constant. A bimolecular rate
constant is clearly 2nd order rate constant. For elementary reactions the order of the reactions
are the same as the molecularity. As the units for rate of reaction are mol L-1 s-1 it follows
from the rate laws that the units of 1st order, 2nd order and 3rd order rate constants are
respectively s-1, L mol-1 s -1 and L2 mol-2 s-1.
As bonds are often broken in elementary reactions not all collisions between reactant species
lead to reaction, only those which collide with sufficient energy to overcome the activation
energy barrier.
16-3
Activation energy: Symbol Ea. The minimum energy needed for colliding species to react,
or cross the barrier. The magnitude of k depends on the height of the barrier, i.e. on the
activation energy. The greater the Ea, the smaller the k, and the slower the reaction. The
activation energy, Ea, is determined form an Arrhenius plot.
Arrhenius plot: A plot of ln k or ln rate against 1/T where T is the absolute temperature
(temperature in kelvin). The slope of an Arrhenius plot equals -Ea/R where R is the universal gas
constant. This follows from the Arrhenius equation.
The kinetic energy of molecules, and hence the fraction of collisions with energy in excess of
Ea increases with increasing temperature. Therefore the rate of a reaction, and the magnitude
of k, increase with temperature. The greater the Ea, the more sensitive the rate and rate
constant to changes in temperature.
Unlike equilibrium constant expressions, the rate law for a reaction cannot be derived from
inspection of the overall chemical equation but must be determined experimentally. Only for
elementary reactions (i.e. one step reactions) can the rate law be deduced directly from the
equation (as explained above).
Information on reaction mechanisms can be obtained from experimentally obtained rate laws.
While a rate law for a reaction can be derived for a postulated mechanism (because the rate
law for each elementary step can be written), agreement between the experimental rate law
and postulated mechanism does not prove the mechanism. Different mechanisms can lead to
the same rate law.
Half-life: Symbol t½, the time for the amount of a reactant in limiting amount (i.e. not in excess)
to fall to half its original value. Commonly applied to radioactive isotopes [e.g. the half-life of
cobalt-60, 60Co, is 5.3 years].
Mean life-time: Symbol τ, the time for the amount of a reactant in limiting amount (i.e. not
in excess) to fall to 0.368 (=1/e) of its original value. This is the average time a molecule
must wait before undergoing reaction.
Chain length: The average number of propagating cycles between initiation and termination.
Catalyst: A substance which increases the rate of a reaction without being consumed in the
overall reaction. It provides an alternative pathway or mechanism which increases the rate of
the overall reaction. The catalyst is involved in the new pathway but if it is consumed in one
step it is regenerated in a later step.
Homogeneous catalysis: The catalyst is in the same phase as the reactants [e.g. sulfuric acid
in the esterification of an organic acid and alcohol ].
Heterogeneous catalysis: The catalyst is in a different phase from the reactants. A solid
catalyst adsorbs reacting species onto its surface where the reaction takes place [e.g solid
V2O5 in the reaction of gaseous SO2 and O2 to form SO3 ].
Nucleophile: A chemical species seeking a nucleus with which to form a bond. To do this
the species must have a pair of non-bonding electrons available to form a bond.
A nucleophile is also a Lewis base.
Lewis base: An electron pair donor in a chemical reaction (see page 14-6).
Electrophile: A chemical species seeking a pair of electrons on a second species with which
to form a bond. An electrophile is also a Lewis acid.
Lewis acid: An electron pair acceptor in a chemical reaction (see page 14-6).
Free-radical: A chemical species with an unpaired valence electron seeking an electron with
which to form a bond. (see page 1-4)
Carbocation: A trivalent species with a positive charge, an electrophile and a Lewis acid
[e.g. (CH3)3C+, the positive carbon having only six valence electrons].
The mechanistic classification is combined with the structural classification and may include
the reaction order (1st or 2nd) of the rate-determining elementary step and further
information on the substrate. [e.g. CH3Cl + I– → CH3I + Cl– nucleophilic substitution
second order, SN2, (nucleophilic attack of iodide ion on carbon replacing chlorine in one step,
synchronous making and breaking of bonds)].
