Академический Документы
Профессиональный Документы
Культура Документы
Chemical formula is derived either from the ions or for non-metal compounds a
description within the name
Ions are combined to cancel out overall charge subscriptions indicate multiples for an ion.
Polyatomic ions are put into brackets
Equation
An equation shows the path of a chemical reaction. It consists of reactants going to
products. When writing equations the correct formula is written and then it is balanced
with mole coefficients. There are a number of common reaction types:
1. - Acids + Base Salt + Water
- Bases are -Hydroxides/-Oxides
2. Acids + Carbonates Salt + Water + Carbon Dioxide
3. Acid + Metal Metal Salt + Hydrogen
4. Reactions with Oxygen Oxides/Hydrocarbon + O2 + CO2 + H2O
Matter
- Matter consists of atoms/particles that fill and available space
- There is no matter in a vacuum
- Matter can divide into: - Mixtures: Combinations of particles that are not
chemically joined
- Pure Substances: Made up of only a single type of
particles: - Elements
- Compounds
States
Matter can exist in three main states (phases): - Solids (s)
- Liquid (aq)
- Gases (g)
At an atomic level energy (heat) and movement are proportional. ie more heat More
movement. As a substance is heated the temperature raises then stops at its melting point
as the energy is used to overcome the force between particles once liquid its temperature
increases again
Properties
Properties are specific attributes for a compound physical propertied include:
- State and Density
- Operative including colour, size, etc.
- Conductivity
- Melting Point (mp) Boiling Point (bp)
- Solubility
Chemical properties include how a substance reacts with common chemicals such as:
- Oxygen, Acids, Bases, Oxidants and Reactants
Separations of Mixtures
A mixture of substance can be ‘easily’ separated by physical means. By using differences
in physical properties of the components they can be separated.
Separation Techniques:
- Filtering insoluble particles trapped in filter paper
- Decanting - Careful pouring off top liquid layer from two different density
substances
- Dissolving - separate soluble from insoluble substances
- Evaporating/Boiling/Crystallization where a soluble solid is recovered by
evaporating the solvent liquid
- Distillation - Used to separate liquid of different boiling points
- The lower boiling point (bp) fraction is evaporated out of the
solution and condensed to recover it
- Centrifuging - Use mass differences in a spinning machine (with centrifugal
force) to separate the heaviest components to the bottom
- Chromatography - Use differences in solubility to separate a mixture in a
moving solvent
Atomic Structure
Atoms make up all things they are tiny indivisible particles consisting of a central nucleus
of protons and neutrons, surrounded by negative electrons arranged in shells
The periodic table tells us information for each element (type of atom)
- Atomic number = # of Protons
- Mass number = # of Protons + # of Neutrons
- # of Electrons = # of Protons
Each shell corresponds to a period on the periodic table. The notation used is element
symbol ten the number of electrons in each shell:
Eg. H: 1
He: 2
O: 2,6
Mg: 2,8,2
K: 2,8,8,1
Ca: 2,8,8,2
Ions
An ion is a particle that has lost or gained electrons to become charged positive ions are
cations, negative ions are anions. Simple monatomic ions form from elements losing or
gaining elections to achieve the stability of a complete outer shell thus, noble gasses do
not form ions. Metals lose elections to become cations. Non-metals gain electrons to
become anions.
2. Ionic Bonding:
Occurs between metal and non-metal elements. Electrons are transferred
from metals forming cations to non-metals forming anions. Then a 3D
network of oppositely charged ions with strong electrostatic attraction
forms
Ionic Compound properties:
- High melting and boiling points due to 3D network lattice structure, it
requires high energy to overcome the electrostatic attractions surrounding
an ion. Eg. NaCl = 801°c
- Do not conduct as solids, but do as liquids/molten or aqueous solutions
as the ions are free to move and carry charge.