In representing details of bond breaking and making electron movement is shown using a
"curly arrow", for electrons moving as pairs, and for electrons moving singly. The
tail of the arrow is close to the electron(s) moving and the head shows where they are moving
16-5
Heterolytic bond breaking or making: The pair of electrons of a bond move together
[e.g. breaking (CH3)3C-Br → (CH3)3C+ + Br–
making and breaking I: – + CH3-Cl → I-CH3 + :Cl– ].
Homolytic bond breaking: Electrons of a bond divide evenly to give two free-radicals
[e.g. CH3O-OC2H5 → CH3O· + ·OC2H5 ].
Homolytic bond making: Pairing of an unpaired electron with a second electron from a
bond of the substrate to form a new bond and a new radical; or dimerisation of two radicals to
give a molecule [e.g. Cl· + CH2=CH2 → Cl-CH2-CH2· or Br· + ·Br → Br2 ]
Full reaction schemes showing electron movement are given in the examples of mechanisms
below. Note how it is not necessary to show non-bonding electron pairs. The tail of the
curly arrow implies the presence of an electron pair.
(i) Nucleophilic substitution second order, SN2 [e.g CH3Cl + I– → CH3I + Cl– ]
(Nucleophilic attack of iodide ion on carbon replacing chlorine in one step,
synchronous making and breaking of bonds.)
H H
(ii)
I- + Cl -
C C
H Cl H
I
H H
(CH3)3C Br (CH3)3C+ + Br -
H
(CH3)3C+ :OH2 (CH3)3C O+
H
H
(CH3)3C O+ :OH2 (CH3)3COH + H3O+
H
H
CH3 H CH3
+
C C C C H + Cl -
H
H H
H
H Cl
CH3 CH3
+
C CH3 H C CH3
H Cl-
Cl
CH3 Br
CH3 H
CH3 C C H C C + H 2O + Br -
H
H H CH3
-OH
O O:-
O +N
N + H
+
O
NO2
- NO2
H O NO2
+ HNO 3
+
Note that the hydrogens are not shown on benzene itself, but when addition to a carbon atom
occurs, the H atom on that carbon is shown.
16-7
.
Cl. CH2 CH2 Cl CH2 CH2
.
CH2 H .Cl CH2 + H Cl
Note:
(1) that electron pairs and H atoms are not necessarily shown. They can be implied from the
symbolism, or from the number of valence electrons in the structure shown.
(2) how important it is to do "electron book-keeping", and show formal charge.
EXERCISES
1. Calculate the average rate of the following reactions in units of mol L-1 s-1 from the
given concentration changes.
2. The bimolecular reaction H3O+ + OH– → 2H2O is one of the fastest known with
a bimolecular rate constant of 1.0 x 1011 L mol-1 s-1. Calculate the rate of the reaction
when equal volumes of 0.10 mol L-1 solutions of hydrochloric acid and sodium
hydroxide are mixed. Remember that on mixing the two solutions the concentration of
each reactant is changed.
3. The reaction in question 1(a) is an electrophilic addition and occurs in two steps. In
the first slow step a bromine atom becomes attached to C1 and a bromide ion is
formed. In the second step the bromide ion adds to the bromo-carbocation
intermediate. Show the mechanism using curly arrows, and give the rate law.
4. Give a structural and mechanistic classification of the reaction between toluene and
bromine given as an example of a chain reaction on page 16-3.
Ans-1
ANSWERS TO EXERCISES
1-2. potassium, K, 20 1-3. copper, Cu, 36 1-4. radon, Rn, 136 1-7. C2H4O2
1-8. C2H5O2N 1-9. C6H12O4N2S2 1-10. KBr 1-11. NH4NO3
1-12. Mg(NO3)2 1-13. Al2(SO4)3
F H O O O O
F C F S S
H N H
F O O
H
O O N
N H N H
O O
O H
H H H H H
C H C C C Cl
N N O N N O
O H H H
HH H H H H H H
H H H
C C C H H C C O O C H H C C O C H
C H
H H C C
H H H H O H
O H H
5-15.
H H H H
H C C C C H
H Br H H
The non-bonding electrons on oxygen in answers to 5-16 - 5-18 are not shown.
5-16. 5-17.
H H H H Cl H
H O C C C H F C C C C O H
H H O H H O H
H
5-18.
H H H H H
I C C C C C C C C H
H H H O H N H
H
6-7. CH3CH2CH(OH)CH2CH(CH2CH2CH3)C(=O)OH
6-8. CH3CH2CH2CH2CH2CH2CH2CH2C(=O)NH2
6-9. HC(=O)NHCH2CH3
6-10. (5-9) methanal 6-11. 1-chloropropane 6-12. propanone 6.13. propene
6.14. ethyl methyl peroxide 6-15. methyl ethanoate 6-16. 2-bromobutane
6-17. 3-hydroxypropanal 6-18. 2-chloro-4-fluorobutan-1,2-diol
7-2. 5.0 x 10-2 m s-1 7-3. 6.4 x 1011 N m-2 7-4. 2.8 x 10-3 g L-1 7-6. t = 2.3 x 103 s
7-7. p = 7.8 x 10-5 Pa 7-9. 300 K 7-10. 1.15 x 105 s 7-11. 8.13 x 103 Pa
7-12. 5.45 x 102 kg m-3
8-2. 0.227 mol 8-3. 960 mol 8-4. 209 nmol 8-5. 540 g 8-6. 836 g 8-7. 1.79 g
8-8. 42 g 8-9. 17.4 kg 8-10. 306 t 8-11. 512 g
9-1. 32.5 L 9-2. 153 ng 9-3. 62 MPa 9-4. 168 kPa 9-5. 172 kPa
10-1. 200 g L-1 0.584 mol L-1 10-2. 0. 486 g L-1 8.36 x 10-3 mol L-1
10-3. 52.34 g L-1 0.4151 mol L-1 10-4. 0.4483 mol L-1 10-5. 92.7
10.6 cf(KIO3) = 0.02219 mol L-1 c(Na2S2O3) = 0.1417 mol L-1 c(Cl2) = 17.4 g L-1
10-7. 6.03 x 10-5 mol L-1 0.565 g
11-1. 4.184 J g-1 K-1 1.00 cal g-1 K-1 75.4 J mol-1 K-1
11-2. 43.0 kJ mol-1 11-3. -298 kJ mol-1 11-4.(i) CS2(l) + 3O2(g) → CO2(g) + 2SO2(g)
(ii) 90.0 kJ mol-1 11-5. -101 kJ mol-1
2+ 2- [H 3 O + (aq)][F − (aq)]
14-3. [Ba (aq)][SO4 (aq)] 14-4. [O2(g)] 14-5.
[HF(aq)]
+ 2−
[CH 3 NH 3 (aq)][OH − (aq)] [CO 3 (aq)][H 3 O + (aq)]
14-6. 14-7. −
[CH 3 NH 2 (aq)] [HCO 3 (aq)]
−
[HCO 3 (aq)][OH − (aq)]
14-8. 2−
14-9. 7.08 x 10-8 mol L-1
[CO 3 (aq)]
14-10. 5.75 x 10-5 mol L-1 14-11. 1.26 x 10-3 mol L-1 14-12. 3.00 14-13. 3.62
14-14. 11.00 14-15. 10.38 14-16. (i) 7.20 (ii) 6.90 14-17. 6.00 14-18. 7.25
Ans-4
16-1. (a) 1.0 x 10-3 mol L-1 s-1 (b) 2.3 x 10-5 mol L-1 s-1 16-2. 2.5 x 108 mol L-1 s-1
16-3.
CH3 H CH3 H Br H
C C C C H CH3 C C H
H H H Br H Br
Br Br Br