- Hard but brittle substance due to lattice imperfections creating cleavage
planes
3. Covalent Bonding
This occurs between non-metal elements and involves sharing electrons to
enable atoms to have access to a full valence shell for stability
Covalent Bonding can form two different types of substances:
1. Network or extended lattice structures:
- Strong bonds in 2 or 3 dimensions
- Very strong, high melting and boiling points, hard
substances
- Insoluble and usually do not conduct (except
graphite)
2. Covalent Molecules
Covalent bonding can form individual discrete molecules. These
can be non-polar or polar
Non-Polar Bonding:
As a Substance:
- Very weak force between non-polar molecules
- Very low melting and boiling points due to weak
forces
- Non-conductors - no free ions or electrons to
carry charge
- Insoluble and immiscible in water
- Individual discrete molecules up of a few covalently
bonded atoms
Polar Molecules:
When two different elements covalently bond, the difference in
electronegativity causes an unequal sharing of bonding electrons,
so a polar bond
Electronegativity - an atom’s ability to attract and hold electron
from a bond
A polar bond can create a polar molecule. However, several polar
bonds may cancel out in a symmetrical molecule to make the
overall non-polar
- Melting and boiling points rose due to increased attractions
- Small molecules are weakly soluble
Lewis Diagrams
Lewis or Electron Dot Diagrams show how a molecule is bonded and can be used to a
certain shape
- Only show valence electrons
To Draw:
1. Put elements with the least number of electrons in the centre
2. Draw valence electrons on each four points of compass, single then
pairs
3. Form bonding pairs from leftover single electrons
4. Resolve diagram for neatness and even spacing between bonds and lone
electron pairs, and check for octet rule:
- elements need 8 electrons except Hydrogen
Types of Reactions
There are four types of chemical reactions:
- Precipitation
- Decomposition
- Oxidation - Reduction (Redox)
- Neutralization (Acid-Base)
Eg. Acid + - Hydroxide
- Oxide
- Carbonate
Precipitation (ppt)
A precipitation is a solid that is formed from a reaction of two aqueous solutions. Things
form a precipitation if a product from a reaction is insoluble.
Solubility Rules:
1. All group 1 (Na+, K+, Li+), Nitrate (NO3-) and Ammonium (NH4+) compounds
are soluble
2. All Chlorides are soluble, except for Silver Chloride (AgCl) and Lead Chloride
(PbCl2+)
3. All Sulfates are soluble, except for Barium Sulfate (BaSO4), Lead Sulfate
(PbSO4) and Calcium Sulfate (CaSO4)
4. All Carbonates are insoluble except for ones in Rule 1
5. All Hydroxides are insoluble except for ones in Rule 1
Precipitation Equation
The precipitate that forms from mixing two solution is the reaction that occurring. The
other ions are spectator ions - they are not involved therefore an ionic equation is written
that omits spectators.
Eg. NiCl2(aq) + 2KOH(aq) 2KCl(aq) + Ni(OH)2(s)
2+
Ni (aq) + 2OH(aq) Ni(OH)2(s)
Complexes
Complexes are soluble ions made from addition of excess of a reagent (chemicals). They
are used of for confirmation testing of unknown ions
Complex ions to remember:
1. [Cu(NH3)4]2+ Copper tetra amine - Royal Blue
2. [Zn(OH)4]2+ Zincate - Colourless
2+
3. [Zn(NH3)4] Zinc tetra amine - Colourless
4. [Al(OH)4] Aluminate - Colourless
2+
5. [FeSCN] Iron (III) Thioscyanate - Blood Red
Unknown Identification
Solutions where the ions are unknown can be identified using precipitation reactions.
Each cations and anion must be identified separately. To bring about known, precipitation
reactions reagents are used.
Common Reactions:
- Sodium Hydroxide - Forms characteristic coloured precipitations
- Some complexes with cations
- Ammonia Solution - For making amino complexes for confirmation
- Barium Nitrate/Chloride - Identify Sulfates
- Silver Nitrate - Identify Chlorides
- Dilute Acid (HNO3) - Identify Carbonates
Decomposition (Thermal)
Decomposition is when one compound breaks into several compounds
Thermal decomposition is when this process occurs during heating. The products of
decomposition depend upon what it is
Types:
Metal Carbonate:
Forms CO2 + Metal Oxide Products
Eg. CaCO3 CO2 + CaO
MgCO3 CO2 + MgO
Na2CO3 CO2 + Na2O
The limewater test confirms CO2
Metal Hydroxide:
These decompose to form the Metal Oxide + H2O
Eg. Mg(OH)2 MgO + H2O
2NaOH Na2O + H2O
Metal Sulfates:
Decompose to form Metal Oxide and Sulfur Dioxide (which
usually gets further oxides to form Sulfur Trioxide)
Eg. MgSO4 MgO + SO2
The Mole
In chemistry very large amounts of particles are reacting are in a given reaction. Even
very accurate balances (scales) will be weighing trillions of atoms. The mole is a name
given to a large quantity of 6.023x1023 =1mol (Avogadro’s Number)
To relate to mass the relative Atomic masses (Ar) or Molar masses (M) on the periodic
table become 1mole of an element
For compounds the molar mass of molecular mass must be found first by summing all the
masses for each element
M(CO2) = 12 + 2(16) = 44
M(Fe) =55.5
Mole Calculations
The relationship between molar mass (M), mass (m) and number of moles or amount of a
substance (n) are:
M Molar mass (gmol-1) M=m/n
m Mass in grams (g) m=Mxn
n Number of moles in mol n=m/M
1.6g of SO2
n(SO2)=m/M=4.2/136.4 =0.0308
2. Use the equation’s mole ratio to fin the number moles for unknown n(unknown)
n(MgSO4)=n(Mg)=0.708mol
What mass of Sulfuric Acid is required to make 27.4g of Zinc Sulfate from Zinc Metal
H2SO4 + Zn ZnSO4 + H2
1. n(ZnSO4)=m/M=27.4/161.4=0.170mol
2. n(H2SO4)=n(ZnSO4)=0.170mol
3. m(H2SO4)=nxM=0.170x98.1=16.7g
C + O2 CO2
1. n(C)=m/M=11.3/12=0.942mol
2. n(CO2)=n(C)=0.942mol
3. m(CO2)=nxM=0.942x44=41.4g
1. n(NaCHO3)=m/M=246/84=0.293mol
2. n(HCl)=n(NaCHO3)=0.293mol
3. m(HCl)=nxM=0.2293x36.5=10.7g (3sf)
Non 1:1 Ratios
When the mole ratio in question is not 1:1 we multiply the n(known) by unknown/known
mole ratio in Step 2
Eg. What mass of Magnesium will react with 14.3g of Hydrochloric Acid
Mg + 2HCl MgCl2 + H2
1. n(known)
n(HCl)=m/M=14.3/36.5=0.392mol
2. n(unknown) from the equation ratio
n(Mg)=1/2xn(HCl)=1/2x0.392=0.196mol
3. m(unknown)=nxM=0.196x24.3=4.76g (3sf)
1. n(Na2SO4)=m/M=8.63/142=0.0608mol
2. n(Na)=2/1xn(H2SO4)=2x0.0608=0.122mol
3. m(unknown)=nxM=1.22x23=2.80g (3sf)
What mass of Carbon Dioxide is produced from 1.63g of Nitric Acid with
Magnesium Carbonate
1. n(HNO3)=m/M=1.63/63= 0.026mol
2. n(CO3)=1/2xn(HNO3)=1/2x0.026=0.0129mol
3. m(unknown)=nxM=0.0129x44=0.569g (3sf)
What mass of Iron (III) Oxide is required to react with 186g of Hydrochloric Acid
1. n(HCl)=m/M=186/36.5=5.10mol
2. n(Fe2O3)=1/6xn(HCl)=1/6x5.10=0.8493mol
3. m(unknown)=nxM=0.8492x159.8=136 (3sf)
Percent for Composition
The percent of composition for a compound tells us the contribution to the total mass
from each element
Empirical Formulas
An Empirical formula is the simplest ratio of elements in a compound. A molecular
formula is the actual ratio
The molar mass and percentage of composition of unknown compounds can be found
from mass spectrometers. This information is used to find empirical and molecular
formulas
Step 1. Assure you have 100g of the substance, then all percentages becomes mass
2. Divide each element’s mass by its molar mass
3. Divide all answers from 2 by the smallest one
4. Judge the numbers to a whole number.
5. Find the ratio of empirical formula Mr to given Mr to get a multiplier from the
molecular formula
2. m(BaCl2)=4.16g
n(BaCl2)=m/M=4.146/208.3=0.0199mol
3. 0.0199/0.0199:0.0398/0.0199=1:2
So the hydrated formula is:
BaCl2 • 2H2O
Non-Metals
Non-metals elements are located on the right of the periodic table’s zigzag. They have
different properties to metals:
- Generally do not conduct (except graphite)
- Have much lower melting and boiling points, except diamond and quartz (SiO2)
- Are more often molecular structures rather than extended lattices
- Often have different colours and are non-shiny
- They form acidic compounds (metals then to form alkali compounds)
Oxygen
Oxygen forms a diatomic gas as an element. It has a melting point of -206°c and a boiling
point of -186°c. Oxygen’s density = 0.0032 gcm3. An allotrope (different physical form of
same element in same state) of oxygen is Ozone (O3)
Ozone is a dangerous respirator irritant in low levels. Often produce by electrical spark or
UV light. Its pale blue and sweet sickly smelling.
The ozone layer filters dangerous UVA and UVB light by absorption. Excessive CFCs
has caused a depletion of O3, thus creating the ‘Ozone Hole.’
Nitrogen is made commercially by the fractional distillation of liquid air. In the lab it’s
made by heating Sodium Nitrate with Ammonium Chloride.
NH4NO2 N2 + 2H2O
Nitrogen is an essential element in plant (and animal) growth for making proteins. To
obtain nitrogen plants require soluble nitrates (NO3-) which can be uptake from the soil.
Nitrogen is ‘fixed’ to nitrates by: - Lightning
- Nitrogen fixing bacteria in legumes plants
- Addition of Ammonium or Nitrate based fertilizer
- Decaying of dead organisms releases some
Nitrates and also denitrifying bacteria release N2 to
the air
Nitrogen Oxides
Nitrogen car reacts with oxygen with the presence of an electrical discharge (spark).
Mostly in lightning strikes (N2 fixing) but also large amounts inside car engines.
Commonly known as NOx there are three main forms:
In areas with significant vehicle congestion, then NO2 causes acid rain and
Photochemical Smog
Ammonia
Ammonia NH3 is a pungent colourless gas. That is denser than air. Ammonia acts as a
base and reacts with water to form Ammonium Hydroxide:
Ammonia vapour is very soluble and will generate a vacuum over water
Haber Process
Ammonia is produced commercially by the Haber Process. The raw materials are
Methane gas and Water.
Step 1 - CH4 and Water are steam reformed to make synthesis gas
CH4 + H2O CO + 3H2
Synthesis Gas
Step 2 - Air (mix of O2 and N2) is added to the mixture. This further reacts with
the CO and some of the H2
CO + O2 CO2 - Removed for later use
2H2 + O2 H2O - Recycled back into Step 1
Now reaction mixture contains leftover H2, and unreacted N2
Step 3 - The ‘Haber Step’, the N2 and H2 is brought together in 1:3 ratio over an
Iron III Oxide catalyst
N2(g) + 3H2(g) (Fe2O3) 2NH3(g)
Ammonia through Ammonium Nitrate is also used to make explosives such as artillery
shells and bombs
NH3 also used: - For a Refrigerant
- As a household cleaner
- Manufacture of dyes and nylon
Sulfur
Sulfur is a yellow powder at room temperature. It is insoluble in water but will dissolve in
non-polar solvents such as Carbon Disulfide. It has a mp=112°c and bp=445°c. Sulfur
exists as an S8 molecule in a ‘puckered’ ring shape
Sulfur Extraction
Sulfur occurs naturally around volcanic areas and as impurities in fossil fuels
It can be extracted: - By open mining
- Frasch process which uses super heated steam to drive liquid S
from underground deposits
- Obtained by reducing H2S impurities in natural gas.
Sulfur Reactions:
- Sulfur reactions with Metals to form Metal Sulfides
Eg. 2Ag + S Ag2S - Silver Tarnish
2Fe + 3S Fe2S3
Zn + S ZnS - Yellow Powder
Metals Sulfides easily react with Acids to make dangerous H2S, rotten egg smells toxic
gas
- Sulfur burns with a blue flame to form Sulfur Dioxide molecules in Oxygen
S + O2 SO2
This is reactive as it’s unstable, but partly stabilised by resonance
Sulfur Dioxide
Sulfur Dioxide SO2 can be prepared in the lap from reactions pf a Sulfur Salt
Na2SO3 + 2HCl 2NaCl + H2O + SO2
As it is more dense than air it is collected by upwards displacement of air
Large amounts of SO2 are produced in industries from impurities in fossil fuels that are
burnt for energy
Sulfuric Acid
H2SO4 is a strong diprotic inorganic acid. It is at maximum strength at approximately
70% when there is full Disassociation (splits into ions)
H2SO4 H+ + HSO-4 2H+ + SO-4
() = H2O
Step 2 - The SO2 is further oxidised over a Vanadium Pent oxide (V2O5) catalyst
bed at 450°c
2SO2 + O2 2SO3
Step 3 - The SO3 is dissolved into concentrated Sulfuric Acid to make Oleum
SO3 + H2SO4 H2S2O7 - Oleum
It cannot be dissolved directly in water as it is exothermic forming an
useable fog
Cl2 is a very strong oxidant and will react with most substance like, metals including inert
ones, non-metals and common reductants eg SO2-4
Lab Production
It is made by oxidising concentrated HCl with KMnO4 (Potassium Permanganate) or
MnO2 (Manganese Dioxide) with heat
Beam.A